openclaw/helpyourneighbour
1
0
Fork 0
Code Issues Pull requests Projects Releases Packages Wiki Activity Actions

feat(auth): implement user authentication system

Browse source
This commit is contained in:
J.A.R.V.I.S. 2026-03-19 23:07:24 +00:00
parent 97116fed1c
commit 4847ab793a
7199 changed files with 38207 additions and 747767 deletions
Download patch file Download diff file Expand all files Collapse all files

1
node_modules/nodemon/node_modules/.bin/semver generated vendored Symbolic link
View file

@ -0,0 +1 @@
../semver/bin/semver.js

23
node_modules/nodemon/node_modules/balanced-match/LICENSE.md generated vendored Normal file
View file

@ -0,0 +1,23 @@
(MIT)
Original code Copyright Julian Gruber <julian@juliangruber.com>
Port to TypeScript Copyright Isaac Z. Schlueter <i@izs.me>
Permission is hereby granted, free of charge, to any person obtaining a copy of
this software and associated documentation files (the "Software"), to deal in
the Software without restriction, including without limitation the rights to
use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
of the Software, and to permit persons to whom the Software is furnished to do
so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in all
copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
SOFTWARE.

57
node_modules/nodemon/node_modules/balanced-match/README.md generated vendored Normal file
View file

@ -0,0 +1,57 @@
# balanced-match
Match balanced string pairs, like `{` and `}` or `<b>` and
`</b>`. Supports regular expressions as well!
## Example
Get the first matching pair of braces:
```js
import { balanced } from 'balanced-match'
console.log(balanced('{', '}', 'pre{in{nested}}post'))
console.log(balanced('{', '}', 'pre{first}between{second}post'))
console.log(
balanced(/\s+\{\s+/, /\s+\}\s+/, 'pre { in{nest} } post'),
)
```
The matches are:
```bash
$ node example.js
{ start: 3, end: 14, pre: 'pre', body: 'in{nested}', post: 'post' }
{ start: 3,
end: 9,
pre: 'pre',
body: 'first',
post: 'between{second}post' }
{ start: 3, end: 17, pre: 'pre', body: 'in{nest}', post: 'post' }
```
## API
### const m = balanced(a, b, str)
For the first non-nested matching pair of `a` and `b` in `str`, return an
object with those keys:
- **start** the index of the first match of `a`
- **end** the index of the matching `b`
- **pre** the preamble, `a` and `b` not included
- **body** the match, `a` and `b` not included
- **post** the postscript, `a` and `b` not included
If there's no match, `undefined` will be returned.
If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `['{', 'a', '']` and `{a}}` will match `['', 'a', '}']`.
### const r = balanced.range(a, b, str)
For the first non-nested matching pair of `a` and `b` in `str`, return an
array with indexes: `[ <a index>, <b index> ]`.
If there's no match, `undefined` will be returned.
If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `[ 1, 3 ]` and `{a}}` will match `[0, 2]`.

9
node_modules/nodemon/node_modules/balanced-match/dist/commonjs/index.d.ts generated vendored Normal file
View file

@ -0,0 +1,9 @@
export declare const balanced: (a: string | RegExp, b: string | RegExp, str: string) => false | {
start: number;
end: number;
pre: string;
body: string;
post: string;
} | undefined;
export declare const range: (a: string, b: string, str: string) => undefined | [number, number];
//# sourceMappingURL=index.d.ts.map

1
node_modules/nodemon/node_modules/balanced-match/dist/commonjs/index.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"index.d.ts","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":"AAAA,eAAO,MAAM,QAAQ,GACnB,GAAG,MAAM,GAAG,MAAM,EAClB,GAAG,MAAM,GAAG,MAAM,EAClB,KAAK,MAAM;;;;;;aAgBZ,CAAA;AAOD,eAAO,MAAM,KAAK,GAChB,GAAG,MAAM,EACT,GAAG,MAAM,EACT,KAAK,MAAM,KACV,SAAS,GAAG,CAAC,MAAM,EAAE,MAAM,CA2C7B,CAAA"}

59
node_modules/nodemon/node_modules/balanced-match/dist/commonjs/index.js generated vendored Normal file
View file

@ -0,0 +1,59 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.range = exports.balanced = void 0;
const balanced = (a, b, str) => {
const ma = a instanceof RegExp ? maybeMatch(a, str) : a;
const mb = b instanceof RegExp ? maybeMatch(b, str) : b;
const r = ma !== null && mb != null && (0, exports.range)(ma, mb, str);
return (r && {
start: r[0],
end: r[1],
pre: str.slice(0, r[0]),
body: str.slice(r[0] + ma.length, r[1]),
post: str.slice(r[1] + mb.length),
});
};
exports.balanced = balanced;
const maybeMatch = (reg, str) => {
const m = str.match(reg);
return m ? m[0] : null;
};
const range = (a, b, str) => {
let begs, beg, left, right = undefined, result;
let ai = str.indexOf(a);
let bi = str.indexOf(b, ai + 1);
let i = ai;
if (ai >= 0 && bi > 0) {
if (a === b) {
return [ai, bi];
}
begs = [];
left = str.length;
while (i >= 0 && !result) {
if (i === ai) {
begs.push(i);
ai = str.indexOf(a, i + 1);
}
else if (begs.length === 1) {
const r = begs.pop();
if (r !== undefined)
result = [r, bi];
}
else {
beg = begs.pop();
if (beg !== undefined && beg < left) {
left = beg;
right = bi;
}
bi = str.indexOf(b, i + 1);
}
i = ai < bi && ai >= 0 ? ai : bi;
}
if (begs.length && right !== undefined) {
result = [left, right];
}
}
return result;
};
exports.range = range;
//# sourceMappingURL=index.js.map

1
node_modules/nodemon/node_modules/balanced-match/dist/commonjs/index.js.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"index.js","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":";;;AAAO,MAAM,QAAQ,GAAG,CACtB,CAAkB,EAClB,CAAkB,EAClB,GAAW,EACX,EAAE;IACF,MAAM,EAAE,GAAG,CAAC,YAAY,MAAM,CAAC,CAAC,CAAC,UAAU,CAAC,CAAC,EAAE,GAAG,CAAC,CAAC,CAAC,CAAC,CAAC,CAAA;IACvD,MAAM,EAAE,GAAG,CAAC,YAAY,MAAM,CAAC,CAAC,CAAC,UAAU,CAAC,CAAC,EAAE,GAAG,CAAC,CAAC,CAAC,CAAC,CAAC,CAAA;IAEvD,MAAM,CAAC,GAAG,EAAE,KAAK,IAAI,IAAI,EAAE,IAAI,IAAI,IAAI,IAAA,aAAK,EAAC,EAAE,EAAE,EAAE,EAAE,GAAG,CAAC,CAAA;IAEzD,OAAO,CACL,CAAC,IAAI;QACH,KAAK,EAAE,CAAC,CAAC,CAAC,CAAC;QACX,GAAG,EAAE,CAAC,CAAC,CAAC,CAAC;QACT,GAAG,EAAE,GAAG,CAAC,KAAK,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,CAAC,CAAC;QACvB,IAAI,EAAE,GAAG,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,MAAM,EAAE,CAAC,CAAC,CAAC,CAAC,CAAC;QACvC,IAAI,EAAE,GAAG,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,MAAM,CAAC;KAClC,CACF,CAAA;AACH,CAAC,CAAA;AAnBY,QAAA,QAAQ,YAmBpB;AAED,MAAM,UAAU,GAAG,CAAC,GAAW,EAAE,GAAW,EAAE,EAAE;IAC9C,MAAM,CAAC,GAAG,GAAG,CAAC,KAAK,CAAC,GAAG,CAAC,CAAA;IACxB,OAAO,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,IAAI,CAAA;AACxB,CAAC,CAAA;AAEM,MAAM,KAAK,GAAG,CACnB,CAAS,EACT,CAAS,EACT,GAAW,EACmB,EAAE;IAChC,IAAI,IAAc,EAChB,GAAuB,EACvB,IAAY,EACZ,KAAK,GAAuB,SAAS,EACrC,MAAoC,CAAA;IACtC,IAAI,EAAE,GAAG,GAAG,CAAC,OAAO,CAAC,CAAC,CAAC,CAAA;IACvB,IAAI,EAAE,GAAG,GAAG,CAAC,OAAO,CAAC,CAAC,EAAE,EAAE,GAAG,CAAC,CAAC,CAAA;IAC/B,IAAI,CAAC,GAAG,EAAE,CAAA;IAEV,IAAI,EAAE,IAAI,CAAC,IAAI,EAAE,GAAG,CAAC,EAAE,CAAC;QACtB,IAAI,CAAC,KAAK,CAAC,EAAE,CAAC;YACZ,OAAO,CAAC,EAAE,EAAE,EAAE,CAAC,CAAA;QACjB,CAAC;QACD,IAAI,GAAG,EAAE,CAAA;QACT,IAAI,GAAG,GAAG,CAAC,MAAM,CAAA;QAEjB,OAAO,CAAC,IAAI,CAAC,IAAI,CAAC,MAAM,EAAE,CAAC;YACzB,IAAI,CAAC,KAAK,EAAE,EAAE,CAAC;gBACb,IAAI,CAAC,IAAI,CAAC,CAAC,CAAC,CAAA;gBACZ,EAAE,GAAG,GAAG,CAAC,OAAO,CAAC,CAAC,EAAE,CAAC,GAAG,CAAC,CAAC,CAAA;YAC5B,CAAC;iBAAM,IAAI,IAAI,CAAC,MAAM,KAAK,CAAC,EAAE,CAAC;gBAC7B,MAAM,CAAC,GAAG,IAAI,CAAC,GAAG,EAAE,CAAA;gBACpB,IAAI,CAAC,KAAK,SAAS;oBAAE,MAAM,GAAG,CAAC,CAAC,EAAE,EAAE,CAAC,CAAA;YACvC,CAAC;iBAAM,CAAC;gBACN,GAAG,GAAG,IAAI,CAAC,GAAG,EAAE,CAAA;gBAChB,IAAI,GAAG,KAAK,SAAS,IAAI,GAAG,GAAG,IAAI,EAAE,CAAC;oBACpC,IAAI,GAAG,GAAG,CAAA;oBACV,KAAK,GAAG,EAAE,CAAA;gBACZ,CAAC;gBAED,EAAE,GAAG,GAAG,CAAC,OAAO,CAAC,CAAC,EAAE,CAAC,GAAG,CAAC,CAAC,CAAA;YAC5B,CAAC;YAED,CAAC,GAAG,EAAE,GAAG,EAAE,IAAI,EAAE,IAAI,CAAC,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,EAAE,CAAA;QAClC,CAAC;QAED,IAAI,IAAI,CAAC,MAAM,IAAI,KAAK,KAAK,SAAS,EAAE,CAAC;YACvC,MAAM,GAAG,CAAC,IAAI,EAAE,KAAK,CAAC,CAAA;QACxB,CAAC;IACH,CAAC;IAED,OAAO,MAAM,CAAA;AACf,CAAC,CAAA;AA/CY,QAAA,KAAK,SA+CjB","sourcesContent":["export const balanced = (\n a: string | RegExp,\n b: string | RegExp,\n str: string,\n) => {\n const ma = a instanceof RegExp ? maybeMatch(a, str) : a\n const mb = b instanceof RegExp ? maybeMatch(b, str) : b\n\n const r = ma !== null && mb != null && range(ma, mb, str)\n\n return (\n r && {\n start: r[0],\n end: r[1],\n pre: str.slice(0, r[0]),\n body: str.slice(r[0] + ma.length, r[1]),\n post: str.slice(r[1] + mb.length),\n }\n )\n}\n\nconst maybeMatch = (reg: RegExp, str: string) => {\n const m = str.match(reg)\n return m ? m[0] : null\n}\n\nexport const range = (\n a: string,\n b: string,\n str: string,\n): undefined | [number, number] => {\n let begs: number[],\n beg: number | undefined,\n left: number,\n right: number | undefined = undefined,\n result: undefined | [number, number]\n let ai = str.indexOf(a)\n let bi = str.indexOf(b, ai + 1)\n let i = ai\n\n if (ai >= 0 && bi > 0) {\n if (a === b) {\n return [ai, bi]\n }\n begs = []\n left = str.length\n\n while (i >= 0 && !result) {\n if (i === ai) {\n begs.push(i)\n ai = str.indexOf(a, i + 1)\n } else if (begs.length === 1) {\n const r = begs.pop()\n if (r !== undefined) result = [r, bi]\n } else {\n beg = begs.pop()\n if (beg !== undefined && beg < left) {\n left = beg\n right = bi\n }\n\n bi = str.indexOf(b, i + 1)\n }\n\n i = ai < bi && ai >= 0 ? ai : bi\n }\n\n if (begs.length && right !== undefined) {\n result = [left, right]\n }\n }\n\n return result\n}\n"]}

3
node_modules/nodemon/node_modules/balanced-match/dist/commonjs/package.json generated vendored Normal file
View file

@ -0,0 +1,3 @@
{
"type": "commonjs"
}

9
node_modules/nodemon/node_modules/balanced-match/dist/esm/index.d.ts generated vendored Normal file
View file

@ -0,0 +1,9 @@
export declare const balanced: (a: string | RegExp, b: string | RegExp, str: string) => false | {
start: number;
end: number;
pre: string;
body: string;
post: string;
} | undefined;
export declare const range: (a: string, b: string, str: string) => undefined | [number, number];
//# sourceMappingURL=index.d.ts.map

1
node_modules/nodemon/node_modules/balanced-match/dist/esm/index.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"index.d.ts","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":"AAAA,eAAO,MAAM,QAAQ,GACnB,GAAG,MAAM,GAAG,MAAM,EAClB,GAAG,MAAM,GAAG,MAAM,EAClB,KAAK,MAAM;;;;;;aAgBZ,CAAA;AAOD,eAAO,MAAM,KAAK,GAChB,GAAG,MAAM,EACT,GAAG,MAAM,EACT,KAAK,MAAM,KACV,SAAS,GAAG,CAAC,MAAM,EAAE,MAAM,CA2C7B,CAAA"}

54
node_modules/nodemon/node_modules/balanced-match/dist/esm/index.js generated vendored Normal file
View file

@ -0,0 +1,54 @@
export const balanced = (a, b, str) => {
const ma = a instanceof RegExp ? maybeMatch(a, str) : a;
const mb = b instanceof RegExp ? maybeMatch(b, str) : b;
const r = ma !== null && mb != null && range(ma, mb, str);
return (r && {
start: r[0],
end: r[1],
pre: str.slice(0, r[0]),
body: str.slice(r[0] + ma.length, r[1]),
post: str.slice(r[1] + mb.length),
});
};
const maybeMatch = (reg, str) => {
const m = str.match(reg);
return m ? m[0] : null;
};
export const range = (a, b, str) => {
let begs, beg, left, right = undefined, result;
let ai = str.indexOf(a);
let bi = str.indexOf(b, ai + 1);
let i = ai;
if (ai >= 0 && bi > 0) {
if (a === b) {
return [ai, bi];
}
begs = [];
left = str.length;
while (i >= 0 && !result) {
if (i === ai) {
begs.push(i);
ai = str.indexOf(a, i + 1);
}
else if (begs.length === 1) {
const r = begs.pop();
if (r !== undefined)
result = [r, bi];
}
else {
beg = begs.pop();
if (beg !== undefined && beg < left) {
left = beg;
right = bi;
}
bi = str.indexOf(b, i + 1);
}
i = ai < bi && ai >= 0 ? ai : bi;
}
if (begs.length && right !== undefined) {
result = [left, right];
}
}
return result;
};
//# sourceMappingURL=index.js.map

1
node_modules/nodemon/node_modules/balanced-match/dist/esm/index.js.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"index.js","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":"AAAA,MAAM,CAAC,MAAM,QAAQ,GAAG,CACtB,CAAkB,EAClB,CAAkB,EAClB,GAAW,EACX,EAAE;IACF,MAAM,EAAE,GAAG,CAAC,YAAY,MAAM,CAAC,CAAC,CAAC,UAAU,CAAC,CAAC,EAAE,GAAG,CAAC,CAAC,CAAC,CAAC,CAAC,CAAA;IACvD,MAAM,EAAE,GAAG,CAAC,YAAY,MAAM,CAAC,CAAC,CAAC,UAAU,CAAC,CAAC,EAAE,GAAG,CAAC,CAAC,CAAC,CAAC,CAAC,CAAA;IAEvD,MAAM,CAAC,GAAG,EAAE,KAAK,IAAI,IAAI,EAAE,IAAI,IAAI,IAAI,KAAK,CAAC,EAAE,EAAE,EAAE,EAAE,GAAG,CAAC,CAAA;IAEzD,OAAO,CACL,CAAC,IAAI;QACH,KAAK,EAAE,CAAC,CAAC,CAAC,CAAC;QACX,GAAG,EAAE,CAAC,CAAC,CAAC,CAAC;QACT,GAAG,EAAE,GAAG,CAAC,KAAK,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,CAAC,CAAC;QACvB,IAAI,EAAE,GAAG,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,MAAM,EAAE,CAAC,CAAC,CAAC,CAAC,CAAC;QACvC,IAAI,EAAE,GAAG,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,MAAM,CAAC;KAClC,CACF,CAAA;AACH,CAAC,CAAA;AAED,MAAM,UAAU,GAAG,CAAC,GAAW,EAAE,GAAW,EAAE,EAAE;IAC9C,MAAM,CAAC,GAAG,GAAG,CAAC,KAAK,CAAC,GAAG,CAAC,CAAA;IACxB,OAAO,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC,IAAI,CAAA;AACxB,CAAC,CAAA;AAED,MAAM,CAAC,MAAM,KAAK,GAAG,CACnB,CAAS,EACT,CAAS,EACT,GAAW,EACmB,EAAE;IAChC,IAAI,IAAc,EAChB,GAAuB,EACvB,IAAY,EACZ,KAAK,GAAuB,SAAS,EACrC,MAAoC,CAAA;IACtC,IAAI,EAAE,GAAG,GAAG,CAAC,OAAO,CAAC,CAAC,CAAC,CAAA;IACvB,IAAI,EAAE,GAAG,GAAG,CAAC,OAAO,CAAC,CAAC,EAAE,EAAE,GAAG,CAAC,CAAC,CAAA;IAC/B,IAAI,CAAC,GAAG,EAAE,CAAA;IAEV,IAAI,EAAE,IAAI,CAAC,IAAI,EAAE,GAAG,CAAC,EAAE,CAAC;QACtB,IAAI,CAAC,KAAK,CAAC,EAAE,CAAC;YACZ,OAAO,CAAC,EAAE,EAAE,EAAE,CAAC,CAAA;QACjB,CAAC;QACD,IAAI,GAAG,EAAE,CAAA;QACT,IAAI,GAAG,GAAG,CAAC,MAAM,CAAA;QAEjB,OAAO,CAAC,IAAI,CAAC,IAAI,CAAC,MAAM,EAAE,CAAC;YACzB,IAAI,CAAC,KAAK,EAAE,EAAE,CAAC;gBACb,IAAI,CAAC,IAAI,CAAC,CAAC,CAAC,CAAA;gBACZ,EAAE,GAAG,GAAG,CAAC,OAAO,CAAC,CAAC,EAAE,CAAC,GAAG,CAAC,CAAC,CAAA;YAC5B,CAAC;iBAAM,IAAI,IAAI,CAAC,MAAM,KAAK,CAAC,EAAE,CAAC;gBAC7B,MAAM,CAAC,GAAG,IAAI,CAAC,GAAG,EAAE,CAAA;gBACpB,IAAI,CAAC,KAAK,SAAS;oBAAE,MAAM,GAAG,CAAC,CAAC,EAAE,EAAE,CAAC,CAAA;YACvC,CAAC;iBAAM,CAAC;gBACN,GAAG,GAAG,IAAI,CAAC,GAAG,EAAE,CAAA;gBAChB,IAAI,GAAG,KAAK,SAAS,IAAI,GAAG,GAAG,IAAI,EAAE,CAAC;oBACpC,IAAI,GAAG,GAAG,CAAA;oBACV,KAAK,GAAG,EAAE,CAAA;gBACZ,CAAC;gBAED,EAAE,GAAG,GAAG,CAAC,OAAO,CAAC,CAAC,EAAE,CAAC,GAAG,CAAC,CAAC,CAAA;YAC5B,CAAC;YAED,CAAC,GAAG,EAAE,GAAG,EAAE,IAAI,EAAE,IAAI,CAAC,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,EAAE,CAAA;QAClC,CAAC;QAED,IAAI,IAAI,CAAC,MAAM,IAAI,KAAK,KAAK,SAAS,EAAE,CAAC;YACvC,MAAM,GAAG,CAAC,IAAI,EAAE,KAAK,CAAC,CAAA;QACxB,CAAC;IACH,CAAC;IAED,OAAO,MAAM,CAAA;AACf,CAAC,CAAA","sourcesContent":["export const balanced = (\n a: string | RegExp,\n b: string | RegExp,\n str: string,\n) => {\n const ma = a instanceof RegExp ? maybeMatch(a, str) : a\n const mb = b instanceof RegExp ? maybeMatch(b, str) : b\n\n const r = ma !== null && mb != null && range(ma, mb, str)\n\n return (\n r && {\n start: r[0],\n end: r[1],\n pre: str.slice(0, r[0]),\n body: str.slice(r[0] + ma.length, r[1]),\n post: str.slice(r[1] + mb.length),\n }\n )\n}\n\nconst maybeMatch = (reg: RegExp, str: string) => {\n const m = str.match(reg)\n return m ? m[0] : null\n}\n\nexport const range = (\n a: string,\n b: string,\n str: string,\n): undefined | [number, number] => {\n let begs: number[],\n beg: number | undefined,\n left: number,\n right: number | undefined = undefined,\n result: undefined | [number, number]\n let ai = str.indexOf(a)\n let bi = str.indexOf(b, ai + 1)\n let i = ai\n\n if (ai >= 0 && bi > 0) {\n if (a === b) {\n return [ai, bi]\n }\n begs = []\n left = str.length\n\n while (i >= 0 && !result) {\n if (i === ai) {\n begs.push(i)\n ai = str.indexOf(a, i + 1)\n } else if (begs.length === 1) {\n const r = begs.pop()\n if (r !== undefined) result = [r, bi]\n } else {\n beg = begs.pop()\n if (beg !== undefined && beg < left) {\n left = beg\n right = bi\n }\n\n bi = str.indexOf(b, i + 1)\n }\n\n i = ai < bi && ai >= 0 ? ai : bi\n }\n\n if (begs.length && right !== undefined) {\n result = [left, right]\n }\n }\n\n return result\n}\n"]}

3
node_modules/nodemon/node_modules/balanced-match/dist/esm/package.json generated vendored Normal file
View file

@ -0,0 +1,3 @@
{
"type": "module"
}

68
node_modules/nodemon/node_modules/balanced-match/package.json generated vendored Normal file
View file

@ -0,0 +1,68 @@
{
"name": "balanced-match",
"description": "Match balanced character pairs, like \"{\" and \"}\"",
"version": "4.0.4",
"files": [
"dist"
],
"repository": {
"type": "git",
"url": "git://github.com/juliangruber/balanced-match.git"
},
"exports": {
"./package.json": "./package.json",
".": {
"import": {
"types": "./dist/esm/index.d.ts",
"default": "./dist/esm/index.js"
},
"require": {
"types": "./dist/commonjs/index.d.ts",
"default": "./dist/commonjs/index.js"
}
}
},
"type": "module",
"scripts": {
"preversion": "npm test",
"postversion": "npm publish",
"prepublishOnly": "git push origin --follow-tags",
"prepare": "tshy",
"pretest": "npm run prepare",
"presnap": "npm run prepare",
"test": "tap",
"snap": "tap",
"format": "prettier --write .",
"benchmark": "node benchmark/index.js",
"typedoc": "typedoc --tsconfig .tshy/esm.json ./src/*.ts"
},
"devDependencies": {
"@types/brace-expansion": "^1.1.2",
"@types/node": "^25.2.1",
"mkdirp": "^3.0.1",
"prettier": "^3.3.2",
"tap": "^21.6.2",
"tshy": "^3.0.2",
"typedoc": "^0.28.5"
},
"keywords": [
"match",
"regexp",
"test",
"balanced",
"parse"
],
"license": "MIT",
"engines": {
"node": "18 || 20 || >=22"
},
"tshy": {
"exports": {
"./package.json": "./package.json",
".": "./src/index.ts"
}
},
"main": "./dist/commonjs/index.js",
"types": "./dist/commonjs/index.d.ts",
"module": "./dist/esm/index.js"
}

23
node_modules/nodemon/node_modules/brace-expansion/LICENSE generated vendored Normal file
View file

@ -0,0 +1,23 @@
MIT License
Copyright Julian Gruber <julian@juliangruber.com>
TypeScript port Copyright Isaac Z. Schlueter <i@izs.me>
Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in all
copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
SOFTWARE.

94
node_modules/nodemon/node_modules/brace-expansion/README.md generated vendored Normal file
View file

@ -0,0 +1,94 @@
# brace-expansion
[Brace expansion](https://www.gnu.org/software/bash/manual/html_node/Brace-Expansion.html),
as known from sh/bash, in JavaScript.
[![CI](https://github.com/juliangruber/brace-expansion/actions/workflows/ci.yml/badge.svg)](https://github.com/juliangruber/brace-expansion/actions/workflows/ci.yml)
[![downloads](https://img.shields.io/npm/dm/brace-expansion.svg)](https://www.npmjs.org/package/brace-expansion)
## Example
```js
import { expand } from 'brace-expansion'
expand('file-{a,b,c}.jpg')
// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg']
expand('-v{,,}')
// => ['-v', '-v', '-v']
expand('file{0..2}.jpg')
// => ['file0.jpg', 'file1.jpg', 'file2.jpg']
expand('file-{a..c}.jpg')
// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg']
expand('file{2..0}.jpg')
// => ['file2.jpg', 'file1.jpg', 'file0.jpg']
expand('file{0..4..2}.jpg')
// => ['file0.jpg', 'file2.jpg', 'file4.jpg']
expand('file-{a..e..2}.jpg')
// => ['file-a.jpg', 'file-c.jpg', 'file-e.jpg']
expand('file{00..10..5}.jpg')
// => ['file00.jpg', 'file05.jpg', 'file10.jpg']
expand('{{A..C},{a..c}}')
// => ['A', 'B', 'C', 'a', 'b', 'c']
expand('ppp{,config,oe{,conf}}')
// => ['ppp', 'pppconfig', 'pppoe', 'pppoeconf']
```
## API
```js
import { expand } from 'brace-expansion'
```
### const expanded = expand(str, [options])
Return an array of all possible and valid expansions of `str`. If
none are found, `[str]` is returned.
The `options` object can provide a `max` value to cap the number
of expansions allowed. This is limited to `100_000` by default,
to prevent DoS attacks.
```js
const expansions = expand('{1..100}'.repeat(5), {
max: 100,
})
// expansions.length will be 100, not 100^5
```
Valid expansions are:
```js
;/^(.*,)+(.+)?$/
// {a,b,...}
```
A comma separated list of options, like `{a,b}` or `{a,{b,c}}` or `{,a,}`.
```js
;/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/
// {x..y[..incr]}
```
A numeric sequence from `x` to `y` inclusive, with optional increment.
If `x` or `y` start with a leading `0`, all the numbers will be padded
to have equal length. Negative numbers and backwards iteration work too.
```js
;/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/
// {x..y[..incr]}
```
An alphabetic sequence from `x` to `y` inclusive, with optional increment.
`x` and `y` must be exactly one character, and if given, `incr` must be a
number.
For compatibility reasons, the string `${` is not eligible for brace expansion.

6
node_modules/nodemon/node_modules/brace-expansion/dist/commonjs/index.d.ts generated vendored Normal file
View file

@ -0,0 +1,6 @@
export declare const EXPANSION_MAX = 100000;
export type BraceExpansionOptions = {
max?: number;
};
export declare function expand(str: string, options?: BraceExpansionOptions): string[];
//# sourceMappingURL=index.d.ts.map

1
node_modules/nodemon/node_modules/brace-expansion/dist/commonjs/index.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"index.d.ts","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":"AAkBA,eAAO,MAAM,aAAa,SAAU,CAAA;AAwDpC,MAAM,MAAM,qBAAqB,GAAG;IAClC,GAAG,CAAC,EAAE,MAAM,CAAA;CACb,CAAA;AAED,wBAAgB,MAAM,CAAC,GAAG,EAAE,MAAM,EAAE,OAAO,GAAE,qBAA0B,YAkBtE"}

199
node_modules/nodemon/node_modules/brace-expansion/dist/commonjs/index.js generated vendored Normal file
View file

@ -0,0 +1,199 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.EXPANSION_MAX = void 0;
exports.expand = expand;
const balanced_match_1 = require("balanced-match");
const escSlash = '\0SLASH' + Math.random() + '\0';
const escOpen = '\0OPEN' + Math.random() + '\0';
const escClose = '\0CLOSE' + Math.random() + '\0';
const escComma = '\0COMMA' + Math.random() + '\0';
const escPeriod = '\0PERIOD' + Math.random() + '\0';
const escSlashPattern = new RegExp(escSlash, 'g');
const escOpenPattern = new RegExp(escOpen, 'g');
const escClosePattern = new RegExp(escClose, 'g');
const escCommaPattern = new RegExp(escComma, 'g');
const escPeriodPattern = new RegExp(escPeriod, 'g');
const slashPattern = /\\\\/g;
const openPattern = /\\{/g;
const closePattern = /\\}/g;
const commaPattern = /\\,/g;
const periodPattern = /\\\./g;
exports.EXPANSION_MAX = 100_000;
function numeric(str) {
return !isNaN(str) ? parseInt(str, 10) : str.charCodeAt(0);
}
function escapeBraces(str) {
return str
.replace(slashPattern, escSlash)
.replace(openPattern, escOpen)
.replace(closePattern, escClose)
.replace(commaPattern, escComma)
.replace(periodPattern, escPeriod);
}
function unescapeBraces(str) {
return str
.replace(escSlashPattern, '\\')
.replace(escOpenPattern, '{')
.replace(escClosePattern, '}')
.replace(escCommaPattern, ',')
.replace(escPeriodPattern, '.');
}
/**
* Basically just str.split(","), but handling cases
* where we have nested braced sections, which should be
* treated as individual members, like {a,{b,c},d}
*/
function parseCommaParts(str) {
if (!str) {
return [''];
}
const parts = [];
const m = (0, balanced_match_1.balanced)('{', '}', str);
if (!m) {
return str.split(',');
}
const { pre, body, post } = m;
const p = pre.split(',');
p[p.length - 1] += '{' + body + '}';
const postParts = parseCommaParts(post);
if (post.length) {
;
p[p.length - 1] += postParts.shift();
p.push.apply(p, postParts);
}
parts.push.apply(parts, p);
return parts;
}
function expand(str, options = {}) {
if (!str) {
return [];
}
const { max = exports.EXPANSION_MAX } = options;
// I don't know why Bash 4.3 does this, but it does.
// Anything starting with {} will have the first two bytes preserved
// but *only* at the top level, so {},a}b will not expand to anything,
// but a{},b}c will be expanded to [a}c,abc].
// One could argue that this is a bug in Bash, but since the goal of
// this module is to match Bash's rules, we escape a leading {}
if (str.slice(0, 2) === '{}') {
str = '\\{\\}' + str.slice(2);
}
return expand_(escapeBraces(str), max, true).map(unescapeBraces);
}
function embrace(str) {
return '{' + str + '}';
}
function isPadded(el) {
return /^-?0\d/.test(el);
}
function lte(i, y) {
return i <= y;
}
function gte(i, y) {
return i >= y;
}
function expand_(str, max, isTop) {
/** @type {string[]} */
const expansions = [];
const m = (0, balanced_match_1.balanced)('{', '}', str);
if (!m)
return [str];
// no need to expand pre, since it is guaranteed to be free of brace-sets
const pre = m.pre;
const post = m.post.length ? expand_(m.post, max, false) : [''];
if (/\$$/.test(m.pre)) {
for (let k = 0; k < post.length && k < max; k++) {
const expansion = pre + '{' + m.body + '}' + post[k];
expansions.push(expansion);
}
}
else {
const isNumericSequence = /^-?\d+\.\.-?\d+(?:\.\.-?\d+)?$/.test(m.body);
const isAlphaSequence = /^[a-zA-Z]\.\.[a-zA-Z](?:\.\.-?\d+)?$/.test(m.body);
const isSequence = isNumericSequence || isAlphaSequence;
const isOptions = m.body.indexOf(',') >= 0;
if (!isSequence && !isOptions) {
// {a},b}
if (m.post.match(/,(?!,).*\}/)) {
str = m.pre + '{' + m.body + escClose + m.post;
return expand_(str, max, true);
}
return [str];
}
let n;
if (isSequence) {
n = m.body.split(/\.\./);
}
else {
n = parseCommaParts(m.body);
if (n.length === 1 && n[0] !== undefined) {
// x{{a,b}}y ==> x{a}y x{b}y
n = expand_(n[0], max, false).map(embrace);
//XXX is this necessary? Can't seem to hit it in tests.
/* c8 ignore start */
if (n.length === 1) {
return post.map(p => m.pre + n[0] + p);
}
/* c8 ignore stop */
}
}
// at this point, n is the parts, and we know it's not a comma set
// with a single entry.
let N;
if (isSequence && n[0] !== undefined && n[1] !== undefined) {
const x = numeric(n[0]);
const y = numeric(n[1]);
const width = Math.max(n[0].length, n[1].length);
let incr = n.length === 3 && n[2] !== undefined ? Math.abs(numeric(n[2])) : 1;
let test = lte;
const reverse = y < x;
if (reverse) {
incr *= -1;
test = gte;
}
const pad = n.some(isPadded);
N = [];
for (let i = x; test(i, y); i += incr) {
let c;
if (isAlphaSequence) {
c = String.fromCharCode(i);
if (c === '\\') {
c = '';
}
}
else {
c = String(i);
if (pad) {
const need = width - c.length;
if (need > 0) {
const z = new Array(need + 1).join('0');
if (i < 0) {
c = '-' + z + c.slice(1);
}
else {
c = z + c;
}
}
}
}
N.push(c);
}
}
else {
N = [];
for (let j = 0; j < n.length; j++) {
N.push.apply(N, expand_(n[j], max, false));
}
}
for (let j = 0; j < N.length; j++) {
for (let k = 0; k < post.length && expansions.length < max; k++) {
const expansion = pre + N[j] + post[k];
if (!isTop || isSequence || expansion) {
expansions.push(expansion);
}
}
}
}
return expansions;
}
//# sourceMappingURL=index.js.map

1
node_modules/nodemon/node_modules/brace-expansion/dist/commonjs/index.js.map generated vendored Normal file
View file

File diff suppressed because one or more lines are too long

3
node_modules/nodemon/node_modules/brace-expansion/dist/commonjs/package.json generated vendored Normal file
View file

@ -0,0 +1,3 @@
{
"type": "commonjs"
}

6
node_modules/nodemon/node_modules/brace-expansion/dist/esm/index.d.ts generated vendored Normal file
View file

@ -0,0 +1,6 @@
export declare const EXPANSION_MAX = 100000;
export type BraceExpansionOptions = {
max?: number;
};
export declare function expand(str: string, options?: BraceExpansionOptions): string[];
//# sourceMappingURL=index.d.ts.map

1
node_modules/nodemon/node_modules/brace-expansion/dist/esm/index.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"index.d.ts","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":"AAkBA,eAAO,MAAM,aAAa,SAAU,CAAA;AAwDpC,MAAM,MAAM,qBAAqB,GAAG;IAClC,GAAG,CAAC,EAAE,MAAM,CAAA;CACb,CAAA;AAED,wBAAgB,MAAM,CAAC,GAAG,EAAE,MAAM,EAAE,OAAO,GAAE,qBAA0B,YAkBtE"}

195
node_modules/nodemon/node_modules/brace-expansion/dist/esm/index.js generated vendored Normal file
View file

@ -0,0 +1,195 @@
import { balanced } from 'balanced-match';
const escSlash = '\0SLASH' + Math.random() + '\0';
const escOpen = '\0OPEN' + Math.random() + '\0';
const escClose = '\0CLOSE' + Math.random() + '\0';
const escComma = '\0COMMA' + Math.random() + '\0';
const escPeriod = '\0PERIOD' + Math.random() + '\0';
const escSlashPattern = new RegExp(escSlash, 'g');
const escOpenPattern = new RegExp(escOpen, 'g');
const escClosePattern = new RegExp(escClose, 'g');
const escCommaPattern = new RegExp(escComma, 'g');
const escPeriodPattern = new RegExp(escPeriod, 'g');
const slashPattern = /\\\\/g;
const openPattern = /\\{/g;
const closePattern = /\\}/g;
const commaPattern = /\\,/g;
const periodPattern = /\\\./g;
export const EXPANSION_MAX = 100_000;
function numeric(str) {
return !isNaN(str) ? parseInt(str, 10) : str.charCodeAt(0);
}
function escapeBraces(str) {
return str
.replace(slashPattern, escSlash)
.replace(openPattern, escOpen)
.replace(closePattern, escClose)
.replace(commaPattern, escComma)
.replace(periodPattern, escPeriod);
}
function unescapeBraces(str) {
return str
.replace(escSlashPattern, '\\')
.replace(escOpenPattern, '{')
.replace(escClosePattern, '}')
.replace(escCommaPattern, ',')
.replace(escPeriodPattern, '.');
}
/**
* Basically just str.split(","), but handling cases
* where we have nested braced sections, which should be
* treated as individual members, like {a,{b,c},d}
*/
function parseCommaParts(str) {
if (!str) {
return [''];
}
const parts = [];
const m = balanced('{', '}', str);
if (!m) {
return str.split(',');
}
const { pre, body, post } = m;
const p = pre.split(',');
p[p.length - 1] += '{' + body + '}';
const postParts = parseCommaParts(post);
if (post.length) {
;
p[p.length - 1] += postParts.shift();
p.push.apply(p, postParts);
}
parts.push.apply(parts, p);
return parts;
}
export function expand(str, options = {}) {
if (!str) {
return [];
}
const { max = EXPANSION_MAX } = options;
// I don't know why Bash 4.3 does this, but it does.
// Anything starting with {} will have the first two bytes preserved
// but *only* at the top level, so {},a}b will not expand to anything,
// but a{},b}c will be expanded to [a}c,abc].
// One could argue that this is a bug in Bash, but since the goal of
// this module is to match Bash's rules, we escape a leading {}
if (str.slice(0, 2) === '{}') {
str = '\\{\\}' + str.slice(2);
}
return expand_(escapeBraces(str), max, true).map(unescapeBraces);
}
function embrace(str) {
return '{' + str + '}';
}
function isPadded(el) {
return /^-?0\d/.test(el);
}
function lte(i, y) {
return i <= y;
}
function gte(i, y) {
return i >= y;
}
function expand_(str, max, isTop) {
/** @type {string[]} */
const expansions = [];
const m = balanced('{', '}', str);
if (!m)
return [str];
// no need to expand pre, since it is guaranteed to be free of brace-sets
const pre = m.pre;
const post = m.post.length ? expand_(m.post, max, false) : [''];
if (/\$$/.test(m.pre)) {
for (let k = 0; k < post.length && k < max; k++) {
const expansion = pre + '{' + m.body + '}' + post[k];
expansions.push(expansion);
}
}
else {
const isNumericSequence = /^-?\d+\.\.-?\d+(?:\.\.-?\d+)?$/.test(m.body);
const isAlphaSequence = /^[a-zA-Z]\.\.[a-zA-Z](?:\.\.-?\d+)?$/.test(m.body);
const isSequence = isNumericSequence || isAlphaSequence;
const isOptions = m.body.indexOf(',') >= 0;
if (!isSequence && !isOptions) {
// {a},b}
if (m.post.match(/,(?!,).*\}/)) {
str = m.pre + '{' + m.body + escClose + m.post;
return expand_(str, max, true);
}
return [str];
}
let n;
if (isSequence) {
n = m.body.split(/\.\./);
}
else {
n = parseCommaParts(m.body);
if (n.length === 1 && n[0] !== undefined) {
// x{{a,b}}y ==> x{a}y x{b}y
n = expand_(n[0], max, false).map(embrace);
//XXX is this necessary? Can't seem to hit it in tests.
/* c8 ignore start */
if (n.length === 1) {
return post.map(p => m.pre + n[0] + p);
}
/* c8 ignore stop */
}
}
// at this point, n is the parts, and we know it's not a comma set
// with a single entry.
let N;
if (isSequence && n[0] !== undefined && n[1] !== undefined) {
const x = numeric(n[0]);
const y = numeric(n[1]);
const width = Math.max(n[0].length, n[1].length);
let incr = n.length === 3 && n[2] !== undefined ? Math.abs(numeric(n[2])) : 1;
let test = lte;
const reverse = y < x;
if (reverse) {
incr *= -1;
test = gte;
}
const pad = n.some(isPadded);
N = [];
for (let i = x; test(i, y); i += incr) {
let c;
if (isAlphaSequence) {
c = String.fromCharCode(i);
if (c === '\\') {
c = '';
}
}
else {
c = String(i);
if (pad) {
const need = width - c.length;
if (need > 0) {
const z = new Array(need + 1).join('0');
if (i < 0) {
c = '-' + z + c.slice(1);
}
else {
c = z + c;
}
}
}
}
N.push(c);
}
}
else {
N = [];
for (let j = 0; j < n.length; j++) {
N.push.apply(N, expand_(n[j], max, false));
}
}
for (let j = 0; j < N.length; j++) {
for (let k = 0; k < post.length && expansions.length < max; k++) {
const expansion = pre + N[j] + post[k];
if (!isTop || isSequence || expansion) {
expansions.push(expansion);
}
}
}
}
return expansions;
}
//# sourceMappingURL=index.js.map

1
node_modules/nodemon/node_modules/brace-expansion/dist/esm/index.js.map generated vendored Normal file
View file

File diff suppressed because one or more lines are too long

3
node_modules/nodemon/node_modules/brace-expansion/dist/esm/package.json generated vendored Normal file
View file

@ -0,0 +1,3 @@
{
"type": "module"
}

64
node_modules/nodemon/node_modules/brace-expansion/package.json generated vendored Normal file
View file

@ -0,0 +1,64 @@
{
"name": "brace-expansion",
"description": "Brace expansion as known from sh/bash",
"version": "5.0.4",
"files": [
"dist"
],
"exports": {
"./package.json": "./package.json",
".": {
"import": {
"types": "./dist/esm/index.d.ts",
"default": "./dist/esm/index.js"
},
"require": {
"types": "./dist/commonjs/index.d.ts",
"default": "./dist/commonjs/index.js"
}
}
},
"type": "module",
"scripts": {
"preversion": "npm test",
"postversion": "npm publish",
"prepublishOnly": "git push origin --follow-tags",
"prepare": "tshy",
"pretest": "npm run prepare",
"presnap": "npm run prepare",
"test": "tap",
"snap": "tap",
"format": "prettier --write .",
"benchmark": "node benchmark/index.js",
"typedoc": "typedoc --tsconfig .tshy/esm.json ./src/*.ts"
},
"devDependencies": {
"@types/brace-expansion": "^1.1.2",
"@types/node": "^25.2.1",
"mkdirp": "^3.0.1",
"prettier": "^3.3.2",
"tap": "^21.6.2",
"tshy": "^3.0.2",
"typedoc": "^0.28.5"
},
"dependencies": {
"balanced-match": "^4.0.2"
},
"license": "MIT",
"engines": {
"node": "18 || 20 || >=22"
},
"tshy": {
"exports": {
"./package.json": "./package.json",
".": "./src/index.ts"
}
},
"main": "./dist/commonjs/index.js",
"types": "./dist/commonjs/index.d.ts",
"module": "./dist/esm/index.js",
"repository": {
"type": "git",
"url": "git+ssh://git@github.com/juliangruber/brace-expansion.git"
}
}

20
node_modules/nodemon/node_modules/debug/LICENSE generated vendored Normal file
View file

@ -0,0 +1,20 @@
(The MIT License)
Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca>
Copyright (c) 2018-2021 Josh Junon
Permission is hereby granted, free of charge, to any person obtaining a copy of this software
and associated documentation files (the 'Software'), to deal in the Software without restriction,
including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense,
and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
subject to the following conditions:
The above copyright notice and this permission notice shall be included in all copies or substantial
portions of the Software.
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT
LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

481
node_modules/nodemon/node_modules/debug/README.md generated vendored Normal file
View file

@ -0,0 +1,481 @@
# debug
[![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
A tiny JavaScript debugging utility modelled after Node.js core's debugging
technique. Works in Node.js and web browsers.
## Installation
```bash
$ npm install debug
```
## Usage
`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
Example [_app.js_](./examples/node/app.js):
```js
var debug = require('debug')('http')
, http = require('http')
, name = 'My App';
// fake app
debug('booting %o', name);
http.createServer(function(req, res){
debug(req.method + ' ' + req.url);
res.end('hello\n');
}).listen(3000, function(){
debug('listening');
});
// fake worker of some kind
require('./worker');
```
Example [_worker.js_](./examples/node/worker.js):
```js
var a = require('debug')('worker:a')
, b = require('debug')('worker:b');
function work() {
a('doing lots of uninteresting work');
setTimeout(work, Math.random() * 1000);
}
work();
function workb() {
b('doing some work');
setTimeout(workb, Math.random() * 2000);
}
workb();
```
The `DEBUG` environment variable is then used to enable these based on space or
comma-delimited names.
Here are some examples:
<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
#### Windows command prompt notes
##### CMD
On Windows the environment variable is set using the `set` command.
```cmd
set DEBUG=*,-not_this
```
Example:
```cmd
set DEBUG=* & node app.js
```
##### PowerShell (VS Code default)
PowerShell uses different syntax to set environment variables.
```cmd
$env:DEBUG = "*,-not_this"
```
Example:
```cmd
$env:DEBUG='app';node app.js
```
Then, run the program to be debugged as usual.
npm script example:
```js
"windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js",
```
## Namespace Colors
Every debug instance has a color generated for it based on its namespace name.
This helps when visually parsing the debug output to identify which debug instance
a debug line belongs to.
#### Node.js
In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
otherwise debug will only use a small handful of basic colors.
<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
#### Web Browser
Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
option. These are WebKit web inspectors, Firefox ([since version
31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
and the Firebug plugin for Firefox (any version).
<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
## Millisecond diff
When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
## Conventions
If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output.
## Wildcards
The `*` character may be used as a wildcard. Suppose for example your library has
debuggers named "connect:bodyParser", "connect:compress", "connect:session",
instead of listing all three with
`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
You can also exclude specific debuggers by prefixing them with a "-" character.
For example, `DEBUG=*,-connect:*` would include all debuggers except those
starting with "connect:".
## Environment Variables
When running through Node.js, you can set a few environment variables that will
change the behavior of the debug logging:
| Name | Purpose |
|-----------|-------------------------------------------------|
| `DEBUG` | Enables/disables specific debugging namespaces. |
| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). |
| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
| `DEBUG_DEPTH` | Object inspection depth. |
| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
__Note:__ The environment variables beginning with `DEBUG_` end up being
converted into an Options object that gets used with `%o`/`%O` formatters.
See the Node.js documentation for
[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
for the complete list.
## Formatters
Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
Below are the officially supported formatters:
| Formatter | Representation |
|-----------|----------------|
| `%O` | Pretty-print an Object on multiple lines. |
| `%o` | Pretty-print an Object all on a single line. |
| `%s` | String. |
| `%d` | Number (both integer and float). |
| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
| `%%` | Single percent sign ('%'). This does not consume an argument. |
### Custom formatters
You can add custom formatters by extending the `debug.formatters` object.
For example, if you wanted to add support for rendering a Buffer as hex with
`%h`, you could do something like:
```js
const createDebug = require('debug')
createDebug.formatters.h = (v) => {
return v.toString('hex')
}
// …elsewhere
const debug = createDebug('foo')
debug('this is hex: %h', new Buffer('hello world'))
// foo this is hex: 68656c6c6f20776f726c6421 +0ms
```
## Browser Support
You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
if you don't want to build it yourself.
Debug's enable state is currently persisted by `localStorage`.
Consider the situation shown below where you have `worker:a` and `worker:b`,
and wish to debug both. You can enable this using `localStorage.debug`:
```js
localStorage.debug = 'worker:*'
```
And then refresh the page.
```js
a = debug('worker:a');
b = debug('worker:b');
setInterval(function(){
a('doing some work');
}, 1000);
setInterval(function(){
b('doing some work');
}, 1200);
```
In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console will—by default—only show messages logged by `debug` if the "Verbose" log level is _enabled_.
<img width="647" src="https://user-images.githubusercontent.com/7143133/152083257-29034707-c42c-4959-8add-3cee850e6fcf.png">
## Output streams
By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
Example [_stdout.js_](./examples/node/stdout.js):
```js
var debug = require('debug');
var error = debug('app:error');
// by default stderr is used
error('goes to stderr!');
var log = debug('app:log');
// set this namespace to log via console.log
log.log = console.log.bind(console); // don't forget to bind to console!
log('goes to stdout');
error('still goes to stderr!');
// set all output to go via console.info
// overrides all per-namespace log settings
debug.log = console.info.bind(console);
error('now goes to stdout via console.info');
log('still goes to stdout, but via console.info now');
```
## Extend
You can simply extend debugger
```js
const log = require('debug')('auth');
//creates new debug instance with extended namespace
const logSign = log.extend('sign');
const logLogin = log.extend('login');
log('hello'); // auth hello
logSign('hello'); //auth:sign hello
logLogin('hello'); //auth:login hello
```
## Set dynamically
You can also enable debug dynamically by calling the `enable()` method :
```js
let debug = require('debug');
console.log(1, debug.enabled('test'));
debug.enable('test');
console.log(2, debug.enabled('test'));
debug.disable();
console.log(3, debug.enabled('test'));
```
print :
```
1 false
2 true
3 false
```
Usage :
`enable(namespaces)`
`namespaces` can include modes separated by a colon and wildcards.
Note that calling `enable()` completely overrides previously set DEBUG variable :
```
$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))'
=> false
```
`disable()`
Will disable all namespaces. The functions returns the namespaces currently
enabled (and skipped). This can be useful if you want to disable debugging
temporarily without knowing what was enabled to begin with.
For example:
```js
let debug = require('debug');
debug.enable('foo:*,-foo:bar');
let namespaces = debug.disable();
debug.enable(namespaces);
```
Note: There is no guarantee that the string will be identical to the initial
enable string, but semantically they will be identical.
## Checking whether a debug target is enabled
After you've created a debug instance, you can determine whether or not it is
enabled by checking the `enabled` property:
```javascript
const debug = require('debug')('http');
if (debug.enabled) {
// do stuff...
}
```
You can also manually toggle this property to force the debug instance to be
enabled or disabled.
## Usage in child processes
Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process.
For example:
```javascript
worker = fork(WORKER_WRAP_PATH, [workerPath], {
stdio: [
/* stdin: */ 0,
/* stdout: */ 'pipe',
/* stderr: */ 'pipe',
'ipc',
],
env: Object.assign({}, process.env, {
DEBUG_COLORS: 1 // without this settings, colors won't be shown
}),
});
worker.stderr.pipe(process.stderr, { end: false });
```
## Authors
- TJ Holowaychuk
- Nathan Rajlich
- Andrew Rhyne
- Josh Junon
## Backers
Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
## Sponsors
Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
## License
(The MIT License)
Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
Copyright (c) 2018-2021 Josh Junon
Permission is hereby granted, free of charge, to any person obtaining
a copy of this software and associated documentation files (the
'Software'), to deal in the Software without restriction, including
without limitation the rights to use, copy, modify, merge, publish,
distribute, sublicense, and/or sell copies of the Software, and to
permit persons to whom the Software is furnished to do so, subject to
the following conditions:
The above copyright notice and this permission notice shall be
included in all copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

64
node_modules/nodemon/node_modules/debug/package.json generated vendored Normal file
View file

@ -0,0 +1,64 @@
{
"name": "debug",
"version": "4.4.3",
"repository": {
"type": "git",
"url": "git://github.com/debug-js/debug.git"
},
"description": "Lightweight debugging utility for Node.js and the browser",
"keywords": [
"debug",
"log",
"debugger"
],
"files": [
"src",
"LICENSE",
"README.md"
],
"author": "Josh Junon (https://github.com/qix-)",
"contributors": [
"TJ Holowaychuk <tj@vision-media.ca>",
"Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)",
"Andrew Rhyne <rhyneandrew@gmail.com>"
],
"license": "MIT",
"scripts": {
"lint": "xo",
"test": "npm run test:node && npm run test:browser && npm run lint",
"test:node": "mocha test.js test.node.js",
"test:browser": "karma start --single-run",
"test:coverage": "cat ./coverage/lcov.info | coveralls"
},
"dependencies": {
"ms": "^2.1.3"
},
"devDependencies": {
"brfs": "^2.0.1",
"browserify": "^16.2.3",
"coveralls": "^3.0.2",
"karma": "^3.1.4",
"karma-browserify": "^6.0.0",
"karma-chrome-launcher": "^2.2.0",
"karma-mocha": "^1.3.0",
"mocha": "^5.2.0",
"mocha-lcov-reporter": "^1.2.0",
"sinon": "^14.0.0",
"xo": "^0.23.0"
},
"peerDependenciesMeta": {
"supports-color": {
"optional": true
}
},
"main": "./src/index.js",
"browser": "./src/browser.js",
"engines": {
"node": ">=6.0"
},
"xo": {
"rules": {
"import/extensions": "off"
}
}
}

272
node_modules/nodemon/node_modules/debug/src/browser.js generated vendored Normal file
View file

@ -0,0 +1,272 @@
/* eslint-env browser */
/**
* This is the web browser implementation of `debug()`.
*/
exports.formatArgs = formatArgs;
exports.save = save;
exports.load = load;
exports.useColors = useColors;
exports.storage = localstorage();
exports.destroy = (() => {
let warned = false;
return () => {
if (!warned) {
warned = true;
console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.');
}
};
})();
/**
* Colors.
*/
exports.colors = [
'#0000CC',
'#0000FF',
'#0033CC',
'#0033FF',
'#0066CC',
'#0066FF',
'#0099CC',
'#0099FF',
'#00CC00',
'#00CC33',
'#00CC66',
'#00CC99',
'#00CCCC',
'#00CCFF',
'#3300CC',
'#3300FF',
'#3333CC',
'#3333FF',
'#3366CC',
'#3366FF',
'#3399CC',
'#3399FF',
'#33CC00',
'#33CC33',
'#33CC66',
'#33CC99',
'#33CCCC',
'#33CCFF',
'#6600CC',
'#6600FF',
'#6633CC',
'#6633FF',
'#66CC00',
'#66CC33',
'#9900CC',
'#9900FF',
'#9933CC',
'#9933FF',
'#99CC00',
'#99CC33',
'#CC0000',
'#CC0033',
'#CC0066',
'#CC0099',
'#CC00CC',
'#CC00FF',
'#CC3300',
'#CC3333',
'#CC3366',
'#CC3399',
'#CC33CC',
'#CC33FF',
'#CC6600',
'#CC6633',
'#CC9900',
'#CC9933',
'#CCCC00',
'#CCCC33',
'#FF0000',
'#FF0033',
'#FF0066',
'#FF0099',
'#FF00CC',
'#FF00FF',
'#FF3300',
'#FF3333',
'#FF3366',
'#FF3399',
'#FF33CC',
'#FF33FF',
'#FF6600',
'#FF6633',
'#FF9900',
'#FF9933',
'#FFCC00',
'#FFCC33'
];
/**
* Currently only WebKit-based Web Inspectors, Firefox >= v31,
* and the Firebug extension (any Firefox version) are known
* to support "%c" CSS customizations.
*
* TODO: add a `localStorage` variable to explicitly enable/disable colors
*/
// eslint-disable-next-line complexity
function useColors() {
// NB: In an Electron preload script, document will be defined but not fully
// initialized. Since we know we're in Chrome, we'll just detect this case
// explicitly
if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) {
return true;
}
// Internet Explorer and Edge do not support colors.
if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) {
return false;
}
let m;
// Is webkit? http://stackoverflow.com/a/16459606/376773
// document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
// eslint-disable-next-line no-return-assign
return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) ||
// Is firebug? http://stackoverflow.com/a/398120/376773
(typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) ||
// Is firefox >= v31?
// https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
(typeof navigator !== 'undefined' && navigator.userAgent && (m = navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/)) && parseInt(m[1], 10) >= 31) ||
// Double check webkit in userAgent just in case we are in a worker
(typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/));
}
/**
* Colorize log arguments if enabled.
*
* @api public
*/
function formatArgs(args) {
args[0] = (this.useColors ? '%c' : '') +
this.namespace +
(this.useColors ? ' %c' : ' ') +
args[0] +
(this.useColors ? '%c ' : ' ') +
'+' + module.exports.humanize(this.diff);
if (!this.useColors) {
return;
}
const c = 'color: ' + this.color;
args.splice(1, 0, c, 'color: inherit');
// The final "%c" is somewhat tricky, because there could be other
// arguments passed either before or after the %c, so we need to
// figure out the correct index to insert the CSS into
let index = 0;
let lastC = 0;
args[0].replace(/%[a-zA-Z%]/g, match => {
if (match === '%%') {
return;
}
index++;
if (match === '%c') {
// We only are interested in the *last* %c
// (the user may have provided their own)
lastC = index;
}
});
args.splice(lastC, 0, c);
}
/**
* Invokes `console.debug()` when available.
* No-op when `console.debug` is not a "function".
* If `console.debug` is not available, falls back
* to `console.log`.
*
* @api public
*/
exports.log = console.debug || console.log || (() => {});
/**
* Save `namespaces`.
*
* @param {String} namespaces
* @api private
*/
function save(namespaces) {
try {
if (namespaces) {
exports.storage.setItem('debug', namespaces);
} else {
exports.storage.removeItem('debug');
}
} catch (error) {
// Swallow
// XXX (@Qix-) should we be logging these?
}
}
/**
* Load `namespaces`.
*
* @return {String} returns the previously persisted debug modes
* @api private
*/
function load() {
let r;
try {
r = exports.storage.getItem('debug') || exports.storage.getItem('DEBUG') ;
} catch (error) {
// Swallow
// XXX (@Qix-) should we be logging these?
}
// If debug isn't set in LS, and we're in Electron, try to load $DEBUG
if (!r && typeof process !== 'undefined' && 'env' in process) {
r = process.env.DEBUG;
}
return r;
}
/**
* Localstorage attempts to return the localstorage.
*
* This is necessary because safari throws
* when a user disables cookies/localstorage
* and you attempt to access it.
*
* @return {LocalStorage}
* @api private
*/
function localstorage() {
try {
// TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
// The Browser also has localStorage in the global context.
return localStorage;
} catch (error) {
// Swallow
// XXX (@Qix-) should we be logging these?
}
}
module.exports = require('./common')(exports);
const {formatters} = module.exports;
/**
* Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
*/
formatters.j = function (v) {
try {
return JSON.stringify(v);
} catch (error) {
return '[UnexpectedJSONParseError]: ' + error.message;
}
};

292
node_modules/nodemon/node_modules/debug/src/common.js generated vendored Normal file
View file

@ -0,0 +1,292 @@
/**
* This is the common logic for both the Node.js and web browser
* implementations of `debug()`.
*/
function setup(env) {
createDebug.debug = createDebug;
createDebug.default = createDebug;
createDebug.coerce = coerce;
createDebug.disable = disable;
createDebug.enable = enable;
createDebug.enabled = enabled;
createDebug.humanize = require('ms');
createDebug.destroy = destroy;
Object.keys(env).forEach(key => {
createDebug[key] = env[key];
});
/**
* The currently active debug mode names, and names to skip.
*/
createDebug.names = [];
createDebug.skips = [];
/**
* Map of special "%n" handling functions, for the debug "format" argument.
*
* Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
*/
createDebug.formatters = {};
/**
* Selects a color for a debug namespace
* @param {String} namespace The namespace string for the debug instance to be colored
* @return {Number|String} An ANSI color code for the given namespace
* @api private
*/
function selectColor(namespace) {
let hash = 0;
for (let i = 0; i < namespace.length; i++) {
hash = ((hash << 5) - hash) + namespace.charCodeAt(i);
hash |= 0; // Convert to 32bit integer
}
return createDebug.colors[Math.abs(hash) % createDebug.colors.length];
}
createDebug.selectColor = selectColor;
/**
* Create a debugger with the given `namespace`.
*
* @param {String} namespace
* @return {Function}
* @api public
*/
function createDebug(namespace) {
let prevTime;
let enableOverride = null;
let namespacesCache;
let enabledCache;
function debug(...args) {
// Disabled?
if (!debug.enabled) {
return;
}
const self = debug;
// Set `diff` timestamp
const curr = Number(new Date());
const ms = curr - (prevTime || curr);
self.diff = ms;
self.prev = prevTime;
self.curr = curr;
prevTime = curr;
args[0] = createDebug.coerce(args[0]);
if (typeof args[0] !== 'string') {
// Anything else let's inspect with %O
args.unshift('%O');
}
// Apply any `formatters` transformations
let index = 0;
args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => {
// If we encounter an escaped % then don't increase the array index
if (match === '%%') {
return '%';
}
index++;
const formatter = createDebug.formatters[format];
if (typeof formatter === 'function') {
const val = args[index];
match = formatter.call(self, val);
// Now we need to remove `args[index]` since it's inlined in the `format`
args.splice(index, 1);
index--;
}
return match;
});
// Apply env-specific formatting (colors, etc.)
createDebug.formatArgs.call(self, args);
const logFn = self.log || createDebug.log;
logFn.apply(self, args);
}
debug.namespace = namespace;
debug.useColors = createDebug.useColors();
debug.color = createDebug.selectColor(namespace);
debug.extend = extend;
debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release.
Object.defineProperty(debug, 'enabled', {
enumerable: true,
configurable: false,
get: () => {
if (enableOverride !== null) {
return enableOverride;
}
if (namespacesCache !== createDebug.namespaces) {
namespacesCache = createDebug.namespaces;
enabledCache = createDebug.enabled(namespace);
}
return enabledCache;
},
set: v => {
enableOverride = v;
}
});
// Env-specific initialization logic for debug instances
if (typeof createDebug.init === 'function') {
createDebug.init(debug);
}
return debug;
}
function extend(namespace, delimiter) {
const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace);
newDebug.log = this.log;
return newDebug;
}
/**
* Enables a debug mode by namespaces. This can include modes
* separated by a colon and wildcards.
*
* @param {String} namespaces
* @api public
*/
function enable(namespaces) {
createDebug.save(namespaces);
createDebug.namespaces = namespaces;
createDebug.names = [];
createDebug.skips = [];
const split = (typeof namespaces === 'string' ? namespaces : '')
.trim()
.replace(/\s+/g, ',')
.split(',')
.filter(Boolean);
for (const ns of split) {
if (ns[0] === '-') {
createDebug.skips.push(ns.slice(1));
} else {
createDebug.names.push(ns);
}
}
}
/**
* Checks if the given string matches a namespace template, honoring
* asterisks as wildcards.
*
* @param {String} search
* @param {String} template
* @return {Boolean}
*/
function matchesTemplate(search, template) {
let searchIndex = 0;
let templateIndex = 0;
let starIndex = -1;
let matchIndex = 0;
while (searchIndex < search.length) {
if (templateIndex < template.length && (template[templateIndex] === search[searchIndex] || template[templateIndex] === '*')) {
// Match character or proceed with wildcard
if (template[templateIndex] === '*') {
starIndex = templateIndex;
matchIndex = searchIndex;
templateIndex++; // Skip the '*'
} else {
searchIndex++;
templateIndex++;
}
} else if (starIndex !== -1) { // eslint-disable-line no-negated-condition
// Backtrack to the last '*' and try to match more characters
templateIndex = starIndex + 1;
matchIndex++;
searchIndex = matchIndex;
} else {
return false; // No match
}
}
// Handle trailing '*' in template
while (templateIndex < template.length && template[templateIndex] === '*') {
templateIndex++;
}
return templateIndex === template.length;
}
/**
* Disable debug output.
*
* @return {String} namespaces
* @api public
*/
function disable() {
const namespaces = [
...createDebug.names,
...createDebug.skips.map(namespace => '-' + namespace)
].join(',');
createDebug.enable('');
return namespaces;
}
/**
* Returns true if the given mode name is enabled, false otherwise.
*
* @param {String} name
* @return {Boolean}
* @api public
*/
function enabled(name) {
for (const skip of createDebug.skips) {
if (matchesTemplate(name, skip)) {
return false;
}
}
for (const ns of createDebug.names) {
if (matchesTemplate(name, ns)) {
return true;
}
}
return false;
}
/**
* Coerce `val`.
*
* @param {Mixed} val
* @return {Mixed}
* @api private
*/
function coerce(val) {
if (val instanceof Error) {
return val.stack || val.message;
}
return val;
}
/**
* XXX DO NOT USE. This is a temporary stub function.
* XXX It WILL be removed in the next major release.
*/
function destroy() {
console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.');
}
createDebug.enable(createDebug.load());
return createDebug;
}
module.exports = setup;

10
node_modules/nodemon/node_modules/debug/src/index.js generated vendored Normal file
View file

@ -0,0 +1,10 @@
/**
* Detect Electron renderer / nwjs process, which is node, but we should
* treat as a browser.
*/
if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) {
module.exports = require('./browser.js');
} else {
module.exports = require('./node.js');
}

263
node_modules/nodemon/node_modules/debug/src/node.js generated vendored Normal file
View file

@ -0,0 +1,263 @@
/**
* Module dependencies.
*/
const tty = require('tty');
const util = require('util');
/**
* This is the Node.js implementation of `debug()`.
*/
exports.init = init;
exports.log = log;
exports.formatArgs = formatArgs;
exports.save = save;
exports.load = load;
exports.useColors = useColors;
exports.destroy = util.deprecate(
() => {},
'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'
);
/**
* Colors.
*/
exports.colors = [6, 2, 3, 4, 5, 1];
try {
// Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json)
// eslint-disable-next-line import/no-extraneous-dependencies
const supportsColor = require('supports-color');
if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) {
exports.colors = [
20,
21,
26,
27,
32,
33,
38,
39,
40,
41,
42,
43,
44,
45,
56,
57,
62,
63,
68,
69,
74,
75,
76,
77,
78,
79,
80,
81,
92,
93,
98,
99,
112,
113,
128,
129,
134,
135,
148,
149,
160,
161,
162,
163,
164,
165,
166,
167,
168,
169,
170,
171,
172,
173,
178,
179,
184,
185,
196,
197,
198,
199,
200,
201,
202,
203,
204,
205,
206,
207,
208,
209,
214,
215,
220,
221
];
}
} catch (error) {
// Swallow - we only care if `supports-color` is available; it doesn't have to be.
}
/**
* Build up the default `inspectOpts` object from the environment variables.
*
* $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
*/
exports.inspectOpts = Object.keys(process.env).filter(key => {
return /^debug_/i.test(key);
}).reduce((obj, key) => {
// Camel-case
const prop = key
.substring(6)
.toLowerCase()
.replace(/_([a-z])/g, (_, k) => {
return k.toUpperCase();
});
// Coerce string value into JS value
let val = process.env[key];
if (/^(yes|on|true|enabled)$/i.test(val)) {
val = true;
} else if (/^(no|off|false|disabled)$/i.test(val)) {
val = false;
} else if (val === 'null') {
val = null;
} else {
val = Number(val);
}
obj[prop] = val;
return obj;
}, {});
/**
* Is stdout a TTY? Colored output is enabled when `true`.
*/
function useColors() {
return 'colors' in exports.inspectOpts ?
Boolean(exports.inspectOpts.colors) :
tty.isatty(process.stderr.fd);
}
/**
* Adds ANSI color escape codes if enabled.
*
* @api public
*/
function formatArgs(args) {
const {namespace: name, useColors} = this;
if (useColors) {
const c = this.color;
const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c);
const prefix = ` ${colorCode};1m${name} \u001B[0m`;
args[0] = prefix + args[0].split('\n').join('\n' + prefix);
args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m');
} else {
args[0] = getDate() + name + ' ' + args[0];
}
}
function getDate() {
if (exports.inspectOpts.hideDate) {
return '';
}
return new Date().toISOString() + ' ';
}
/**
* Invokes `util.formatWithOptions()` with the specified arguments and writes to stderr.
*/
function log(...args) {
return process.stderr.write(util.formatWithOptions(exports.inspectOpts, ...args) + '\n');
}
/**
* Save `namespaces`.
*
* @param {String} namespaces
* @api private
*/
function save(namespaces) {
if (namespaces) {
process.env.DEBUG = namespaces;
} else {
// If you set a process.env field to null or undefined, it gets cast to the
// string 'null' or 'undefined'. Just delete instead.
delete process.env.DEBUG;
}
}
/**
* Load `namespaces`.
*
* @return {String} returns the previously persisted debug modes
* @api private
*/
function load() {
return process.env.DEBUG;
}
/**
* Init logic for `debug` instances.
*
* Create a new `inspectOpts` object in case `useColors` is set
* differently for a particular `debug` instance.
*/
function init(debug) {
debug.inspectOpts = {};
const keys = Object.keys(exports.inspectOpts);
for (let i = 0; i < keys.length; i++) {
debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
}
}
module.exports = require('./common')(exports);
const {formatters} = module.exports;
/**
* Map %o to `util.inspect()`, all on a single line.
*/
formatters.o = function (v) {
this.inspectOpts.colors = this.useColors;
return util.inspect(v, this.inspectOpts)
.split('\n')
.map(str => str.trim())
.join(' ');
};
/**
* Map %O to `util.inspect()`, allowing multiple lines if needed.
*/
formatters.O = function (v) {
this.inspectOpts.colors = this.useColors;
return util.inspect(v, this.inspectOpts);
};

8
node_modules/nodemon/node_modules/has-flag/index.js generated vendored Normal file
View file

@ -0,0 +1,8 @@
'use strict';
module.exports = (flag, argv) => {
argv = argv || process.argv;
const prefix = flag.startsWith('-') ? '' : (flag.length === 1 ? '-' : '--');
const pos = argv.indexOf(prefix + flag);
const terminatorPos = argv.indexOf('--');
return pos !== -1 && (terminatorPos === -1 ? true : pos < terminatorPos);
};

9
node_modules/nodemon/node_modules/has-flag/license generated vendored Normal file
View file

@ -0,0 +1,9 @@
MIT License
Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com)
Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

44
node_modules/nodemon/node_modules/has-flag/package.json generated vendored Normal file
View file

@ -0,0 +1,44 @@
{
"name": "has-flag",
"version": "3.0.0",
"description": "Check if argv has a specific flag",
"license": "MIT",
"repository": "sindresorhus/has-flag",
"author": {
"name": "Sindre Sorhus",
"email": "sindresorhus@gmail.com",
"url": "sindresorhus.com"
},
"engines": {
"node": ">=4"
},
"scripts": {
"test": "xo && ava"
},
"files": [
"index.js"
],
"keywords": [
"has",
"check",
"detect",
"contains",
"find",
"flag",
"cli",
"command-line",
"argv",
"process",
"arg",
"args",
"argument",
"arguments",
"getopt",
"minimist",
"optimist"
],
"devDependencies": {
"ava": "*",
"xo": "*"
}
}

70
node_modules/nodemon/node_modules/has-flag/readme.md generated vendored Normal file
View file

@ -0,0 +1,70 @@
# has-flag [![Build Status](https://travis-ci.org/sindresorhus/has-flag.svg?branch=master)](https://travis-ci.org/sindresorhus/has-flag)
> Check if [`argv`](https://nodejs.org/docs/latest/api/process.html#process_process_argv) has a specific flag
Correctly stops looking after an `--` argument terminator.
## Install
```
$ npm install has-flag
```
## Usage
```js
// foo.js
const hasFlag = require('has-flag');
hasFlag('unicorn');
//=> true
hasFlag('--unicorn');
//=> true
hasFlag('f');
//=> true
hasFlag('-f');
//=> true
hasFlag('foo=bar');
//=> true
hasFlag('foo');
//=> false
hasFlag('rainbow');
//=> false
```
```
$ node foo.js -f --unicorn --foo=bar -- --rainbow
```
## API
### hasFlag(flag, [argv])
Returns a boolean for whether the flag exists.
#### flag
Type: `string`
CLI flag to look for. The `--` prefix is optional.
#### argv
Type: `string[]`<br>
Default: `process.argv`
CLI arguments.
## License
MIT © [Sindre Sorhus](https://sindresorhus.com)

55
node_modules/nodemon/node_modules/minimatch/LICENSE.md generated vendored Normal file
View file

@ -0,0 +1,55 @@
# Blue Oak Model License
Version 1.0.0
## Purpose
This license gives everyone as much permission to work with
this software as possible, while protecting contributors
from liability.
## Acceptance
In order to receive this license, you must agree to its
rules. The rules of this license are both obligations
under that agreement and conditions to your license.
You must not do anything with this software that triggers
a rule that you cannot or will not follow.
## Copyright
Each contributor licenses you to do everything with this
software that would otherwise infringe that contributor's
copyright in it.
## Notices
You must ensure that everyone who gets a copy of
any part of this software from you, with or without
changes, also gets the text of this license or a link to
<https://blueoakcouncil.org/license/1.0.0>.
## Excuse
If anyone notifies you in writing that you have not
complied with [Notices](#notices), you can keep your
license by taking all practical steps to comply within 30
days after the notice. If you do not do so, your license
ends immediately.
## Patent
Each contributor licenses you to do everything with this
software that would otherwise infringe any patent claims
they can license or become able to license.
## Reliability
No contributor can revoke this license.
## No Liability
**_As far as the law allows, this software comes as is,
without any warranty or condition, and no contributor
will be liable to anyone for any damages related to this
software or this license, under any kind of legal claim._**

528
node_modules/nodemon/node_modules/minimatch/README.md generated vendored Normal file
View file

@ -0,0 +1,528 @@
# minimatch
A minimal matching utility.
This is the matching library used internally by npm.
It works by converting glob expressions into JavaScript `RegExp`
objects.
## Important Security Consideration!
> [!WARNING]
> This library uses JavaScript regular expressions. Please read
> the following warning carefully, and be thoughtful about what
> you provide to this library in production systems.
_Any_ library in JavaScript that deals with matching string
patterns using regular expressions will be subject to
[ReDoS](https://owasp.org/www-community/attacks/Regular_expression_Denial_of_Service_-_ReDoS)
if the pattern is generated using untrusted input.
Efforts have been made to mitigate risk as much as is feasible in
such a library, providing maximum recursion depths and so forth,
but these measures can only ultimately protect against accidents,
not malice. A dedicated attacker can _always_ find patterns that
cannot be defended against by a bash-compatible glob pattern
matching system that uses JavaScript regular expressions.
To be extremely clear:
> [!WARNING]
> **If you create a system where you take user input, and use
> that input as the source of a Regular Expression pattern, in
> this or any extant glob matcher in JavaScript, you will be
> pwned.**
A future version of this library _may_ use a different matching
algorithm which does not exhibit backtracking problems. If and
when that happens, it will likely be a sweeping change, and those
improvements will **not** be backported to legacy versions.
In the near term, it is not reasonable to continue to play
whack-a-mole with security advisories, and so any future ReDoS
reports will be considered "working as intended", and resolved
entirely by this warning.
## Usage
```js
// hybrid module, load with require() or import
import { minimatch } from 'minimatch'
// or:
const { minimatch } = require('minimatch')
minimatch('bar.foo', '*.foo') // true!
minimatch('bar.foo', '*.bar') // false!
minimatch('bar.foo', '*.+(bar|foo)', { debug: true }) // true, and noisy!
```
## Features
Supports these glob features:
- Brace Expansion
- Extended glob matching
- "Globstar" `**` matching
- [Posix character
classes](https://www.gnu.org/software/bash/manual/html_node/Pattern-Matching.html),
like `[[:alpha:]]`, supporting the full range of Unicode
characters. For example, `[[:alpha:]]` will match against
`'é'`, though `[a-zA-Z]` will not. Collating symbol and set
matching is not supported, so `[[=e=]]` will _not_ match `'é'`
and `[[.ch.]]` will not match `'ch'` in locales where `ch` is
considered a single character.
See:
- `man sh`
- `man bash` [Pattern
Matching](https://www.gnu.org/software/bash/manual/html_node/Pattern-Matching.html)
- `man 3 fnmatch`
- `man 5 gitignore`
## Windows
**Please only use forward-slashes in glob expressions.**
Though windows uses either `/` or `\` as its path separator, only `/`
characters are used by this glob implementation. You must use
forward-slashes **only** in glob expressions. Back-slashes in patterns
will always be interpreted as escape characters, not path separators.
Note that `\` or `/` _will_ be interpreted as path separators in paths on
Windows, and will match against `/` in glob expressions.
So just always use `/` in patterns.
### UNC Paths
On Windows, UNC paths like `//?/c:/...` or
`//ComputerName/Share/...` are handled specially.
- Patterns starting with a double-slash followed by some
non-slash characters will preserve their double-slash. As a
result, a pattern like `//*` will match `//x`, but not `/x`.
- Patterns staring with `//?/<drive letter>:` will _not_ treat
the `?` as a wildcard character. Instead, it will be treated
as a normal string.
- Patterns starting with `//?/<drive letter>:/...` will match
file paths starting with `<drive letter>:/...`, and vice versa,
as if the `//?/` was not present. This behavior only is
present when the drive letters are a case-insensitive match to
one another. The remaining portions of the path/pattern are
compared case sensitively, unless `nocase:true` is set.
Note that specifying a UNC path using `\` characters as path
separators is always allowed in the file path argument, but only
allowed in the pattern argument when `windowsPathsNoEscape: true`
is set in the options.
## Minimatch Class
Create a minimatch object by instantiating the `minimatch.Minimatch` class.
```javascript
var Minimatch = require('minimatch').Minimatch
var mm = new Minimatch(pattern, options)
```
### Properties
- `pattern` The original pattern the minimatch object represents.
- `options` The options supplied to the constructor.
- `set` A 2-dimensional array of regexp or string expressions.
Each row in the
array corresponds to a brace-expanded pattern. Each item in the row
corresponds to a single path-part. For example, the pattern
`{a,b/c}/d` would expand to a set of patterns like:
[ [ a, d ]
, [ b, c, d ] ]
If a portion of the pattern doesn't have any "magic" in it
(that is, it's something like `"foo"` rather than `fo*o?`), then it
will be left as a string rather than converted to a regular
expression.
- `regexp` Created by the `makeRe` method. A single regular expression
expressing the entire pattern. This is useful in cases where you wish
to use the pattern somewhat like `fnmatch(3)` with `FNM_PATH` enabled.
- `negate` True if the pattern is negated.
- `comment` True if the pattern is a comment.
- `empty` True if the pattern is `""`.
### Methods
- `makeRe()` Generate the `regexp` member if necessary, and return it.
Will return `false` if the pattern is invalid.
- `match(fname)` Return true if the filename matches the pattern, or
false otherwise.
- `matchOne(fileArray, patternArray, partial)` Take a `/`-split
filename, and match it against a single row in the `regExpSet`. This
method is mainly for internal use, but is exposed so that it can be
used by a glob-walker that needs to avoid excessive filesystem calls.
- `hasMagic()` Returns true if the parsed pattern contains any
magic characters. Returns false if all comparator parts are
string literals. If the `magicalBraces` option is set on the
constructor, then it will consider brace expansions which are
not otherwise magical to be magic. If not set, then a pattern
like `a{b,c}d` will return `false`, because neither `abd` nor
`acd` contain any special glob characters.
This does **not** mean that the pattern string can be used as a
literal filename, as it may contain magic glob characters that
are escaped. For example, the pattern `\\*` or `[*]` would not
be considered to have magic, as the matching portion parses to
the literal string `'*'` and would match a path named `'*'`,
not `'\\*'` or `'[*]'`. The `minimatch.unescape()` method may
be used to remove escape characters.
All other methods are internal, and will be called as necessary.
### minimatch(path, pattern, options)
Main export. Tests a path against the pattern using the options.
```javascript
var isJS = minimatch(file, '*.js', { matchBase: true })
```
### minimatch.filter(pattern, options)
Returns a function that tests its
supplied argument, suitable for use with `Array.filter`. Example:
```javascript
var javascripts = fileList.filter(
minimatch.filter('*.js', { matchBase: true }),
)
```
### minimatch.escape(pattern, options = {})
Escape all magic characters in a glob pattern, so that it will
only ever match literal strings.
If the `windowsPathsNoEscape` option is used, then characters are
escaped by wrapping in `[]`, because a magic character wrapped in
a character class can only be satisfied by that exact character.
Slashes (and backslashes in `windowsPathsNoEscape` mode) cannot
be escaped or unescaped.
### minimatch.unescape(pattern, options = {})
Un-escape a glob string that may contain some escaped characters.
If the `windowsPathsNoEscape` option is used, then square-brace
escapes are removed, but not backslash escapes. For example, it
will turn the string `'[*]'` into `*`, but it will not turn
`'\\*'` into `'*'`, because `\` is a path separator in
`windowsPathsNoEscape` mode.
When `windowsPathsNoEscape` is not set, then both brace escapes
and backslash escapes are removed.
Slashes (and backslashes in `windowsPathsNoEscape` mode) cannot
be escaped or unescaped.
### minimatch.match(list, pattern, options)
Match against the list of
files, in the style of fnmatch or glob. If nothing is matched, and
options.nonull is set, then return a list containing the pattern itself.
```javascript
var javascripts = minimatch.match(fileList, '*.js', { matchBase: true })
```
### minimatch.makeRe(pattern, options)
Make a regular expression object from the pattern.
## Options
All options are `false` by default.
### debug
Dump a ton of stuff to stderr.
### nobrace
Do not expand `{a,b}` and `{1..3}` brace sets.
### noglobstar
Disable `**` matching against multiple folder names.
### dot
Allow patterns to match filenames starting with a period, even if
the pattern does not explicitly have a period in that spot.
Note that by default, `a/**/b` will **not** match `a/.d/b`, unless `dot`
is set.
### noext
Disable "extglob" style patterns like `+(a|b)`.
### nocase
Perform a case-insensitive match.
### nocaseMagicOnly
When used with `{nocase: true}`, create regular expressions that
are case-insensitive, but leave string match portions untouched.
Has no effect when used without `{nocase: true}`.
Useful when some other form of case-insensitive matching is used,
or if the original string representation is useful in some other
way.
### nonull
When a match is not found by `minimatch.match`, return a list containing
the pattern itself if this option is set. When not set, an empty list
is returned if there are no matches.
### magicalBraces
This only affects the results of the `Minimatch.hasMagic` method.
If the pattern contains brace expansions, such as `a{b,c}d`, but
no other magic characters, then the `Minimatch.hasMagic()` method
will return `false` by default. When this option set, it will
return `true` for brace expansion as well as other magic glob
characters.
### matchBase
If set, then patterns without slashes will be matched
against the basename of the path if it contains slashes. For example,
`a?b` would match the path `/xyz/123/acb`, but not `/xyz/acb/123`.
### nocomment
Suppress the behavior of treating `#` at the start of a pattern as a
comment.
### nonegate
Suppress the behavior of treating a leading `!` character as negation.
### flipNegate
Returns from negate expressions the same as if they were not negated.
(Ie, true on a hit, false on a miss.)
### partial
Compare a partial path to a pattern. As long as the parts of the path that
are present are not contradicted by the pattern, it will be treated as a
match. This is useful in applications where you're walking through a
folder structure, and don't yet have the full path, but want to ensure that
you do not walk down paths that can never be a match.
For example,
```js
minimatch('/a/b', '/a/*/c/d', { partial: true }) // true, might be /a/b/c/d
minimatch('/a/b', '/**/d', { partial: true }) // true, might be /a/b/.../d
minimatch('/x/y/z', '/a/**/z', { partial: true }) // false, because x !== a
```
### windowsPathsNoEscape
Use `\\` as a path separator _only_, and _never_ as an escape
character. If set, all `\\` characters are replaced with `/` in
the pattern. Note that this makes it **impossible** to match
against paths containing literal glob pattern characters, but
allows matching with patterns constructed using `path.join()` and
`path.resolve()` on Windows platforms, mimicking the (buggy!)
behavior of earlier versions on Windows. Please use with
caution, and be mindful of [the caveat about Windows
paths](#windows).
For legacy reasons, this is also set if
`options.allowWindowsEscape` is set to the exact value `false`.
### windowsNoMagicRoot
When a pattern starts with a UNC path or drive letter, and in
`nocase:true` mode, do not convert the root portions of the
pattern into a case-insensitive regular expression, and instead
leave them as strings.
This is the default when the platform is `win32` and
`nocase:true` is set.
### preserveMultipleSlashes
By default, multiple `/` characters (other than the leading `//`
in a UNC path, see "UNC Paths" above) are treated as a single
`/`.
That is, a pattern like `a///b` will match the file path `a/b`.
Set `preserveMultipleSlashes: true` to suppress this behavior.
### optimizationLevel
A number indicating the level of optimization that should be done
to the pattern prior to parsing and using it for matches.
Globstar parts `**` are always converted to `*` when `noglobstar`
is set, and multiple adjacent `**` parts are converted into a
single `**` (ie, `a/**/**/b` will be treated as `a/**/b`, as this
is equivalent in all cases).
- `0` - Make no further changes. In this mode, `.` and `..` are
maintained in the pattern, meaning that they must also appear
in the same position in the test path string. Eg, a pattern
like `a/*/../c` will match the string `a/b/../c` but not the
string `a/c`.
- `1` - (default) Remove cases where a double-dot `..` follows a
pattern portion that is not `**`, `.`, `..`, or empty `''`. For
example, the pattern `./a/b/../*` is converted to `./a/*`, and
so it will match the path string `./a/c`, but not the path
string `./a/b/../c`. Dots and empty path portions in the
pattern are preserved.
- `2` (or higher) - Much more aggressive optimizations, suitable
for use with file-walking cases:
- Remove cases where a double-dot `..` follows a pattern
portion that is not `**`, `.`, or empty `''`. Remove empty
and `.` portions of the pattern, where safe to do so (ie,
anywhere other than the last position, the first position, or
the second position in a pattern starting with `/`, as this
may indicate a UNC path on Windows).
- Convert patterns containing `<pre>/**/../<p>/<rest>` into the
equivalent `<pre>/{..,**}/<p>/<rest>`, where `<p>` is a
a pattern portion other than `.`, `..`, `**`, or empty
`''`.
- Dedupe patterns where a `**` portion is present in one and
omitted in another, and it is not the final path portion, and
they are otherwise equivalent. So `{a/**/b,a/b}` becomes
`a/**/b`, because `**` matches against an empty path portion.
- Dedupe patterns where a `*` portion is present in one, and a
non-dot pattern other than `**`, `.`, `..`, or `''` is in the
same position in the other. So `a/{*,x}/b` becomes `a/*/b`,
because `*` can match against `x`.
While these optimizations improve the performance of
file-walking use cases such as [glob](http://npm.im/glob) (ie,
the reason this module exists), there are cases where it will
fail to match a literal string that would have been matched in
optimization level 1 or 0.
Specifically, while the `Minimatch.match()` method will
optimize the file path string in the same ways, resulting in
the same matches, it will fail when tested with the regular
expression provided by `Minimatch.makeRe()`, unless the path
string is first processed with
`minimatch.levelTwoFileOptimize()` or similar.
### platform
When set to `win32`, this will trigger all windows-specific
behaviors (special handling for UNC paths, and treating `\` as
separators in file paths for comparison.)
Defaults to the value of `process.platform`.
### maxGlobstarRecursion
Max number of non-adjacent `**` patterns to recursively walk
down.
The default of `200` is almost certainly high enough for most
purposes, and can handle absurdly excessive patterns.
If the limit is exceeded (which would require very excessively
long patterns and paths containing lots of `**` patterns!), then
it is treated as non-matching, even if the path would normally
match the pattern provided.
That is, this is an intentional false negative, deemed an
acceptable break in correctness for security and performance.
### maxExtglobRecursion
Max depth to traverse for nested extglobs like `*(a|b|c)`
Default is 2, which is quite low, but any higher value swiftly
results in punishing performance impacts. Note that this is _not_
relevant when the globstar types can be safely coalesced into a
single set.
For example, `*(a|@(b|c)|d)` would be flattened into
`*(a|b|c|d)`. Thus, many common extglobs will retain good
performance and never hit this limit, even if they are
excessively deep and complicated.
If the limit is hit, then the extglob characters are simply not
parsed, and the pattern effectively switches into `noextglob:
true` mode for the contents of that nested sub-pattern. This will
typically _not_ result in a match, but is considered a valid
trade-off for security and performance.
## Comparisons to other fnmatch/glob implementations
While strict compliance with the existing standards is a
worthwhile goal, some discrepancies exist between minimatch and
other implementations. Some are intentional, and some are
unavoidable.
If the pattern starts with a `!` character, then it is negated. Set the
`nonegate` flag to suppress this behavior, and treat leading `!`
characters normally. This is perhaps relevant if you wish to start the
pattern with a negative extglob pattern like `!(a|B)`. Multiple `!`
characters at the start of a pattern will negate the pattern multiple
times.
If a pattern starts with `#`, then it is treated as a comment, and
will not match anything. Use `\#` to match a literal `#` at the
start of a line, or set the `nocomment` flag to suppress this behavior.
The double-star character `**` is supported by default, unless the
`noglobstar` flag is set. This is supported in the manner of bsdglob
and bash 4.1, where `**` only has special significance if it is the only
thing in a path part. That is, `a/**/b` will match `a/x/y/b`, but
`a/**b` will not.
If an escaped pattern has no matches, and the `nonull` flag is set,
then minimatch.match returns the pattern as-provided, rather than
interpreting the character escapes. For example,
`minimatch.match([], "\\*a\\?")` will return `"\\*a\\?"` rather than
`"*a?"`. This is akin to setting the `nullglob` option in bash, except
that it does not resolve escaped pattern characters.
If brace expansion is not disabled, then it is performed before any
other interpretation of the glob pattern. Thus, a pattern like
`+(a|{b),c)}`, which would not be valid in bash or zsh, is expanded
**first** into the set of `+(a|b)` and `+(a|c)`, and those patterns are
checked for validity. Since those two are valid, matching proceeds.
Negated extglob patterns are handled as closely as possible to
Bash semantics, but there are some cases with negative extglobs
which are exceedingly difficult to express in a JavaScript
regular expression. In particular the negated pattern
`<start>!(<pattern>*|)*` will in bash match anything that does
not start with `<start><pattern>`. However,
`<start>!(<pattern>*)*` _will_ match paths starting with
`<start><pattern>`, because the empty string can match against
the negated portion. In this library, `<start>!(<pattern>*|)*`
will _not_ match any pattern starting with `<start>`, due to a
difference in precisely which patterns are considered "greedy" in
Regular Expressions vs bash path expansion. This may be fixable,
but not without incurring some complexity and performance costs,
and the trade-off seems to not be worth pursuing.
Note that `fnmatch(3)` in libc is an extremely naive string comparison
matcher, which does not do anything special for slashes. This library is
designed to be used in glob searching and file walkers, and so it does do
special things with `/`. Thus, `foo*` will not match `foo/bar` in this
library, even though it would in `fnmatch(3)`.

2
node_modules/nodemon/node_modules/minimatch/dist/commonjs/assert-valid-pattern.d.ts generated vendored Normal file
View file

@ -0,0 +1,2 @@
export declare const assertValidPattern: (pattern: unknown) => void;
//# sourceMappingURL=assert-valid-pattern.d.ts.map

1
node_modules/nodemon/node_modules/minimatch/dist/commonjs/assert-valid-pattern.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"assert-valid-pattern.d.ts","sourceRoot":"","sources":["../../src/assert-valid-pattern.ts"],"names":[],"mappings":"AACA,eAAO,MAAM,kBAAkB,EAAE,CAAC,OAAO,EAAE,OAAO,KAAK,IAUtD,CAAA"}

14
node_modules/nodemon/node_modules/minimatch/dist/commonjs/assert-valid-pattern.js generated vendored Normal file
View file

@ -0,0 +1,14 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.assertValidPattern = void 0;
const MAX_PATTERN_LENGTH = 1024 * 64;
const assertValidPattern = (pattern) => {
if (typeof pattern !== 'string') {
throw new TypeError('invalid pattern');
}
if (pattern.length > MAX_PATTERN_LENGTH) {
throw new TypeError('pattern is too long');
}
};
exports.assertValidPattern = assertValidPattern;
//# sourceMappingURL=assert-valid-pattern.js.map

1
node_modules/nodemon/node_modules/minimatch/dist/commonjs/assert-valid-pattern.js.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"assert-valid-pattern.js","sourceRoot":"","sources":["../../src/assert-valid-pattern.ts"],"names":[],"mappings":";;;AAAA,MAAM,kBAAkB,GAAG,IAAI,GAAG,EAAE,CAAA;AAC7B,MAAM,kBAAkB,GAA+B,CAC5D,OAAgB,EACW,EAAE;IAC7B,IAAI,OAAO,OAAO,KAAK,QAAQ,EAAE,CAAC;QAChC,MAAM,IAAI,SAAS,CAAC,iBAAiB,CAAC,CAAA;IACxC,CAAC;IAED,IAAI,OAAO,CAAC,MAAM,GAAG,kBAAkB,EAAE,CAAC;QACxC,MAAM,IAAI,SAAS,CAAC,qBAAqB,CAAC,CAAA;IAC5C,CAAC;AACH,CAAC,CAAA;AAVY,QAAA,kBAAkB,sBAU9B","sourcesContent":["const MAX_PATTERN_LENGTH = 1024 * 64\nexport const assertValidPattern: (pattern: unknown) => void = (\n pattern: unknown,\n): asserts pattern is string => {\n if (typeof pattern !== 'string') {\n throw new TypeError('invalid pattern')\n }\n\n if (pattern.length > MAX_PATTERN_LENGTH) {\n throw new TypeError('pattern is too long')\n }\n}\n"]}

22
node_modules/nodemon/node_modules/minimatch/dist/commonjs/ast.d.ts generated vendored Normal file
View file

@ -0,0 +1,22 @@
import { MinimatchOptions, MMRegExp } from './index.js';
export type ExtglobType = '!' | '?' | '+' | '*' | '@';
export declare class AST {
#private;
type: ExtglobType | null;
id: number;
get depth(): number;
constructor(type: ExtglobType | null, parent?: AST, options?: MinimatchOptions);
get hasMagic(): boolean | undefined;
toString(): string;
push(...parts: (string | AST)[]): void;
toJSON(): any[];
isStart(): boolean;
isEnd(): boolean;
copyIn(part: AST | string): void;
clone(parent: AST): AST;
static fromGlob(pattern: string, options?: MinimatchOptions): AST;
toMMPattern(): MMRegExp | string;
get options(): MinimatchOptions;
toRegExpSource(allowDot?: boolean): [re: string, body: string, hasMagic: boolean, uflag: boolean];
}
//# sourceMappingURL=ast.d.ts.map

1
node_modules/nodemon/node_modules/minimatch/dist/commonjs/ast.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"ast.d.ts","sourceRoot":"","sources":["../../src/ast.ts"],"names":[],"mappings":"AAGA,OAAO,EAAE,gBAAgB,EAAE,QAAQ,EAAE,MAAM,YAAY,CAAA;AAwCvD,MAAM,MAAM,WAAW,GAAG,GAAG,GAAG,GAAG,GAAG,GAAG,GAAG,GAAG,GAAG,GAAG,CAAA;AA6IrD,qBAAa,GAAG;;IACd,IAAI,EAAE,WAAW,GAAG,IAAI,CAAA;IAexB,EAAE,SAAO;IAET,IAAI,KAAK,IAAI,MAAM,CAElB;gBAgBC,IAAI,EAAE,WAAW,GAAG,IAAI,EACxB,MAAM,CAAC,EAAE,GAAG,EACZ,OAAO,GAAE,gBAAqB;IAahC,IAAI,QAAQ,IAAI,OAAO,GAAG,SAAS,CAUlC;IAGD,QAAQ,IAAI,MAAM;IA+ClB,IAAI,CAAC,GAAG,KAAK,EAAE,CAAC,MAAM,GAAG,GAAG,CAAC,EAAE;IAe/B,MAAM;IAkBN,OAAO,IAAI,OAAO;IAgBlB,KAAK,IAAI,OAAO;IAYhB,MAAM,CAAC,IAAI,EAAE,GAAG,GAAG,MAAM;IAKzB,KAAK,CAAC,MAAM,EAAE,GAAG;IAwQjB,MAAM,CAAC,QAAQ,CAAC,OAAO,EAAE,MAAM,EAAE,OAAO,GAAE,gBAAqB;IAQ/D,WAAW,IAAI,QAAQ,GAAG,MAAM;IA2BhC,IAAI,OAAO,qBAEV;IAuED,cAAc,CACZ,QAAQ,CAAC,EAAE,OAAO,GACjB,CAAC,EAAE,EAAE,MAAM,EAAE,IAAI,EAAE,MAAM,EAAE,QAAQ,EAAE,OAAO,EAAE,KAAK,EAAE,OAAO,CAAC;CA6OjE"}

846
node_modules/nodemon/node_modules/minimatch/dist/commonjs/ast.js generated vendored Normal file
View file

@ -0,0 +1,846 @@
"use strict";
// parse a single path portion
var _a;
Object.defineProperty(exports, "__esModule", { value: true });
exports.AST = void 0;
const brace_expressions_js_1 = require("./brace-expressions.js");
const unescape_js_1 = require("./unescape.js");
const types = new Set(['!', '?', '+', '*', '@']);
const isExtglobType = (c) => types.has(c);
const isExtglobAST = (c) => isExtglobType(c.type);
// Map of which extglob types can adopt the children of a nested extglob
//
// anything but ! can adopt a matching type:
// +(a|+(b|c)|d) => +(a|b|c|d)
// *(a|*(b|c)|d) => *(a|b|c|d)
// @(a|@(b|c)|d) => @(a|b|c|d)
// ?(a|?(b|c)|d) => ?(a|b|c|d)
//
// * can adopt anything, because 0 or repetition is allowed
// *(a|?(b|c)|d) => *(a|b|c|d)
// *(a|+(b|c)|d) => *(a|b|c|d)
// *(a|@(b|c)|d) => *(a|b|c|d)
//
// + can adopt @, because 1 or repetition is allowed
// +(a|@(b|c)|d) => +(a|b|c|d)
//
// + and @ CANNOT adopt *, because 0 would be allowed
// +(a|*(b|c)|d) => would match "", on *(b|c)
// @(a|*(b|c)|d) => would match "", on *(b|c)
//
// + and @ CANNOT adopt ?, because 0 would be allowed
// +(a|?(b|c)|d) => would match "", on ?(b|c)
// @(a|?(b|c)|d) => would match "", on ?(b|c)
//
// ? can adopt @, because 0 or 1 is allowed
// ?(a|@(b|c)|d) => ?(a|b|c|d)
//
// ? and @ CANNOT adopt * or +, because >1 would be allowed
// ?(a|*(b|c)|d) => would match bbb on *(b|c)
// @(a|*(b|c)|d) => would match bbb on *(b|c)
// ?(a|+(b|c)|d) => would match bbb on +(b|c)
// @(a|+(b|c)|d) => would match bbb on +(b|c)
//
// ! CANNOT adopt ! (nothing else can either)
// !(a|!(b|c)|d) => !(a|b|c|d) would fail to match on b (not not b|c)
//
// ! can adopt @
// !(a|@(b|c)|d) => !(a|b|c|d)
//
// ! CANNOT adopt *
// !(a|*(b|c)|d) => !(a|b|c|d) would match on bbb, not allowed
//
// ! CANNOT adopt +
// !(a|+(b|c)|d) => !(a|b|c|d) would match on bbb, not allowed
//
// ! CANNOT adopt ?
// x!(a|?(b|c)|d) => x!(a|b|c|d) would fail to match "x"
const adoptionMap = new Map([
['!', ['@']],
['?', ['?', '@']],
['@', ['@']],
['*', ['*', '+', '?', '@']],
['+', ['+', '@']],
]);
// nested extglobs that can be adopted in, but with the addition of
// a blank '' element.
const adoptionWithSpaceMap = new Map([
['!', ['?']],
['@', ['?']],
['+', ['?', '*']],
]);
// union of the previous two maps
const adoptionAnyMap = new Map([
['!', ['?', '@']],
['?', ['?', '@']],
['@', ['?', '@']],
['*', ['*', '+', '?', '@']],
['+', ['+', '@', '?', '*']],
]);
// Extglobs that can take over their parent if they are the only child
// the key is parent, value maps child to resulting extglob parent type
// '@' is omitted because it's a special case. An `@` extglob with a single
// member can always be usurped by that subpattern.
const usurpMap = new Map([
['!', new Map([['!', '@']])],
[
'?',
new Map([
['*', '*'],
['+', '*'],
]),
],
[
'@',
new Map([
['!', '!'],
['?', '?'],
['@', '@'],
['*', '*'],
['+', '+'],
]),
],
[
'+',
new Map([
['?', '*'],
['*', '*'],
]),
],
]);
// Patterns that get prepended to bind to the start of either the
// entire string, or just a single path portion, to prevent dots
// and/or traversal patterns, when needed.
// Exts don't need the ^ or / bit, because the root binds that already.
const startNoTraversal = '(?!(?:^|/)\\.\\.?(?:$|/))';
const startNoDot = '(?!\\.)';
// characters that indicate a start of pattern needs the "no dots" bit,
// because a dot *might* be matched. ( is not in the list, because in
// the case of a child extglob, it will handle the prevention itself.
const addPatternStart = new Set(['[', '.']);
// cases where traversal is A-OK, no dot prevention needed
const justDots = new Set(['..', '.']);
const reSpecials = new Set('().*{}+?[]^$\\!');
const regExpEscape = (s) => s.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, '\\$&');
// any single thing other than /
const qmark = '[^/]';
// * => any number of characters
const star = qmark + '*?';
// use + when we need to ensure that *something* matches, because the * is
// the only thing in the path portion.
const starNoEmpty = qmark + '+?';
// remove the \ chars that we added if we end up doing a nonmagic compare
// const deslash = (s: string) => s.replace(/\\(.)/g, '$1')
let ID = 0;
class AST {
type;
#root;
#hasMagic;
#uflag = false;
#parts = [];
#parent;
#parentIndex;
#negs;
#filledNegs = false;
#options;
#toString;
// set to true if it's an extglob with no children
// (which really means one child of '')
#emptyExt = false;
id = ++ID;
get depth() {
return (this.#parent?.depth ?? -1) + 1;
}
[Symbol.for('nodejs.util.inspect.custom')]() {
return {
'@@type': 'AST',
id: this.id,
type: this.type,
root: this.#root.id,
parent: this.#parent?.id,
depth: this.depth,
partsLength: this.#parts.length,
parts: this.#parts,
};
}
constructor(type, parent, options = {}) {
this.type = type;
// extglobs are inherently magical
if (type)
this.#hasMagic = true;
this.#parent = parent;
this.#root = this.#parent ? this.#parent.#root : this;
this.#options = this.#root === this ? options : this.#root.#options;
this.#negs = this.#root === this ? [] : this.#root.#negs;
if (type === '!' && !this.#root.#filledNegs)
this.#negs.push(this);
this.#parentIndex = this.#parent ? this.#parent.#parts.length : 0;
}
get hasMagic() {
/* c8 ignore start */
if (this.#hasMagic !== undefined)
return this.#hasMagic;
/* c8 ignore stop */
for (const p of this.#parts) {
if (typeof p === 'string')
continue;
if (p.type || p.hasMagic)
return (this.#hasMagic = true);
}
// note: will be undefined until we generate the regexp src and find out
return this.#hasMagic;
}
// reconstructs the pattern
toString() {
if (this.#toString !== undefined)
return this.#toString;
if (!this.type) {
return (this.#toString = this.#parts.map(p => String(p)).join(''));
}
else {
return (this.#toString =
this.type + '(' + this.#parts.map(p => String(p)).join('|') + ')');
}
}
#fillNegs() {
/* c8 ignore start */
if (this !== this.#root)
throw new Error('should only call on root');
if (this.#filledNegs)
return this;
/* c8 ignore stop */
// call toString() once to fill this out
this.toString();
this.#filledNegs = true;
let n;
while ((n = this.#negs.pop())) {
if (n.type !== '!')
continue;
// walk up the tree, appending everthing that comes AFTER parentIndex
let p = n;
let pp = p.#parent;
while (pp) {
for (let i = p.#parentIndex + 1; !pp.type && i < pp.#parts.length; i++) {
for (const part of n.#parts) {
/* c8 ignore start */
if (typeof part === 'string') {
throw new Error('string part in extglob AST??');
}
/* c8 ignore stop */
part.copyIn(pp.#parts[i]);
}
}
p = pp;
pp = p.#parent;
}
}
return this;
}
push(...parts) {
for (const p of parts) {
if (p === '')
continue;
/* c8 ignore start */
if (typeof p !== 'string' &&
!(p instanceof _a && p.#parent === this)) {
throw new Error('invalid part: ' + p);
}
/* c8 ignore stop */
this.#parts.push(p);
}
}
toJSON() {
const ret = this.type === null ?
this.#parts
.slice()
.map(p => (typeof p === 'string' ? p : p.toJSON()))
: [this.type, ...this.#parts.map(p => p.toJSON())];
if (this.isStart() && !this.type)
ret.unshift([]);
if (this.isEnd() &&
(this === this.#root ||
(this.#root.#filledNegs && this.#parent?.type === '!'))) {
ret.push({});
}
return ret;
}
isStart() {
if (this.#root === this)
return true;
// if (this.type) return !!this.#parent?.isStart()
if (!this.#parent?.isStart())
return false;
if (this.#parentIndex === 0)
return true;
// if everything AHEAD of this is a negation, then it's still the "start"
const p = this.#parent;
for (let i = 0; i < this.#parentIndex; i++) {
const pp = p.#parts[i];
if (!(pp instanceof _a && pp.type === '!')) {
return false;
}
}
return true;
}
isEnd() {
if (this.#root === this)
return true;
if (this.#parent?.type === '!')
return true;
if (!this.#parent?.isEnd())
return false;
if (!this.type)
return this.#parent?.isEnd();
// if not root, it'll always have a parent
/* c8 ignore start */
const pl = this.#parent ? this.#parent.#parts.length : 0;
/* c8 ignore stop */
return this.#parentIndex === pl - 1;
}
copyIn(part) {
if (typeof part === 'string')
this.push(part);
else
this.push(part.clone(this));
}
clone(parent) {
const c = new _a(this.type, parent);
for (const p of this.#parts) {
c.copyIn(p);
}
return c;
}
static #parseAST(str, ast, pos, opt, extDepth) {
const maxDepth = opt.maxExtglobRecursion ?? 2;
let escaping = false;
let inBrace = false;
let braceStart = -1;
let braceNeg = false;
if (ast.type === null) {
// outside of a extglob, append until we find a start
let i = pos;
let acc = '';
while (i < str.length) {
const c = str.charAt(i++);
// still accumulate escapes at this point, but we do ignore
// starts that are escaped
if (escaping || c === '\\') {
escaping = !escaping;
acc += c;
continue;
}
if (inBrace) {
if (i === braceStart + 1) {
if (c === '^' || c === '!') {
braceNeg = true;
}
}
else if (c === ']' && !(i === braceStart + 2 && braceNeg)) {
inBrace = false;
}
acc += c;
continue;
}
else if (c === '[') {
inBrace = true;
braceStart = i;
braceNeg = false;
acc += c;
continue;
}
// we don't have to check for adoption here, because that's
// done at the other recursion point.
const doRecurse = !opt.noext &&
isExtglobType(c) &&
str.charAt(i) === '(' &&
extDepth <= maxDepth;
if (doRecurse) {
ast.push(acc);
acc = '';
const ext = new _a(c, ast);
i = _a.#parseAST(str, ext, i, opt, extDepth + 1);
ast.push(ext);
continue;
}
acc += c;
}
ast.push(acc);
return i;
}
// some kind of extglob, pos is at the (
// find the next | or )
let i = pos + 1;
let part = new _a(null, ast);
const parts = [];
let acc = '';
while (i < str.length) {
const c = str.charAt(i++);
// still accumulate escapes at this point, but we do ignore
// starts that are escaped
if (escaping || c === '\\') {
escaping = !escaping;
acc += c;
continue;
}
if (inBrace) {
if (i === braceStart + 1) {
if (c === '^' || c === '!') {
braceNeg = true;
}
}
else if (c === ']' && !(i === braceStart + 2 && braceNeg)) {
inBrace = false;
}
acc += c;
continue;
}
else if (c === '[') {
inBrace = true;
braceStart = i;
braceNeg = false;
acc += c;
continue;
}
const doRecurse = !opt.noext &&
isExtglobType(c) &&
str.charAt(i) === '(' &&
/* c8 ignore start - the maxDepth is sufficient here */
(extDepth <= maxDepth || (ast && ast.#canAdoptType(c)));
/* c8 ignore stop */
if (doRecurse) {
const depthAdd = ast && ast.#canAdoptType(c) ? 0 : 1;
part.push(acc);
acc = '';
const ext = new _a(c, part);
part.push(ext);
i = _a.#parseAST(str, ext, i, opt, extDepth + depthAdd);
continue;
}
if (c === '|') {
part.push(acc);
acc = '';
parts.push(part);
part = new _a(null, ast);
continue;
}
if (c === ')') {
if (acc === '' && ast.#parts.length === 0) {
ast.#emptyExt = true;
}
part.push(acc);
acc = '';
ast.push(...parts, part);
return i;
}
acc += c;
}
// unfinished extglob
// if we got here, it was a malformed extglob! not an extglob, but
// maybe something else in there.
ast.type = null;
ast.#hasMagic = undefined;
ast.#parts = [str.substring(pos - 1)];
return i;
}
#canAdoptWithSpace(child) {
return this.#canAdopt(child, adoptionWithSpaceMap);
}
#canAdopt(child, map = adoptionMap) {
if (!child ||
typeof child !== 'object' ||
child.type !== null ||
child.#parts.length !== 1 ||
this.type === null) {
return false;
}
const gc = child.#parts[0];
if (!gc || typeof gc !== 'object' || gc.type === null) {
return false;
}
return this.#canAdoptType(gc.type, map);
}
#canAdoptType(c, map = adoptionAnyMap) {
return !!map.get(this.type)?.includes(c);
}
#adoptWithSpace(child, index) {
const gc = child.#parts[0];
const blank = new _a(null, gc, this.options);
blank.#parts.push('');
gc.push(blank);
this.#adopt(child, index);
}
#adopt(child, index) {
const gc = child.#parts[0];
this.#parts.splice(index, 1, ...gc.#parts);
for (const p of gc.#parts) {
if (typeof p === 'object')
p.#parent = this;
}
this.#toString = undefined;
}
#canUsurpType(c) {
const m = usurpMap.get(this.type);
return !!(m?.has(c));
}
#canUsurp(child) {
if (!child ||
typeof child !== 'object' ||
child.type !== null ||
child.#parts.length !== 1 ||
this.type === null ||
this.#parts.length !== 1) {
return false;
}
const gc = child.#parts[0];
if (!gc || typeof gc !== 'object' || gc.type === null) {
return false;
}
return this.#canUsurpType(gc.type);
}
#usurp(child) {
const m = usurpMap.get(this.type);
const gc = child.#parts[0];
const nt = m?.get(gc.type);
/* c8 ignore start - impossible */
if (!nt)
return false;
/* c8 ignore stop */
this.#parts = gc.#parts;
for (const p of this.#parts) {
if (typeof p === 'object') {
p.#parent = this;
}
}
this.type = nt;
this.#toString = undefined;
this.#emptyExt = false;
}
static fromGlob(pattern, options = {}) {
const ast = new _a(null, undefined, options);
_a.#parseAST(pattern, ast, 0, options, 0);
return ast;
}
// returns the regular expression if there's magic, or the unescaped
// string if not.
toMMPattern() {
// should only be called on root
/* c8 ignore start */
if (this !== this.#root)
return this.#root.toMMPattern();
/* c8 ignore stop */
const glob = this.toString();
const [re, body, hasMagic, uflag] = this.toRegExpSource();
// if we're in nocase mode, and not nocaseMagicOnly, then we do
// still need a regular expression if we have to case-insensitively
// match capital/lowercase characters.
const anyMagic = hasMagic ||
this.#hasMagic ||
(this.#options.nocase &&
!this.#options.nocaseMagicOnly &&
glob.toUpperCase() !== glob.toLowerCase());
if (!anyMagic) {
return body;
}
const flags = (this.#options.nocase ? 'i' : '') + (uflag ? 'u' : '');
return Object.assign(new RegExp(`^${re}$`, flags), {
_src: re,
_glob: glob,
});
}
get options() {
return this.#options;
}
// returns the string match, the regexp source, whether there's magic
// in the regexp (so a regular expression is required) and whether or
// not the uflag is needed for the regular expression (for posix classes)
// TODO: instead of injecting the start/end at this point, just return
// the BODY of the regexp, along with the start/end portions suitable
// for binding the start/end in either a joined full-path makeRe context
// (where we bind to (^|/), or a standalone matchPart context (where
// we bind to ^, and not /). Otherwise slashes get duped!
//
// In part-matching mode, the start is:
// - if not isStart: nothing
// - if traversal possible, but not allowed: ^(?!\.\.?$)
// - if dots allowed or not possible: ^
// - if dots possible and not allowed: ^(?!\.)
// end is:
// - if not isEnd(): nothing
// - else: $
//
// In full-path matching mode, we put the slash at the START of the
// pattern, so start is:
// - if first pattern: same as part-matching mode
// - if not isStart(): nothing
// - if traversal possible, but not allowed: /(?!\.\.?(?:$|/))
// - if dots allowed or not possible: /
// - if dots possible and not allowed: /(?!\.)
// end is:
// - if last pattern, same as part-matching mode
// - else nothing
//
// Always put the (?:$|/) on negated tails, though, because that has to be
// there to bind the end of the negated pattern portion, and it's easier to
// just stick it in now rather than try to inject it later in the middle of
// the pattern.
//
// We can just always return the same end, and leave it up to the caller
// to know whether it's going to be used joined or in parts.
// And, if the start is adjusted slightly, can do the same there:
// - if not isStart: nothing
// - if traversal possible, but not allowed: (?:/|^)(?!\.\.?$)
// - if dots allowed or not possible: (?:/|^)
// - if dots possible and not allowed: (?:/|^)(?!\.)
//
// But it's better to have a simpler binding without a conditional, for
// performance, so probably better to return both start options.
//
// Then the caller just ignores the end if it's not the first pattern,
// and the start always gets applied.
//
// But that's always going to be $ if it's the ending pattern, or nothing,
// so the caller can just attach $ at the end of the pattern when building.
//
// So the todo is:
// - better detect what kind of start is needed
// - return both flavors of starting pattern
// - attach $ at the end of the pattern when creating the actual RegExp
//
// Ah, but wait, no, that all only applies to the root when the first pattern
// is not an extglob. If the first pattern IS an extglob, then we need all
// that dot prevention biz to live in the extglob portions, because eg
// +(*|.x*) can match .xy but not .yx.
//
// So, return the two flavors if it's #root and the first child is not an
// AST, otherwise leave it to the child AST to handle it, and there,
// use the (?:^|/) style of start binding.
//
// Even simplified further:
// - Since the start for a join is eg /(?!\.) and the start for a part
// is ^(?!\.), we can just prepend (?!\.) to the pattern (either root
// or start or whatever) and prepend ^ or / at the Regexp construction.
toRegExpSource(allowDot) {
const dot = allowDot ?? !!this.#options.dot;
if (this.#root === this) {
this.#flatten();
this.#fillNegs();
}
if (!isExtglobAST(this)) {
const noEmpty = this.isStart() &&
this.isEnd() &&
!this.#parts.some(s => typeof s !== 'string');
const src = this.#parts
.map(p => {
const [re, _, hasMagic, uflag] = typeof p === 'string' ?
_a.#parseGlob(p, this.#hasMagic, noEmpty)
: p.toRegExpSource(allowDot);
this.#hasMagic = this.#hasMagic || hasMagic;
this.#uflag = this.#uflag || uflag;
return re;
})
.join('');
let start = '';
if (this.isStart()) {
if (typeof this.#parts[0] === 'string') {
// this is the string that will match the start of the pattern,
// so we need to protect against dots and such.
// '.' and '..' cannot match unless the pattern is that exactly,
// even if it starts with . or dot:true is set.
const dotTravAllowed = this.#parts.length === 1 && justDots.has(this.#parts[0]);
if (!dotTravAllowed) {
const aps = addPatternStart;
// check if we have a possibility of matching . or ..,
// and prevent that.
const needNoTrav =
// dots are allowed, and the pattern starts with [ or .
(dot && aps.has(src.charAt(0))) ||
// the pattern starts with \., and then [ or .
(src.startsWith('\\.') && aps.has(src.charAt(2))) ||
// the pattern starts with \.\., and then [ or .
(src.startsWith('\\.\\.') && aps.has(src.charAt(4)));
// no need to prevent dots if it can't match a dot, or if a
// sub-pattern will be preventing it anyway.
const needNoDot = !dot && !allowDot && aps.has(src.charAt(0));
start =
needNoTrav ? startNoTraversal
: needNoDot ? startNoDot
: '';
}
}
}
// append the "end of path portion" pattern to negation tails
let end = '';
if (this.isEnd() &&
this.#root.#filledNegs &&
this.#parent?.type === '!') {
end = '(?:$|\\/)';
}
const final = start + src + end;
return [
final,
(0, unescape_js_1.unescape)(src),
(this.#hasMagic = !!this.#hasMagic),
this.#uflag,
];
}
// We need to calculate the body *twice* if it's a repeat pattern
// at the start, once in nodot mode, then again in dot mode, so a
// pattern like *(?) can match 'x.y'
const repeated = this.type === '*' || this.type === '+';
// some kind of extglob
const start = this.type === '!' ? '(?:(?!(?:' : '(?:';
let body = this.#partsToRegExp(dot);
if (this.isStart() && this.isEnd() && !body && this.type !== '!') {
// invalid extglob, has to at least be *something* present, if it's
// the entire path portion.
const s = this.toString();
const me = this;
me.#parts = [s];
me.type = null;
me.#hasMagic = undefined;
return [s, (0, unescape_js_1.unescape)(this.toString()), false, false];
}
let bodyDotAllowed = !repeated || allowDot || dot || !startNoDot ?
''
: this.#partsToRegExp(true);
if (bodyDotAllowed === body) {
bodyDotAllowed = '';
}
if (bodyDotAllowed) {
body = `(?:${body})(?:${bodyDotAllowed})*?`;
}
// an empty !() is exactly equivalent to a starNoEmpty
let final = '';
if (this.type === '!' && this.#emptyExt) {
final = (this.isStart() && !dot ? startNoDot : '') + starNoEmpty;
}
else {
const close = this.type === '!' ?
// !() must match something,but !(x) can match ''
'))' +
(this.isStart() && !dot && !allowDot ? startNoDot : '') +
star +
')'
: this.type === '@' ? ')'
: this.type === '?' ? ')?'
: this.type === '+' && bodyDotAllowed ? ')'
: this.type === '*' && bodyDotAllowed ? `)?`
: `)${this.type}`;
final = start + body + close;
}
return [
final,
(0, unescape_js_1.unescape)(body),
(this.#hasMagic = !!this.#hasMagic),
this.#uflag,
];
}
#flatten() {
if (!isExtglobAST(this)) {
for (const p of this.#parts) {
if (typeof p === 'object') {
p.#flatten();
}
}
}
else {
// do up to 10 passes to flatten as much as possible
let iterations = 0;
let done = false;
do {
done = true;
for (let i = 0; i < this.#parts.length; i++) {
const c = this.#parts[i];
if (typeof c === 'object') {
c.#flatten();
if (this.#canAdopt(c)) {
done = false;
this.#adopt(c, i);
}
else if (this.#canAdoptWithSpace(c)) {
done = false;
this.#adoptWithSpace(c, i);
}
else if (this.#canUsurp(c)) {
done = false;
this.#usurp(c);
}
}
}
} while (!done && ++iterations < 10);
}
this.#toString = undefined;
}
#partsToRegExp(dot) {
return this.#parts
.map(p => {
// extglob ASTs should only contain parent ASTs
/* c8 ignore start */
if (typeof p === 'string') {
throw new Error('string type in extglob ast??');
}
/* c8 ignore stop */
// can ignore hasMagic, because extglobs are already always magic
const [re, _, _hasMagic, uflag] = p.toRegExpSource(dot);
this.#uflag = this.#uflag || uflag;
return re;
})
.filter(p => !(this.isStart() && this.isEnd()) || !!p)
.join('|');
}
static #parseGlob(glob, hasMagic, noEmpty = false) {
let escaping = false;
let re = '';
let uflag = false;
// multiple stars that aren't globstars coalesce into one *
let inStar = false;
for (let i = 0; i < glob.length; i++) {
const c = glob.charAt(i);
if (escaping) {
escaping = false;
re += (reSpecials.has(c) ? '\\' : '') + c;
continue;
}
if (c === '*') {
if (inStar)
continue;
inStar = true;
re += noEmpty && /^[*]+$/.test(glob) ? starNoEmpty : star;
hasMagic = true;
continue;
}
else {
inStar = false;
}
if (c === '\\') {
if (i === glob.length - 1) {
re += '\\\\';
}
else {
escaping = true;
}
continue;
}
if (c === '[') {
const [src, needUflag, consumed, magic] = (0, brace_expressions_js_1.parseClass)(glob, i);
if (consumed) {
re += src;
uflag = uflag || needUflag;
i += consumed - 1;
hasMagic = hasMagic || magic;
continue;
}
}
if (c === '?') {
re += qmark;
hasMagic = true;
continue;
}
re += regExpEscape(c);
}
return [re, (0, unescape_js_1.unescape)(glob), !!hasMagic, uflag];
}
}
exports.AST = AST;
_a = AST;
//# sourceMappingURL=ast.js.map

1
node_modules/nodemon/node_modules/minimatch/dist/commonjs/ast.js.map generated vendored Normal file
View file

File diff suppressed because one or more lines are too long

8
node_modules/nodemon/node_modules/minimatch/dist/commonjs/brace-expressions.d.ts generated vendored Normal file
View file

@ -0,0 +1,8 @@
export type ParseClassResult = [
src: string,
uFlag: boolean,
consumed: number,
hasMagic: boolean
];
export declare const parseClass: (glob: string, position: number) => ParseClassResult;
//# sourceMappingURL=brace-expressions.d.ts.map

1
node_modules/nodemon/node_modules/minimatch/dist/commonjs/brace-expressions.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"brace-expressions.d.ts","sourceRoot":"","sources":["../../src/brace-expressions.ts"],"names":[],"mappings":"AAgCA,MAAM,MAAM,gBAAgB,GAAG;IAC7B,GAAG,EAAE,MAAM;IACX,KAAK,EAAE,OAAO;IACd,QAAQ,EAAE,MAAM;IAChB,QAAQ,EAAE,OAAO;CAClB,CAAA;AAQD,eAAO,MAAM,UAAU,GACrB,MAAM,MAAM,EACZ,UAAU,MAAM,KACf,gBA2HF,CAAA"}

150
node_modules/nodemon/node_modules/minimatch/dist/commonjs/brace-expressions.js generated vendored Normal file
View file

@ -0,0 +1,150 @@
"use strict";
// translate the various posix character classes into unicode properties
// this works across all unicode locales
Object.defineProperty(exports, "__esModule", { value: true });
exports.parseClass = void 0;
// { <posix class>: [<translation>, /u flag required, negated]
const posixClasses = {
'[:alnum:]': ['\\p{L}\\p{Nl}\\p{Nd}', true],
'[:alpha:]': ['\\p{L}\\p{Nl}', true],
'[:ascii:]': ['\\x' + '00-\\x' + '7f', false],
'[:blank:]': ['\\p{Zs}\\t', true],
'[:cntrl:]': ['\\p{Cc}', true],
'[:digit:]': ['\\p{Nd}', true],
'[:graph:]': ['\\p{Z}\\p{C}', true, true],
'[:lower:]': ['\\p{Ll}', true],
'[:print:]': ['\\p{C}', true],
'[:punct:]': ['\\p{P}', true],
'[:space:]': ['\\p{Z}\\t\\r\\n\\v\\f', true],
'[:upper:]': ['\\p{Lu}', true],
'[:word:]': ['\\p{L}\\p{Nl}\\p{Nd}\\p{Pc}', true],
'[:xdigit:]': ['A-Fa-f0-9', false],
};
// only need to escape a few things inside of brace expressions
// escapes: [ \ ] -
const braceEscape = (s) => s.replace(/[[\]\\-]/g, '\\$&');
// escape all regexp magic characters
const regexpEscape = (s) => s.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, '\\$&');
// everything has already been escaped, we just have to join
const rangesToString = (ranges) => ranges.join('');
// takes a glob string at a posix brace expression, and returns
// an equivalent regular expression source, and boolean indicating
// whether the /u flag needs to be applied, and the number of chars
// consumed to parse the character class.
// This also removes out of order ranges, and returns ($.) if the
// entire class just no good.
const parseClass = (glob, position) => {
const pos = position;
/* c8 ignore start */
if (glob.charAt(pos) !== '[') {
throw new Error('not in a brace expression');
}
/* c8 ignore stop */
const ranges = [];
const negs = [];
let i = pos + 1;
let sawStart = false;
let uflag = false;
let escaping = false;
let negate = false;
let endPos = pos;
let rangeStart = '';
WHILE: while (i < glob.length) {
const c = glob.charAt(i);
if ((c === '!' || c === '^') && i === pos + 1) {
negate = true;
i++;
continue;
}
if (c === ']' && sawStart && !escaping) {
endPos = i + 1;
break;
}
sawStart = true;
if (c === '\\') {
if (!escaping) {
escaping = true;
i++;
continue;
}
// escaped \ char, fall through and treat like normal char
}
if (c === '[' && !escaping) {
// either a posix class, a collation equivalent, or just a [
for (const [cls, [unip, u, neg]] of Object.entries(posixClasses)) {
if (glob.startsWith(cls, i)) {
// invalid, [a-[] is fine, but not [a-[:alpha]]
if (rangeStart) {
return ['$.', false, glob.length - pos, true];
}
i += cls.length;
if (neg)
negs.push(unip);
else
ranges.push(unip);
uflag = uflag || u;
continue WHILE;
}
}
}
// now it's just a normal character, effectively
escaping = false;
if (rangeStart) {
// throw this range away if it's not valid, but others
// can still match.
if (c > rangeStart) {
ranges.push(braceEscape(rangeStart) + '-' + braceEscape(c));
}
else if (c === rangeStart) {
ranges.push(braceEscape(c));
}
rangeStart = '';
i++;
continue;
}
// now might be the start of a range.
// can be either c-d or c-] or c<more...>] or c] at this point
if (glob.startsWith('-]', i + 1)) {
ranges.push(braceEscape(c + '-'));
i += 2;
continue;
}
if (glob.startsWith('-', i + 1)) {
rangeStart = c;
i += 2;
continue;
}
// not the start of a range, just a single character
ranges.push(braceEscape(c));
i++;
}
if (endPos < i) {
// didn't see the end of the class, not a valid class,
// but might still be valid as a literal match.
return ['', false, 0, false];
}
// if we got no ranges and no negates, then we have a range that
// cannot possibly match anything, and that poisons the whole glob
if (!ranges.length && !negs.length) {
return ['$.', false, glob.length - pos, true];
}
// if we got one positive range, and it's a single character, then that's
// not actually a magic pattern, it's just that one literal character.
// we should not treat that as "magic", we should just return the literal
// character. [_] is a perfectly valid way to escape glob magic chars.
if (negs.length === 0 &&
ranges.length === 1 &&
/^\\?.$/.test(ranges[0]) &&
!negate) {
const r = ranges[0].length === 2 ? ranges[0].slice(-1) : ranges[0];
return [regexpEscape(r), false, endPos - pos, false];
}
const sranges = '[' + (negate ? '^' : '') + rangesToString(ranges) + ']';
const snegs = '[' + (negate ? '' : '^') + rangesToString(negs) + ']';
const comb = ranges.length && negs.length ? '(' + sranges + '|' + snegs + ')'
: ranges.length ? sranges
: snegs;
return [comb, uflag, endPos - pos, true];
};
exports.parseClass = parseClass;
//# sourceMappingURL=brace-expressions.js.map

1
node_modules/nodemon/node_modules/minimatch/dist/commonjs/brace-expressions.js.map generated vendored Normal file
View file

File diff suppressed because one or more lines are too long

15
node_modules/nodemon/node_modules/minimatch/dist/commonjs/escape.d.ts generated vendored Normal file
View file

@ -0,0 +1,15 @@
import { MinimatchOptions } from './index.js';
/**
* Escape all magic characters in a glob pattern.
*
* If the {@link MinimatchOptions.windowsPathsNoEscape}
* option is used, then characters are escaped by wrapping in `[]`, because
* a magic character wrapped in a character class can only be satisfied by
* that exact character. In this mode, `\` is _not_ escaped, because it is
* not interpreted as a magic character, but instead as a path separator.
*
* If the {@link MinimatchOptions.magicalBraces} option is used,
* then braces (`{` and `}`) will be escaped.
*/
export declare const escape: (s: string, { windowsPathsNoEscape, magicalBraces, }?: Pick<MinimatchOptions, "windowsPathsNoEscape" | "magicalBraces">) => string;
//# sourceMappingURL=escape.d.ts.map

1
node_modules/nodemon/node_modules/minimatch/dist/commonjs/escape.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"escape.d.ts","sourceRoot":"","sources":["../../src/escape.ts"],"names":[],"mappings":"AAAA,OAAO,EAAE,gBAAgB,EAAE,MAAM,YAAY,CAAA;AAE7C;;;;;;;;;;;GAWG;AACH,eAAO,MAAM,MAAM,GACjB,GAAG,MAAM,EACT,2CAGG,IAAI,CAAC,gBAAgB,EAAE,sBAAsB,GAAG,eAAe,CAAM,WAazE,CAAA"}

30
node_modules/nodemon/node_modules/minimatch/dist/commonjs/escape.js generated vendored Normal file
View file

@ -0,0 +1,30 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.escape = void 0;
/**
* Escape all magic characters in a glob pattern.
*
* If the {@link MinimatchOptions.windowsPathsNoEscape}
* option is used, then characters are escaped by wrapping in `[]`, because
* a magic character wrapped in a character class can only be satisfied by
* that exact character. In this mode, `\` is _not_ escaped, because it is
* not interpreted as a magic character, but instead as a path separator.
*
* If the {@link MinimatchOptions.magicalBraces} option is used,
* then braces (`{` and `}`) will be escaped.
*/
const escape = (s, { windowsPathsNoEscape = false, magicalBraces = false, } = {}) => {
// don't need to escape +@! because we escape the parens
// that make those magic, and escaping ! as [!] isn't valid,
// because [!]] is a valid glob class meaning not ']'.
if (magicalBraces) {
return windowsPathsNoEscape ?
s.replace(/[?*()[\]{}]/g, '[$&]')
: s.replace(/[?*()[\]\\{}]/g, '\\$&');
}
return windowsPathsNoEscape ?
s.replace(/[?*()[\]]/g, '[$&]')
: s.replace(/[?*()[\]\\]/g, '\\$&');
};
exports.escape = escape;
//# sourceMappingURL=escape.js.map

1
node_modules/nodemon/node_modules/minimatch/dist/commonjs/escape.js.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"escape.js","sourceRoot":"","sources":["../../src/escape.ts"],"names":[],"mappings":";;;AAEA;;;;;;;;;;;GAWG;AACI,MAAM,MAAM,GAAG,CACpB,CAAS,EACT,EACE,oBAAoB,GAAG,KAAK,EAC5B,aAAa,GAAG,KAAK,MAC+C,EAAE,EACxE,EAAE;IACF,wDAAwD;IACxD,4DAA4D;IAC5D,sDAAsD;IACtD,IAAI,aAAa,EAAE,CAAC;QAClB,OAAO,oBAAoB,CAAC,CAAC;YACzB,CAAC,CAAC,OAAO,CAAC,cAAc,EAAE,MAAM,CAAC;YACnC,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,gBAAgB,EAAE,MAAM,CAAC,CAAA;IACzC,CAAC;IACD,OAAO,oBAAoB,CAAC,CAAC;QACzB,CAAC,CAAC,OAAO,CAAC,YAAY,EAAE,MAAM,CAAC;QACjC,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,cAAc,EAAE,MAAM,CAAC,CAAA;AACvC,CAAC,CAAA;AAlBY,QAAA,MAAM,UAkBlB","sourcesContent":["import { MinimatchOptions } from './index.js'\n\n/**\n * Escape all magic characters in a glob pattern.\n *\n * If the {@link MinimatchOptions.windowsPathsNoEscape}\n * option is used, then characters are escaped by wrapping in `[]`, because\n * a magic character wrapped in a character class can only be satisfied by\n * that exact character. In this mode, `\\` is _not_ escaped, because it is\n * not interpreted as a magic character, but instead as a path separator.\n *\n * If the {@link MinimatchOptions.magicalBraces} option is used,\n * then braces (`{` and `}`) will be escaped.\n */\nexport const escape = (\n s: string,\n {\n windowsPathsNoEscape = false,\n magicalBraces = false,\n }: Pick<MinimatchOptions, 'windowsPathsNoEscape' | 'magicalBraces'> = {},\n) => {\n // don't need to escape +@! because we escape the parens\n // that make those magic, and escaping ! as [!] isn't valid,\n // because [!]] is a valid glob class meaning not ']'.\n if (magicalBraces) {\n return windowsPathsNoEscape ?\n s.replace(/[?*()[\\]{}]/g, '[$&]')\n : s.replace(/[?*()[\\]\\\\{}]/g, '\\\\$&')\n }\n return windowsPathsNoEscape ?\n s.replace(/[?*()[\\]]/g, '[$&]')\n : s.replace(/[?*()[\\]\\\\]/g, '\\\\$&')\n}\n"]}

174
node_modules/nodemon/node_modules/minimatch/dist/commonjs/index.d.ts generated vendored Normal file
View file

@ -0,0 +1,174 @@
import { AST } from './ast.js';
export type Platform = 'aix' | 'android' | 'darwin' | 'freebsd' | 'haiku' | 'linux' | 'openbsd' | 'sunos' | 'win32' | 'cygwin' | 'netbsd';
export interface MinimatchOptions {
/** do not expand `{x,y}` style braces */
nobrace?: boolean;
/** do not treat patterns starting with `#` as a comment */
nocomment?: boolean;
/** do not treat patterns starting with `!` as a negation */
nonegate?: boolean;
/** print LOTS of debugging output */
debug?: boolean;
/** treat `**` the same as `*` */
noglobstar?: boolean;
/** do not expand extglobs like `+(a|b)` */
noext?: boolean;
/** return the pattern if nothing matches */
nonull?: boolean;
/** treat `\\` as a path separator, not an escape character */
windowsPathsNoEscape?: boolean;
/**
* inverse of {@link MinimatchOptions.windowsPathsNoEscape}
* @deprecated
*/
allowWindowsEscape?: boolean;
/**
* Compare a partial path to a pattern. As long as the parts
* of the path that are present are not contradicted by the
* pattern, it will be treated as a match. This is useful in
* applications where you're walking through a folder structure,
* and don't yet have the full path, but want to ensure that you
* do not walk down paths that can never be a match.
*/
partial?: boolean;
/** allow matches that start with `.` even if the pattern does not */
dot?: boolean;
/** ignore case */
nocase?: boolean;
/** ignore case only in wildcard patterns */
nocaseMagicOnly?: boolean;
/** consider braces to be "magic" for the purpose of `hasMagic` */
magicalBraces?: boolean;
/**
* If set, then patterns without slashes will be matched
* against the basename of the path if it contains slashes.
* For example, `a?b` would match the path `/xyz/123/acb`, but
* not `/xyz/acb/123`.
*/
matchBase?: boolean;
/** invert the results of negated matches */
flipNegate?: boolean;
/** do not collapse multiple `/` into a single `/` */
preserveMultipleSlashes?: boolean;
/**
* A number indicating the level of optimization that should be done
* to the pattern prior to parsing and using it for matches.
*/
optimizationLevel?: number;
/** operating system platform */
platform?: Platform;
/**
* When a pattern starts with a UNC path or drive letter, and in
* `nocase:true` mode, do not convert the root portions of the
* pattern into a case-insensitive regular expression, and instead
* leave them as strings.
*
* This is the default when the platform is `win32` and
* `nocase:true` is set.
*/
windowsNoMagicRoot?: boolean;
/**
* max number of `{...}` patterns to expand. Default 100_000.
*/
braceExpandMax?: number;
/**
* Max number of non-adjacent `**` patterns to recursively walk down.
*
* The default of 200 is almost certainly high enough for most purposes,
* and can handle absurdly excessive patterns.
*/
maxGlobstarRecursion?: number;
/**
* Max depth to traverse for nested extglobs like `*(a|b|c)`
*
* Default is 2, which is quite low, but any higher value
* swiftly results in punishing performance impacts. Note
* that this is *not* relevant when the globstar types can
* be safely coalesced into a single set.
*
* For example, `*(a|@(b|c)|d)` would be flattened into
* `*(a|b|c|d)`. Thus, many common extglobs will retain good
* performance and never hit this limit, even if they are
* excessively deep and complicated.
*
* If the limit is hit, then the extglob characters are simply
* not parsed, and the pattern effectively switches into
* `noextglob: true` mode for the contents of that nested
* sub-pattern. This will typically _not_ result in a match,
* but is considered a valid trade-off for security and
* performance.
*/
maxExtglobRecursion?: number;
}
export declare const minimatch: {
(p: string, pattern: string, options?: MinimatchOptions): boolean;
sep: Sep;
GLOBSTAR: typeof GLOBSTAR;
filter: (pattern: string, options?: MinimatchOptions) => (p: string) => boolean;
defaults: (def: MinimatchOptions) => typeof minimatch;
braceExpand: (pattern: string, options?: MinimatchOptions) => string[];
makeRe: (pattern: string, options?: MinimatchOptions) => false | MMRegExp;
match: (list: string[], pattern: string, options?: MinimatchOptions) => string[];
AST: typeof AST;
Minimatch: typeof Minimatch;
escape: (s: string, { windowsPathsNoEscape, magicalBraces, }?: Pick<MinimatchOptions, "windowsPathsNoEscape" | "magicalBraces">) => string;
unescape: (s: string, { windowsPathsNoEscape, magicalBraces, }?: Pick<MinimatchOptions, "windowsPathsNoEscape" | "magicalBraces">) => string;
};
export type Sep = '\\' | '/';
export declare const sep: Sep;
export declare const GLOBSTAR: unique symbol;
export declare const filter: (pattern: string, options?: MinimatchOptions) => (p: string) => boolean;
export declare const defaults: (def: MinimatchOptions) => typeof minimatch;
export declare const braceExpand: (pattern: string, options?: MinimatchOptions) => string[];
export declare const makeRe: (pattern: string, options?: MinimatchOptions) => false | MMRegExp;
export declare const match: (list: string[], pattern: string, options?: MinimatchOptions) => string[];
export type MMRegExp = RegExp & {
_src?: string;
_glob?: string;
};
export type ParseReturnFiltered = string | MMRegExp | typeof GLOBSTAR;
export type ParseReturn = ParseReturnFiltered | false;
export declare class Minimatch {
#private;
options: MinimatchOptions;
set: ParseReturnFiltered[][];
pattern: string;
windowsPathsNoEscape: boolean;
nonegate: boolean;
negate: boolean;
comment: boolean;
empty: boolean;
preserveMultipleSlashes: boolean;
partial: boolean;
globSet: string[];
globParts: string[][];
nocase: boolean;
isWindows: boolean;
platform: Platform;
windowsNoMagicRoot: boolean;
maxGlobstarRecursion: number;
regexp: false | null | MMRegExp;
constructor(pattern: string, options?: MinimatchOptions);
hasMagic(): boolean;
debug(..._: any[]): void;
make(): void;
preprocess(globParts: string[][]): string[][];
adjascentGlobstarOptimize(globParts: string[][]): string[][];
levelOneOptimize(globParts: string[][]): string[][];
levelTwoFileOptimize(parts: string | string[]): string[];
firstPhasePreProcess(globParts: string[][]): string[][];
secondPhasePreProcess(globParts: string[][]): string[][];
partsMatch(a: string[], b: string[], emptyGSMatch?: boolean): false | string[];
parseNegate(): void;
matchOne(file: string[], pattern: ParseReturn[], partial?: boolean): boolean;
braceExpand(): string[];
parse(pattern: string): ParseReturn;
makeRe(): false | MMRegExp;
slashSplit(p: string): string[];
match(f: string, partial?: boolean): boolean;
static defaults(def: MinimatchOptions): typeof Minimatch;
}
export { AST } from './ast.js';
export { escape } from './escape.js';
export { unescape } from './unescape.js';
//# sourceMappingURL=index.d.ts.map

1
node_modules/nodemon/node_modules/minimatch/dist/commonjs/index.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"index.d.ts","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":"AAEA,OAAO,EAAE,GAAG,EAAe,MAAM,UAAU,CAAA;AAI3C,MAAM,MAAM,QAAQ,GAChB,KAAK,GACL,SAAS,GACT,QAAQ,GACR,SAAS,GACT,OAAO,GACP,OAAO,GACP,SAAS,GACT,OAAO,GACP,OAAO,GACP,QAAQ,GACR,QAAQ,CAAA;AAEZ,MAAM,WAAW,gBAAgB;IAC/B,yCAAyC;IACzC,OAAO,CAAC,EAAE,OAAO,CAAA;IACjB,2DAA2D;IAC3D,SAAS,CAAC,EAAE,OAAO,CAAA;IACnB,4DAA4D;IAC5D,QAAQ,CAAC,EAAE,OAAO,CAAA;IAClB,qCAAqC;IACrC,KAAK,CAAC,EAAE,OAAO,CAAA;IACf,iCAAiC;IACjC,UAAU,CAAC,EAAE,OAAO,CAAA;IACpB,2CAA2C;IAC3C,KAAK,CAAC,EAAE,OAAO,CAAA;IACf,4CAA4C;IAC5C,MAAM,CAAC,EAAE,OAAO,CAAA;IAChB,8DAA8D;IAC9D,oBAAoB,CAAC,EAAE,OAAO,CAAA;IAC9B;;;OAGG;IACH,kBAAkB,CAAC,EAAE,OAAO,CAAA;IAC5B;;;;;;;OAOG;IACH,OAAO,CAAC,EAAE,OAAO,CAAA;IACjB,qEAAqE;IACrE,GAAG,CAAC,EAAE,OAAO,CAAA;IACb,kBAAkB;IAClB,MAAM,CAAC,EAAE,OAAO,CAAA;IAChB,4CAA4C;IAC5C,eAAe,CAAC,EAAE,OAAO,CAAA;IACzB,kEAAkE;IAClE,aAAa,CAAC,EAAE,OAAO,CAAA;IACvB;;;;;OAKG;IACH,SAAS,CAAC,EAAE,OAAO,CAAA;IACnB,4CAA4C;IAC5C,UAAU,CAAC,EAAE,OAAO,CAAA;IACpB,qDAAqD;IACrD,uBAAuB,CAAC,EAAE,OAAO,CAAA;IACjC;;;OAGG;IACH,iBAAiB,CAAC,EAAE,MAAM,CAAA;IAC1B,gCAAgC;IAChC,QAAQ,CAAC,EAAE,QAAQ,CAAA;IACnB;;;;;;;;OAQG;IACH,kBAAkB,CAAC,EAAE,OAAO,CAAA;IAC5B;;OAEG;IACH,cAAc,CAAC,EAAE,MAAM,CAAA;IACvB;;;;;OAKG;IACH,oBAAoB,CAAC,EAAE,MAAM,CAAA;IAE7B;;;;;;;;;;;;;;;;;;;OAmBG;IACH,mBAAmB,CAAC,EAAE,MAAM,CAAA;CAC7B;AAED,eAAO,MAAM,SAAS;QACjB,MAAM,WACA,MAAM,YACN,gBAAgB;;;sBA4Gf,MAAM,YAAW,gBAAgB,MAC1C,GAAG,MAAM;oBAOkB,gBAAgB,KAAG,OAAO,SAAS;2BAuFtD,MAAM,YACN,gBAAgB;sBA2BK,MAAM,YAAW,gBAAgB;kBAKzD,MAAM,EAAE,WACL,MAAM,YACN,gBAAgB;;;;;CApO1B,CAAA;AAkED,MAAM,MAAM,GAAG,GAAG,IAAI,GAAG,GAAG,CAAA;AAQ5B,eAAO,MAAM,GAAG,KAC+C,CAAA;AAG/D,eAAO,MAAM,QAAQ,eAAwB,CAAA;AAmB7C,eAAO,MAAM,MAAM,GAChB,SAAS,MAAM,EAAE,UAAS,gBAAqB,MAC/C,GAAG,MAAM,YACsB,CAAA;AAMlC,eAAO,MAAM,QAAQ,GAAI,KAAK,gBAAgB,KAAG,OAAO,SAyEvD,CAAA;AAaD,eAAO,MAAM,WAAW,GACtB,SAAS,MAAM,EACf,UAAS,gBAAqB,aAY/B,CAAA;AAeD,eAAO,MAAM,MAAM,GAAI,SAAS,MAAM,EAAE,UAAS,gBAAqB,qBAC5B,CAAA;AAG1C,eAAO,MAAM,KAAK,GAChB,MAAM,MAAM,EAAE,EACd,SAAS,MAAM,EACf,UAAS,gBAAqB,aAQ/B,CAAA;AAQD,MAAM,MAAM,QAAQ,GAAG,MAAM,GAAG;IAC9B,IAAI,CAAC,EAAE,MAAM,CAAA;IACb,KAAK,CAAC,EAAE,MAAM,CAAA;CACf,CAAA;AAED,MAAM,MAAM,mBAAmB,GAAG,MAAM,GAAG,QAAQ,GAAG,OAAO,QAAQ,CAAA;AACrE,MAAM,MAAM,WAAW,GAAG,mBAAmB,GAAG,KAAK,CAAA;AAErD,qBAAa,SAAS;;IACpB,OAAO,EAAE,gBAAgB,CAAA;IACzB,GAAG,EAAE,mBAAmB,EAAE,EAAE,CAAA;IAC5B,OAAO,EAAE,MAAM,CAAA;IAEf,oBAAoB,EAAE,OAAO,CAAA;IAC7B,QAAQ,EAAE,OAAO,CAAA;IACjB,MAAM,EAAE,OAAO,CAAA;IACf,OAAO,EAAE,OAAO,CAAA;IAChB,KAAK,EAAE,OAAO,CAAA;IACd,uBAAuB,EAAE,OAAO,CAAA;IAChC,OAAO,EAAE,OAAO,CAAA;IAChB,OAAO,EAAE,MAAM,EAAE,CAAA;IACjB,SAAS,EAAE,MAAM,EAAE,EAAE,CAAA;IACrB,MAAM,EAAE,OAAO,CAAA;IAEf,SAAS,EAAE,OAAO,CAAA;IAClB,QAAQ,EAAE,QAAQ,CAAA;IAClB,kBAAkB,EAAE,OAAO,CAAA;IAC3B,oBAAoB,EAAE,MAAM,CAAA;IAE5B,MAAM,EAAE,KAAK,GAAG,IAAI,GAAG,QAAQ,CAAA;gBACnB,OAAO,EAAE,MAAM,EAAE,OAAO,GAAE,gBAAqB;IAqC3D,QAAQ,IAAI,OAAO;IAYnB,KAAK,CAAC,GAAG,CAAC,EAAE,GAAG,EAAE;IAEjB,IAAI;IA6FJ,UAAU,CAAC,SAAS,EAAE,MAAM,EAAE,EAAE;IA8BhC,yBAAyB,CAAC,SAAS,EAAE,MAAM,EAAE,EAAE;IAiB/C,gBAAgB,CAAC,SAAS,EAAE,MAAM,EAAE,EAAE;IAoBtC,oBAAoB,CAAC,KAAK,EAAE,MAAM,GAAG,MAAM,EAAE;IA6D7C,oBAAoB,CAAC,SAAS,EAAE,MAAM,EAAE,EAAE;IA0F1C,qBAAqB,CAAC,SAAS,EAAE,MAAM,EAAE,EAAE,GAAG,MAAM,EAAE,EAAE;IAkBxD,UAAU,CACR,CAAC,EAAE,MAAM,EAAE,EACX,CAAC,EAAE,MAAM,EAAE,EACX,YAAY,GAAE,OAAe,GAC5B,KAAK,GAAG,MAAM,EAAE;IA+CnB,WAAW;IAqBX,QAAQ,CACN,IAAI,EAAE,MAAM,EAAE,EACd,OAAO,EAAE,WAAW,EAAE,EACtB,OAAO,GAAE,OAAe;IA8W1B,WAAW;IAIX,KAAK,CAAC,OAAO,EAAE,MAAM,GAAG,WAAW;IA6CnC,MAAM;IAuGN,UAAU,CAAC,CAAC,EAAE,MAAM;IAepB,KAAK,CAAC,CAAC,EAAE,MAAM,EAAE,OAAO,UAAe;IAiEvC,MAAM,CAAC,QAAQ,CAAC,GAAG,EAAE,gBAAgB;CAGtC;AAED,OAAO,EAAE,GAAG,EAAE,MAAM,UAAU,CAAA;AAC9B,OAAO,EAAE,MAAM,EAAE,MAAM,aAAa,CAAA;AACpC,OAAO,EAAE,QAAQ,EAAE,MAAM,eAAe,CAAA"}

1121
node_modules/nodemon/node_modules/minimatch/dist/commonjs/index.js generated vendored Normal file
View file

File diff suppressed because it is too large Load diff

1
node_modules/nodemon/node_modules/minimatch/dist/commonjs/index.js.map generated vendored Normal file
View file

File diff suppressed because one or more lines are too long

3
node_modules/nodemon/node_modules/minimatch/dist/commonjs/package.json generated vendored Normal file
View file

@ -0,0 +1,3 @@
{
"type": "commonjs"
}

22
node_modules/nodemon/node_modules/minimatch/dist/commonjs/unescape.d.ts generated vendored Normal file
View file

@ -0,0 +1,22 @@
import { MinimatchOptions } from './index.js';
/**
* Un-escape a string that has been escaped with {@link escape}.
*
* If the {@link MinimatchOptions.windowsPathsNoEscape} option is used, then
* square-bracket escapes are removed, but not backslash escapes.
*
* For example, it will turn the string `'[*]'` into `*`, but it will not
* turn `'\\*'` into `'*'`, because `\` is a path separator in
* `windowsPathsNoEscape` mode.
*
* When `windowsPathsNoEscape` is not set, then both square-bracket escapes and
* backslash escapes are removed.
*
* Slashes (and backslashes in `windowsPathsNoEscape` mode) cannot be escaped
* or unescaped.
*
* When `magicalBraces` is not set, escapes of braces (`{` and `}`) will not be
* unescaped.
*/
export declare const unescape: (s: string, { windowsPathsNoEscape, magicalBraces, }?: Pick<MinimatchOptions, "windowsPathsNoEscape" | "magicalBraces">) => string;
//# sourceMappingURL=unescape.d.ts.map

1
node_modules/nodemon/node_modules/minimatch/dist/commonjs/unescape.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"unescape.d.ts","sourceRoot":"","sources":["../../src/unescape.ts"],"names":[],"mappings":"AAAA,OAAO,EAAE,gBAAgB,EAAE,MAAM,YAAY,CAAA;AAE7C;;;;;;;;;;;;;;;;;;GAkBG;AAEH,eAAO,MAAM,QAAQ,GACnB,GAAG,MAAM,EACT,2CAGG,IAAI,CAAC,gBAAgB,EAAE,sBAAsB,GAAG,eAAe,CAAM,WAczE,CAAA"}

38
node_modules/nodemon/node_modules/minimatch/dist/commonjs/unescape.js generated vendored Normal file
View file

@ -0,0 +1,38 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.unescape = void 0;
/**
* Un-escape a string that has been escaped with {@link escape}.
*
* If the {@link MinimatchOptions.windowsPathsNoEscape} option is used, then
* square-bracket escapes are removed, but not backslash escapes.
*
* For example, it will turn the string `'[*]'` into `*`, but it will not
* turn `'\\*'` into `'*'`, because `\` is a path separator in
* `windowsPathsNoEscape` mode.
*
* When `windowsPathsNoEscape` is not set, then both square-bracket escapes and
* backslash escapes are removed.
*
* Slashes (and backslashes in `windowsPathsNoEscape` mode) cannot be escaped
* or unescaped.
*
* When `magicalBraces` is not set, escapes of braces (`{` and `}`) will not be
* unescaped.
*/
const unescape = (s, { windowsPathsNoEscape = false, magicalBraces = true, } = {}) => {
if (magicalBraces) {
return windowsPathsNoEscape ?
s.replace(/\[([^\/\\])\]/g, '$1')
: s
.replace(/((?!\\).|^)\[([^\/\\])\]/g, '$1$2')
.replace(/\\([^\/])/g, '$1');
}
return windowsPathsNoEscape ?
s.replace(/\[([^\/\\{}])\]/g, '$1')
: s
.replace(/((?!\\).|^)\[([^\/\\{}])\]/g, '$1$2')
.replace(/\\([^\/{}])/g, '$1');
};
exports.unescape = unescape;
//# sourceMappingURL=unescape.js.map

1
node_modules/nodemon/node_modules/minimatch/dist/commonjs/unescape.js.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"unescape.js","sourceRoot":"","sources":["../../src/unescape.ts"],"names":[],"mappings":";;;AAEA;;;;;;;;;;;;;;;;;;GAkBG;AAEI,MAAM,QAAQ,GAAG,CACtB,CAAS,EACT,EACE,oBAAoB,GAAG,KAAK,EAC5B,aAAa,GAAG,IAAI,MACgD,EAAE,EACxE,EAAE;IACF,IAAI,aAAa,EAAE,CAAC;QAClB,OAAO,oBAAoB,CAAC,CAAC;YACzB,CAAC,CAAC,OAAO,CAAC,gBAAgB,EAAE,IAAI,CAAC;YACnC,CAAC,CAAC,CAAC;iBACE,OAAO,CAAC,2BAA2B,EAAE,MAAM,CAAC;iBAC5C,OAAO,CAAC,YAAY,EAAE,IAAI,CAAC,CAAA;IACpC,CAAC;IACD,OAAO,oBAAoB,CAAC,CAAC;QACzB,CAAC,CAAC,OAAO,CAAC,kBAAkB,EAAE,IAAI,CAAC;QACrC,CAAC,CAAC,CAAC;aACE,OAAO,CAAC,6BAA6B,EAAE,MAAM,CAAC;aAC9C,OAAO,CAAC,cAAc,EAAE,IAAI,CAAC,CAAA;AACtC,CAAC,CAAA;AAnBY,QAAA,QAAQ,YAmBpB","sourcesContent":["import { MinimatchOptions } from './index.js'\n\n/**\n * Un-escape a string that has been escaped with {@link escape}.\n *\n * If the {@link MinimatchOptions.windowsPathsNoEscape} option is used, then\n * square-bracket escapes are removed, but not backslash escapes.\n *\n * For example, it will turn the string `'[*]'` into `*`, but it will not\n * turn `'\\\\*'` into `'*'`, because `\\` is a path separator in\n * `windowsPathsNoEscape` mode.\n *\n * When `windowsPathsNoEscape` is not set, then both square-bracket escapes and\n * backslash escapes are removed.\n *\n * Slashes (and backslashes in `windowsPathsNoEscape` mode) cannot be escaped\n * or unescaped.\n *\n * When `magicalBraces` is not set, escapes of braces (`{` and `}`) will not be\n * unescaped.\n */\n\nexport const unescape = (\n s: string,\n {\n windowsPathsNoEscape = false,\n magicalBraces = true,\n }: Pick<MinimatchOptions, 'windowsPathsNoEscape' | 'magicalBraces'> = {},\n) => {\n if (magicalBraces) {\n return windowsPathsNoEscape ?\n s.replace(/\\[([^\\/\\\\])\\]/g, '$1')\n : s\n .replace(/((?!\\\\).|^)\\[([^\\/\\\\])\\]/g, '$1$2')\n .replace(/\\\\([^\\/])/g, '$1')\n }\n return windowsPathsNoEscape ?\n s.replace(/\\[([^\\/\\\\{}])\\]/g, '$1')\n : s\n .replace(/((?!\\\\).|^)\\[([^\\/\\\\{}])\\]/g, '$1$2')\n .replace(/\\\\([^\\/{}])/g, '$1')\n}\n"]}

2
node_modules/nodemon/node_modules/minimatch/dist/esm/assert-valid-pattern.d.ts generated vendored Normal file
View file

@ -0,0 +1,2 @@
export declare const assertValidPattern: (pattern: unknown) => void;
//# sourceMappingURL=assert-valid-pattern.d.ts.map

1
node_modules/nodemon/node_modules/minimatch/dist/esm/assert-valid-pattern.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"assert-valid-pattern.d.ts","sourceRoot":"","sources":["../../src/assert-valid-pattern.ts"],"names":[],"mappings":"AACA,eAAO,MAAM,kBAAkB,EAAE,CAAC,OAAO,EAAE,OAAO,KAAK,IAUtD,CAAA"}

10
node_modules/nodemon/node_modules/minimatch/dist/esm/assert-valid-pattern.js generated vendored Normal file
View file

@ -0,0 +1,10 @@
const MAX_PATTERN_LENGTH = 1024 * 64;
export const assertValidPattern = (pattern) => {
if (typeof pattern !== 'string') {
throw new TypeError('invalid pattern');
}
if (pattern.length > MAX_PATTERN_LENGTH) {
throw new TypeError('pattern is too long');
}
};
//# sourceMappingURL=assert-valid-pattern.js.map

1
node_modules/nodemon/node_modules/minimatch/dist/esm/assert-valid-pattern.js.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"assert-valid-pattern.js","sourceRoot":"","sources":["../../src/assert-valid-pattern.ts"],"names":[],"mappings":"AAAA,MAAM,kBAAkB,GAAG,IAAI,GAAG,EAAE,CAAA;AACpC,MAAM,CAAC,MAAM,kBAAkB,GAA+B,CAC5D,OAAgB,EACW,EAAE;IAC7B,IAAI,OAAO,OAAO,KAAK,QAAQ,EAAE,CAAC;QAChC,MAAM,IAAI,SAAS,CAAC,iBAAiB,CAAC,CAAA;IACxC,CAAC;IAED,IAAI,OAAO,CAAC,MAAM,GAAG,kBAAkB,EAAE,CAAC;QACxC,MAAM,IAAI,SAAS,CAAC,qBAAqB,CAAC,CAAA;IAC5C,CAAC;AACH,CAAC,CAAA","sourcesContent":["const MAX_PATTERN_LENGTH = 1024 * 64\nexport const assertValidPattern: (pattern: unknown) => void = (\n pattern: unknown,\n): asserts pattern is string => {\n if (typeof pattern !== 'string') {\n throw new TypeError('invalid pattern')\n }\n\n if (pattern.length > MAX_PATTERN_LENGTH) {\n throw new TypeError('pattern is too long')\n }\n}\n"]}

22
node_modules/nodemon/node_modules/minimatch/dist/esm/ast.d.ts generated vendored Normal file
View file

@ -0,0 +1,22 @@
import { MinimatchOptions, MMRegExp } from './index.js';
export type ExtglobType = '!' | '?' | '+' | '*' | '@';
export declare class AST {
#private;
type: ExtglobType | null;
id: number;
get depth(): number;
constructor(type: ExtglobType | null, parent?: AST, options?: MinimatchOptions);
get hasMagic(): boolean | undefined;
toString(): string;
push(...parts: (string | AST)[]): void;
toJSON(): any[];
isStart(): boolean;
isEnd(): boolean;
copyIn(part: AST | string): void;
clone(parent: AST): AST;
static fromGlob(pattern: string, options?: MinimatchOptions): AST;
toMMPattern(): MMRegExp | string;
get options(): MinimatchOptions;
toRegExpSource(allowDot?: boolean): [re: string, body: string, hasMagic: boolean, uflag: boolean];
}
//# sourceMappingURL=ast.d.ts.map

1
node_modules/nodemon/node_modules/minimatch/dist/esm/ast.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"ast.d.ts","sourceRoot":"","sources":["../../src/ast.ts"],"names":[],"mappings":"AAGA,OAAO,EAAE,gBAAgB,EAAE,QAAQ,EAAE,MAAM,YAAY,CAAA;AAwCvD,MAAM,MAAM,WAAW,GAAG,GAAG,GAAG,GAAG,GAAG,GAAG,GAAG,GAAG,GAAG,GAAG,CAAA;AA6IrD,qBAAa,GAAG;;IACd,IAAI,EAAE,WAAW,GAAG,IAAI,CAAA;IAexB,EAAE,SAAO;IAET,IAAI,KAAK,IAAI,MAAM,CAElB;gBAgBC,IAAI,EAAE,WAAW,GAAG,IAAI,EACxB,MAAM,CAAC,EAAE,GAAG,EACZ,OAAO,GAAE,gBAAqB;IAahC,IAAI,QAAQ,IAAI,OAAO,GAAG,SAAS,CAUlC;IAGD,QAAQ,IAAI,MAAM;IA+ClB,IAAI,CAAC,GAAG,KAAK,EAAE,CAAC,MAAM,GAAG,GAAG,CAAC,EAAE;IAe/B,MAAM;IAkBN,OAAO,IAAI,OAAO;IAgBlB,KAAK,IAAI,OAAO;IAYhB,MAAM,CAAC,IAAI,EAAE,GAAG,GAAG,MAAM;IAKzB,KAAK,CAAC,MAAM,EAAE,GAAG;IAwQjB,MAAM,CAAC,QAAQ,CAAC,OAAO,EAAE,MAAM,EAAE,OAAO,GAAE,gBAAqB;IAQ/D,WAAW,IAAI,QAAQ,GAAG,MAAM;IA2BhC,IAAI,OAAO,qBAEV;IAuED,cAAc,CACZ,QAAQ,CAAC,EAAE,OAAO,GACjB,CAAC,EAAE,EAAE,MAAM,EAAE,IAAI,EAAE,MAAM,EAAE,QAAQ,EAAE,OAAO,EAAE,KAAK,EAAE,OAAO,CAAC;CA6OjE"}

842
node_modules/nodemon/node_modules/minimatch/dist/esm/ast.js generated vendored Normal file
View file

@ -0,0 +1,842 @@
// parse a single path portion
var _a;
import { parseClass } from './brace-expressions.js';
import { unescape } from './unescape.js';
const types = new Set(['!', '?', '+', '*', '@']);
const isExtglobType = (c) => types.has(c);
const isExtglobAST = (c) => isExtglobType(c.type);
// Map of which extglob types can adopt the children of a nested extglob
//
// anything but ! can adopt a matching type:
// +(a|+(b|c)|d) => +(a|b|c|d)
// *(a|*(b|c)|d) => *(a|b|c|d)
// @(a|@(b|c)|d) => @(a|b|c|d)
// ?(a|?(b|c)|d) => ?(a|b|c|d)
//
// * can adopt anything, because 0 or repetition is allowed
// *(a|?(b|c)|d) => *(a|b|c|d)
// *(a|+(b|c)|d) => *(a|b|c|d)
// *(a|@(b|c)|d) => *(a|b|c|d)
//
// + can adopt @, because 1 or repetition is allowed
// +(a|@(b|c)|d) => +(a|b|c|d)
//
// + and @ CANNOT adopt *, because 0 would be allowed
// +(a|*(b|c)|d) => would match "", on *(b|c)
// @(a|*(b|c)|d) => would match "", on *(b|c)
//
// + and @ CANNOT adopt ?, because 0 would be allowed
// +(a|?(b|c)|d) => would match "", on ?(b|c)
// @(a|?(b|c)|d) => would match "", on ?(b|c)
//
// ? can adopt @, because 0 or 1 is allowed
// ?(a|@(b|c)|d) => ?(a|b|c|d)
//
// ? and @ CANNOT adopt * or +, because >1 would be allowed
// ?(a|*(b|c)|d) => would match bbb on *(b|c)
// @(a|*(b|c)|d) => would match bbb on *(b|c)
// ?(a|+(b|c)|d) => would match bbb on +(b|c)
// @(a|+(b|c)|d) => would match bbb on +(b|c)
//
// ! CANNOT adopt ! (nothing else can either)
// !(a|!(b|c)|d) => !(a|b|c|d) would fail to match on b (not not b|c)
//
// ! can adopt @
// !(a|@(b|c)|d) => !(a|b|c|d)
//
// ! CANNOT adopt *
// !(a|*(b|c)|d) => !(a|b|c|d) would match on bbb, not allowed
//
// ! CANNOT adopt +
// !(a|+(b|c)|d) => !(a|b|c|d) would match on bbb, not allowed
//
// ! CANNOT adopt ?
// x!(a|?(b|c)|d) => x!(a|b|c|d) would fail to match "x"
const adoptionMap = new Map([
['!', ['@']],
['?', ['?', '@']],
['@', ['@']],
['*', ['*', '+', '?', '@']],
['+', ['+', '@']],
]);
// nested extglobs that can be adopted in, but with the addition of
// a blank '' element.
const adoptionWithSpaceMap = new Map([
['!', ['?']],
['@', ['?']],
['+', ['?', '*']],
]);
// union of the previous two maps
const adoptionAnyMap = new Map([
['!', ['?', '@']],
['?', ['?', '@']],
['@', ['?', '@']],
['*', ['*', '+', '?', '@']],
['+', ['+', '@', '?', '*']],
]);
// Extglobs that can take over their parent if they are the only child
// the key is parent, value maps child to resulting extglob parent type
// '@' is omitted because it's a special case. An `@` extglob with a single
// member can always be usurped by that subpattern.
const usurpMap = new Map([
['!', new Map([['!', '@']])],
[
'?',
new Map([
['*', '*'],
['+', '*'],
]),
],
[
'@',
new Map([
['!', '!'],
['?', '?'],
['@', '@'],
['*', '*'],
['+', '+'],
]),
],
[
'+',
new Map([
['?', '*'],
['*', '*'],
]),
],
]);
// Patterns that get prepended to bind to the start of either the
// entire string, or just a single path portion, to prevent dots
// and/or traversal patterns, when needed.
// Exts don't need the ^ or / bit, because the root binds that already.
const startNoTraversal = '(?!(?:^|/)\\.\\.?(?:$|/))';
const startNoDot = '(?!\\.)';
// characters that indicate a start of pattern needs the "no dots" bit,
// because a dot *might* be matched. ( is not in the list, because in
// the case of a child extglob, it will handle the prevention itself.
const addPatternStart = new Set(['[', '.']);
// cases where traversal is A-OK, no dot prevention needed
const justDots = new Set(['..', '.']);
const reSpecials = new Set('().*{}+?[]^$\\!');
const regExpEscape = (s) => s.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, '\\$&');
// any single thing other than /
const qmark = '[^/]';
// * => any number of characters
const star = qmark + '*?';
// use + when we need to ensure that *something* matches, because the * is
// the only thing in the path portion.
const starNoEmpty = qmark + '+?';
// remove the \ chars that we added if we end up doing a nonmagic compare
// const deslash = (s: string) => s.replace(/\\(.)/g, '$1')
let ID = 0;
export class AST {
type;
#root;
#hasMagic;
#uflag = false;
#parts = [];
#parent;
#parentIndex;
#negs;
#filledNegs = false;
#options;
#toString;
// set to true if it's an extglob with no children
// (which really means one child of '')
#emptyExt = false;
id = ++ID;
get depth() {
return (this.#parent?.depth ?? -1) + 1;
}
[Symbol.for('nodejs.util.inspect.custom')]() {
return {
'@@type': 'AST',
id: this.id,
type: this.type,
root: this.#root.id,
parent: this.#parent?.id,
depth: this.depth,
partsLength: this.#parts.length,
parts: this.#parts,
};
}
constructor(type, parent, options = {}) {
this.type = type;
// extglobs are inherently magical
if (type)
this.#hasMagic = true;
this.#parent = parent;
this.#root = this.#parent ? this.#parent.#root : this;
this.#options = this.#root === this ? options : this.#root.#options;
this.#negs = this.#root === this ? [] : this.#root.#negs;
if (type === '!' && !this.#root.#filledNegs)
this.#negs.push(this);
this.#parentIndex = this.#parent ? this.#parent.#parts.length : 0;
}
get hasMagic() {
/* c8 ignore start */
if (this.#hasMagic !== undefined)
return this.#hasMagic;
/* c8 ignore stop */
for (const p of this.#parts) {
if (typeof p === 'string')
continue;
if (p.type || p.hasMagic)
return (this.#hasMagic = true);
}
// note: will be undefined until we generate the regexp src and find out
return this.#hasMagic;
}
// reconstructs the pattern
toString() {
if (this.#toString !== undefined)
return this.#toString;
if (!this.type) {
return (this.#toString = this.#parts.map(p => String(p)).join(''));
}
else {
return (this.#toString =
this.type + '(' + this.#parts.map(p => String(p)).join('|') + ')');
}
}
#fillNegs() {
/* c8 ignore start */
if (this !== this.#root)
throw new Error('should only call on root');
if (this.#filledNegs)
return this;
/* c8 ignore stop */
// call toString() once to fill this out
this.toString();
this.#filledNegs = true;
let n;
while ((n = this.#negs.pop())) {
if (n.type !== '!')
continue;
// walk up the tree, appending everthing that comes AFTER parentIndex
let p = n;
let pp = p.#parent;
while (pp) {
for (let i = p.#parentIndex + 1; !pp.type && i < pp.#parts.length; i++) {
for (const part of n.#parts) {
/* c8 ignore start */
if (typeof part === 'string') {
throw new Error('string part in extglob AST??');
}
/* c8 ignore stop */
part.copyIn(pp.#parts[i]);
}
}
p = pp;
pp = p.#parent;
}
}
return this;
}
push(...parts) {
for (const p of parts) {
if (p === '')
continue;
/* c8 ignore start */
if (typeof p !== 'string' &&
!(p instanceof _a && p.#parent === this)) {
throw new Error('invalid part: ' + p);
}
/* c8 ignore stop */
this.#parts.push(p);
}
}
toJSON() {
const ret = this.type === null ?
this.#parts
.slice()
.map(p => (typeof p === 'string' ? p : p.toJSON()))
: [this.type, ...this.#parts.map(p => p.toJSON())];
if (this.isStart() && !this.type)
ret.unshift([]);
if (this.isEnd() &&
(this === this.#root ||
(this.#root.#filledNegs && this.#parent?.type === '!'))) {
ret.push({});
}
return ret;
}
isStart() {
if (this.#root === this)
return true;
// if (this.type) return !!this.#parent?.isStart()
if (!this.#parent?.isStart())
return false;
if (this.#parentIndex === 0)
return true;
// if everything AHEAD of this is a negation, then it's still the "start"
const p = this.#parent;
for (let i = 0; i < this.#parentIndex; i++) {
const pp = p.#parts[i];
if (!(pp instanceof _a && pp.type === '!')) {
return false;
}
}
return true;
}
isEnd() {
if (this.#root === this)
return true;
if (this.#parent?.type === '!')
return true;
if (!this.#parent?.isEnd())
return false;
if (!this.type)
return this.#parent?.isEnd();
// if not root, it'll always have a parent
/* c8 ignore start */
const pl = this.#parent ? this.#parent.#parts.length : 0;
/* c8 ignore stop */
return this.#parentIndex === pl - 1;
}
copyIn(part) {
if (typeof part === 'string')
this.push(part);
else
this.push(part.clone(this));
}
clone(parent) {
const c = new _a(this.type, parent);
for (const p of this.#parts) {
c.copyIn(p);
}
return c;
}
static #parseAST(str, ast, pos, opt, extDepth) {
const maxDepth = opt.maxExtglobRecursion ?? 2;
let escaping = false;
let inBrace = false;
let braceStart = -1;
let braceNeg = false;
if (ast.type === null) {
// outside of a extglob, append until we find a start
let i = pos;
let acc = '';
while (i < str.length) {
const c = str.charAt(i++);
// still accumulate escapes at this point, but we do ignore
// starts that are escaped
if (escaping || c === '\\') {
escaping = !escaping;
acc += c;
continue;
}
if (inBrace) {
if (i === braceStart + 1) {
if (c === '^' || c === '!') {
braceNeg = true;
}
}
else if (c === ']' && !(i === braceStart + 2 && braceNeg)) {
inBrace = false;
}
acc += c;
continue;
}
else if (c === '[') {
inBrace = true;
braceStart = i;
braceNeg = false;
acc += c;
continue;
}
// we don't have to check for adoption here, because that's
// done at the other recursion point.
const doRecurse = !opt.noext &&
isExtglobType(c) &&
str.charAt(i) === '(' &&
extDepth <= maxDepth;
if (doRecurse) {
ast.push(acc);
acc = '';
const ext = new _a(c, ast);
i = _a.#parseAST(str, ext, i, opt, extDepth + 1);
ast.push(ext);
continue;
}
acc += c;
}
ast.push(acc);
return i;
}
// some kind of extglob, pos is at the (
// find the next | or )
let i = pos + 1;
let part = new _a(null, ast);
const parts = [];
let acc = '';
while (i < str.length) {
const c = str.charAt(i++);
// still accumulate escapes at this point, but we do ignore
// starts that are escaped
if (escaping || c === '\\') {
escaping = !escaping;
acc += c;
continue;
}
if (inBrace) {
if (i === braceStart + 1) {
if (c === '^' || c === '!') {
braceNeg = true;
}
}
else if (c === ']' && !(i === braceStart + 2 && braceNeg)) {
inBrace = false;
}
acc += c;
continue;
}
else if (c === '[') {
inBrace = true;
braceStart = i;
braceNeg = false;
acc += c;
continue;
}
const doRecurse = !opt.noext &&
isExtglobType(c) &&
str.charAt(i) === '(' &&
/* c8 ignore start - the maxDepth is sufficient here */
(extDepth <= maxDepth || (ast && ast.#canAdoptType(c)));
/* c8 ignore stop */
if (doRecurse) {
const depthAdd = ast && ast.#canAdoptType(c) ? 0 : 1;
part.push(acc);
acc = '';
const ext = new _a(c, part);
part.push(ext);
i = _a.#parseAST(str, ext, i, opt, extDepth + depthAdd);
continue;
}
if (c === '|') {
part.push(acc);
acc = '';
parts.push(part);
part = new _a(null, ast);
continue;
}
if (c === ')') {
if (acc === '' && ast.#parts.length === 0) {
ast.#emptyExt = true;
}
part.push(acc);
acc = '';
ast.push(...parts, part);
return i;
}
acc += c;
}
// unfinished extglob
// if we got here, it was a malformed extglob! not an extglob, but
// maybe something else in there.
ast.type = null;
ast.#hasMagic = undefined;
ast.#parts = [str.substring(pos - 1)];
return i;
}
#canAdoptWithSpace(child) {
return this.#canAdopt(child, adoptionWithSpaceMap);
}
#canAdopt(child, map = adoptionMap) {
if (!child ||
typeof child !== 'object' ||
child.type !== null ||
child.#parts.length !== 1 ||
this.type === null) {
return false;
}
const gc = child.#parts[0];
if (!gc || typeof gc !== 'object' || gc.type === null) {
return false;
}
return this.#canAdoptType(gc.type, map);
}
#canAdoptType(c, map = adoptionAnyMap) {
return !!map.get(this.type)?.includes(c);
}
#adoptWithSpace(child, index) {
const gc = child.#parts[0];
const blank = new _a(null, gc, this.options);
blank.#parts.push('');
gc.push(blank);
this.#adopt(child, index);
}
#adopt(child, index) {
const gc = child.#parts[0];
this.#parts.splice(index, 1, ...gc.#parts);
for (const p of gc.#parts) {
if (typeof p === 'object')
p.#parent = this;
}
this.#toString = undefined;
}
#canUsurpType(c) {
const m = usurpMap.get(this.type);
return !!(m?.has(c));
}
#canUsurp(child) {
if (!child ||
typeof child !== 'object' ||
child.type !== null ||
child.#parts.length !== 1 ||
this.type === null ||
this.#parts.length !== 1) {
return false;
}
const gc = child.#parts[0];
if (!gc || typeof gc !== 'object' || gc.type === null) {
return false;
}
return this.#canUsurpType(gc.type);
}
#usurp(child) {
const m = usurpMap.get(this.type);
const gc = child.#parts[0];
const nt = m?.get(gc.type);
/* c8 ignore start - impossible */
if (!nt)
return false;
/* c8 ignore stop */
this.#parts = gc.#parts;
for (const p of this.#parts) {
if (typeof p === 'object') {
p.#parent = this;
}
}
this.type = nt;
this.#toString = undefined;
this.#emptyExt = false;
}
static fromGlob(pattern, options = {}) {
const ast = new _a(null, undefined, options);
_a.#parseAST(pattern, ast, 0, options, 0);
return ast;
}
// returns the regular expression if there's magic, or the unescaped
// string if not.
toMMPattern() {
// should only be called on root
/* c8 ignore start */
if (this !== this.#root)
return this.#root.toMMPattern();
/* c8 ignore stop */
const glob = this.toString();
const [re, body, hasMagic, uflag] = this.toRegExpSource();
// if we're in nocase mode, and not nocaseMagicOnly, then we do
// still need a regular expression if we have to case-insensitively
// match capital/lowercase characters.
const anyMagic = hasMagic ||
this.#hasMagic ||
(this.#options.nocase &&
!this.#options.nocaseMagicOnly &&
glob.toUpperCase() !== glob.toLowerCase());
if (!anyMagic) {
return body;
}
const flags = (this.#options.nocase ? 'i' : '') + (uflag ? 'u' : '');
return Object.assign(new RegExp(`^${re}$`, flags), {
_src: re,
_glob: glob,
});
}
get options() {
return this.#options;
}
// returns the string match, the regexp source, whether there's magic
// in the regexp (so a regular expression is required) and whether or
// not the uflag is needed for the regular expression (for posix classes)
// TODO: instead of injecting the start/end at this point, just return
// the BODY of the regexp, along with the start/end portions suitable
// for binding the start/end in either a joined full-path makeRe context
// (where we bind to (^|/), or a standalone matchPart context (where
// we bind to ^, and not /). Otherwise slashes get duped!
//
// In part-matching mode, the start is:
// - if not isStart: nothing
// - if traversal possible, but not allowed: ^(?!\.\.?$)
// - if dots allowed or not possible: ^
// - if dots possible and not allowed: ^(?!\.)
// end is:
// - if not isEnd(): nothing
// - else: $
//
// In full-path matching mode, we put the slash at the START of the
// pattern, so start is:
// - if first pattern: same as part-matching mode
// - if not isStart(): nothing
// - if traversal possible, but not allowed: /(?!\.\.?(?:$|/))
// - if dots allowed or not possible: /
// - if dots possible and not allowed: /(?!\.)
// end is:
// - if last pattern, same as part-matching mode
// - else nothing
//
// Always put the (?:$|/) on negated tails, though, because that has to be
// there to bind the end of the negated pattern portion, and it's easier to
// just stick it in now rather than try to inject it later in the middle of
// the pattern.
//
// We can just always return the same end, and leave it up to the caller
// to know whether it's going to be used joined or in parts.
// And, if the start is adjusted slightly, can do the same there:
// - if not isStart: nothing
// - if traversal possible, but not allowed: (?:/|^)(?!\.\.?$)
// - if dots allowed or not possible: (?:/|^)
// - if dots possible and not allowed: (?:/|^)(?!\.)
//
// But it's better to have a simpler binding without a conditional, for
// performance, so probably better to return both start options.
//
// Then the caller just ignores the end if it's not the first pattern,
// and the start always gets applied.
//
// But that's always going to be $ if it's the ending pattern, or nothing,
// so the caller can just attach $ at the end of the pattern when building.
//
// So the todo is:
// - better detect what kind of start is needed
// - return both flavors of starting pattern
// - attach $ at the end of the pattern when creating the actual RegExp
//
// Ah, but wait, no, that all only applies to the root when the first pattern
// is not an extglob. If the first pattern IS an extglob, then we need all
// that dot prevention biz to live in the extglob portions, because eg
// +(*|.x*) can match .xy but not .yx.
//
// So, return the two flavors if it's #root and the first child is not an
// AST, otherwise leave it to the child AST to handle it, and there,
// use the (?:^|/) style of start binding.
//
// Even simplified further:
// - Since the start for a join is eg /(?!\.) and the start for a part
// is ^(?!\.), we can just prepend (?!\.) to the pattern (either root
// or start or whatever) and prepend ^ or / at the Regexp construction.
toRegExpSource(allowDot) {
const dot = allowDot ?? !!this.#options.dot;
if (this.#root === this) {
this.#flatten();
this.#fillNegs();
}
if (!isExtglobAST(this)) {
const noEmpty = this.isStart() &&
this.isEnd() &&
!this.#parts.some(s => typeof s !== 'string');
const src = this.#parts
.map(p => {
const [re, _, hasMagic, uflag] = typeof p === 'string' ?
_a.#parseGlob(p, this.#hasMagic, noEmpty)
: p.toRegExpSource(allowDot);
this.#hasMagic = this.#hasMagic || hasMagic;
this.#uflag = this.#uflag || uflag;
return re;
})
.join('');
let start = '';
if (this.isStart()) {
if (typeof this.#parts[0] === 'string') {
// this is the string that will match the start of the pattern,
// so we need to protect against dots and such.
// '.' and '..' cannot match unless the pattern is that exactly,
// even if it starts with . or dot:true is set.
const dotTravAllowed = this.#parts.length === 1 && justDots.has(this.#parts[0]);
if (!dotTravAllowed) {
const aps = addPatternStart;
// check if we have a possibility of matching . or ..,
// and prevent that.
const needNoTrav =
// dots are allowed, and the pattern starts with [ or .
(dot && aps.has(src.charAt(0))) ||
// the pattern starts with \., and then [ or .
(src.startsWith('\\.') && aps.has(src.charAt(2))) ||
// the pattern starts with \.\., and then [ or .
(src.startsWith('\\.\\.') && aps.has(src.charAt(4)));
// no need to prevent dots if it can't match a dot, or if a
// sub-pattern will be preventing it anyway.
const needNoDot = !dot && !allowDot && aps.has(src.charAt(0));
start =
needNoTrav ? startNoTraversal
: needNoDot ? startNoDot
: '';
}
}
}
// append the "end of path portion" pattern to negation tails
let end = '';
if (this.isEnd() &&
this.#root.#filledNegs &&
this.#parent?.type === '!') {
end = '(?:$|\\/)';
}
const final = start + src + end;
return [
final,
unescape(src),
(this.#hasMagic = !!this.#hasMagic),
this.#uflag,
];
}
// We need to calculate the body *twice* if it's a repeat pattern
// at the start, once in nodot mode, then again in dot mode, so a
// pattern like *(?) can match 'x.y'
const repeated = this.type === '*' || this.type === '+';
// some kind of extglob
const start = this.type === '!' ? '(?:(?!(?:' : '(?:';
let body = this.#partsToRegExp(dot);
if (this.isStart() && this.isEnd() && !body && this.type !== '!') {
// invalid extglob, has to at least be *something* present, if it's
// the entire path portion.
const s = this.toString();
const me = this;
me.#parts = [s];
me.type = null;
me.#hasMagic = undefined;
return [s, unescape(this.toString()), false, false];
}
let bodyDotAllowed = !repeated || allowDot || dot || !startNoDot ?
''
: this.#partsToRegExp(true);
if (bodyDotAllowed === body) {
bodyDotAllowed = '';
}
if (bodyDotAllowed) {
body = `(?:${body})(?:${bodyDotAllowed})*?`;
}
// an empty !() is exactly equivalent to a starNoEmpty
let final = '';
if (this.type === '!' && this.#emptyExt) {
final = (this.isStart() && !dot ? startNoDot : '') + starNoEmpty;
}
else {
const close = this.type === '!' ?
// !() must match something,but !(x) can match ''
'))' +
(this.isStart() && !dot && !allowDot ? startNoDot : '') +
star +
')'
: this.type === '@' ? ')'
: this.type === '?' ? ')?'
: this.type === '+' && bodyDotAllowed ? ')'
: this.type === '*' && bodyDotAllowed ? `)?`
: `)${this.type}`;
final = start + body + close;
}
return [
final,
unescape(body),
(this.#hasMagic = !!this.#hasMagic),
this.#uflag,
];
}
#flatten() {
if (!isExtglobAST(this)) {
for (const p of this.#parts) {
if (typeof p === 'object') {
p.#flatten();
}
}
}
else {
// do up to 10 passes to flatten as much as possible
let iterations = 0;
let done = false;
do {
done = true;
for (let i = 0; i < this.#parts.length; i++) {
const c = this.#parts[i];
if (typeof c === 'object') {
c.#flatten();
if (this.#canAdopt(c)) {
done = false;
this.#adopt(c, i);
}
else if (this.#canAdoptWithSpace(c)) {
done = false;
this.#adoptWithSpace(c, i);
}
else if (this.#canUsurp(c)) {
done = false;
this.#usurp(c);
}
}
}
} while (!done && ++iterations < 10);
}
this.#toString = undefined;
}
#partsToRegExp(dot) {
return this.#parts
.map(p => {
// extglob ASTs should only contain parent ASTs
/* c8 ignore start */
if (typeof p === 'string') {
throw new Error('string type in extglob ast??');
}
/* c8 ignore stop */
// can ignore hasMagic, because extglobs are already always magic
const [re, _, _hasMagic, uflag] = p.toRegExpSource(dot);
this.#uflag = this.#uflag || uflag;
return re;
})
.filter(p => !(this.isStart() && this.isEnd()) || !!p)
.join('|');
}
static #parseGlob(glob, hasMagic, noEmpty = false) {
let escaping = false;
let re = '';
let uflag = false;
// multiple stars that aren't globstars coalesce into one *
let inStar = false;
for (let i = 0; i < glob.length; i++) {
const c = glob.charAt(i);
if (escaping) {
escaping = false;
re += (reSpecials.has(c) ? '\\' : '') + c;
continue;
}
if (c === '*') {
if (inStar)
continue;
inStar = true;
re += noEmpty && /^[*]+$/.test(glob) ? starNoEmpty : star;
hasMagic = true;
continue;
}
else {
inStar = false;
}
if (c === '\\') {
if (i === glob.length - 1) {
re += '\\\\';
}
else {
escaping = true;
}
continue;
}
if (c === '[') {
const [src, needUflag, consumed, magic] = parseClass(glob, i);
if (consumed) {
re += src;
uflag = uflag || needUflag;
i += consumed - 1;
hasMagic = hasMagic || magic;
continue;
}
}
if (c === '?') {
re += qmark;
hasMagic = true;
continue;
}
re += regExpEscape(c);
}
return [re, unescape(glob), !!hasMagic, uflag];
}
}
_a = AST;
//# sourceMappingURL=ast.js.map

1
node_modules/nodemon/node_modules/minimatch/dist/esm/ast.js.map generated vendored Normal file
View file

File diff suppressed because one or more lines are too long

8
node_modules/nodemon/node_modules/minimatch/dist/esm/brace-expressions.d.ts generated vendored Normal file
View file

@ -0,0 +1,8 @@
export type ParseClassResult = [
src: string,
uFlag: boolean,
consumed: number,
hasMagic: boolean
];
export declare const parseClass: (glob: string, position: number) => ParseClassResult;
//# sourceMappingURL=brace-expressions.d.ts.map

1
node_modules/nodemon/node_modules/minimatch/dist/esm/brace-expressions.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"brace-expressions.d.ts","sourceRoot":"","sources":["../../src/brace-expressions.ts"],"names":[],"mappings":"AAgCA,MAAM,MAAM,gBAAgB,GAAG;IAC7B,GAAG,EAAE,MAAM;IACX,KAAK,EAAE,OAAO;IACd,QAAQ,EAAE,MAAM;IAChB,QAAQ,EAAE,OAAO;CAClB,CAAA;AAQD,eAAO,MAAM,UAAU,GACrB,MAAM,MAAM,EACZ,UAAU,MAAM,KACf,gBA2HF,CAAA"}

146
node_modules/nodemon/node_modules/minimatch/dist/esm/brace-expressions.js generated vendored Normal file
View file

@ -0,0 +1,146 @@
// translate the various posix character classes into unicode properties
// this works across all unicode locales
// { <posix class>: [<translation>, /u flag required, negated]
const posixClasses = {
'[:alnum:]': ['\\p{L}\\p{Nl}\\p{Nd}', true],
'[:alpha:]': ['\\p{L}\\p{Nl}', true],
'[:ascii:]': ['\\x' + '00-\\x' + '7f', false],
'[:blank:]': ['\\p{Zs}\\t', true],
'[:cntrl:]': ['\\p{Cc}', true],
'[:digit:]': ['\\p{Nd}', true],
'[:graph:]': ['\\p{Z}\\p{C}', true, true],
'[:lower:]': ['\\p{Ll}', true],
'[:print:]': ['\\p{C}', true],
'[:punct:]': ['\\p{P}', true],
'[:space:]': ['\\p{Z}\\t\\r\\n\\v\\f', true],
'[:upper:]': ['\\p{Lu}', true],
'[:word:]': ['\\p{L}\\p{Nl}\\p{Nd}\\p{Pc}', true],
'[:xdigit:]': ['A-Fa-f0-9', false],
};
// only need to escape a few things inside of brace expressions
// escapes: [ \ ] -
const braceEscape = (s) => s.replace(/[[\]\\-]/g, '\\$&');
// escape all regexp magic characters
const regexpEscape = (s) => s.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, '\\$&');
// everything has already been escaped, we just have to join
const rangesToString = (ranges) => ranges.join('');
// takes a glob string at a posix brace expression, and returns
// an equivalent regular expression source, and boolean indicating
// whether the /u flag needs to be applied, and the number of chars
// consumed to parse the character class.
// This also removes out of order ranges, and returns ($.) if the
// entire class just no good.
export const parseClass = (glob, position) => {
const pos = position;
/* c8 ignore start */
if (glob.charAt(pos) !== '[') {
throw new Error('not in a brace expression');
}
/* c8 ignore stop */
const ranges = [];
const negs = [];
let i = pos + 1;
let sawStart = false;
let uflag = false;
let escaping = false;
let negate = false;
let endPos = pos;
let rangeStart = '';
WHILE: while (i < glob.length) {
const c = glob.charAt(i);
if ((c === '!' || c === '^') && i === pos + 1) {
negate = true;
i++;
continue;
}
if (c === ']' && sawStart && !escaping) {
endPos = i + 1;
break;
}
sawStart = true;
if (c === '\\') {
if (!escaping) {
escaping = true;
i++;
continue;
}
// escaped \ char, fall through and treat like normal char
}
if (c === '[' && !escaping) {
// either a posix class, a collation equivalent, or just a [
for (const [cls, [unip, u, neg]] of Object.entries(posixClasses)) {
if (glob.startsWith(cls, i)) {
// invalid, [a-[] is fine, but not [a-[:alpha]]
if (rangeStart) {
return ['$.', false, glob.length - pos, true];
}
i += cls.length;
if (neg)
negs.push(unip);
else
ranges.push(unip);
uflag = uflag || u;
continue WHILE;
}
}
}
// now it's just a normal character, effectively
escaping = false;
if (rangeStart) {
// throw this range away if it's not valid, but others
// can still match.
if (c > rangeStart) {
ranges.push(braceEscape(rangeStart) + '-' + braceEscape(c));
}
else if (c === rangeStart) {
ranges.push(braceEscape(c));
}
rangeStart = '';
i++;
continue;
}
// now might be the start of a range.
// can be either c-d or c-] or c<more...>] or c] at this point
if (glob.startsWith('-]', i + 1)) {
ranges.push(braceEscape(c + '-'));
i += 2;
continue;
}
if (glob.startsWith('-', i + 1)) {
rangeStart = c;
i += 2;
continue;
}
// not the start of a range, just a single character
ranges.push(braceEscape(c));
i++;
}
if (endPos < i) {
// didn't see the end of the class, not a valid class,
// but might still be valid as a literal match.
return ['', false, 0, false];
}
// if we got no ranges and no negates, then we have a range that
// cannot possibly match anything, and that poisons the whole glob
if (!ranges.length && !negs.length) {
return ['$.', false, glob.length - pos, true];
}
// if we got one positive range, and it's a single character, then that's
// not actually a magic pattern, it's just that one literal character.
// we should not treat that as "magic", we should just return the literal
// character. [_] is a perfectly valid way to escape glob magic chars.
if (negs.length === 0 &&
ranges.length === 1 &&
/^\\?.$/.test(ranges[0]) &&
!negate) {
const r = ranges[0].length === 2 ? ranges[0].slice(-1) : ranges[0];
return [regexpEscape(r), false, endPos - pos, false];
}
const sranges = '[' + (negate ? '^' : '') + rangesToString(ranges) + ']';
const snegs = '[' + (negate ? '' : '^') + rangesToString(negs) + ']';
const comb = ranges.length && negs.length ? '(' + sranges + '|' + snegs + ')'
: ranges.length ? sranges
: snegs;
return [comb, uflag, endPos - pos, true];
};
//# sourceMappingURL=brace-expressions.js.map

1
node_modules/nodemon/node_modules/minimatch/dist/esm/brace-expressions.js.map generated vendored Normal file
View file

File diff suppressed because one or more lines are too long

15
node_modules/nodemon/node_modules/minimatch/dist/esm/escape.d.ts generated vendored Normal file
View file

@ -0,0 +1,15 @@
import { MinimatchOptions } from './index.js';
/**
* Escape all magic characters in a glob pattern.
*
* If the {@link MinimatchOptions.windowsPathsNoEscape}
* option is used, then characters are escaped by wrapping in `[]`, because
* a magic character wrapped in a character class can only be satisfied by
* that exact character. In this mode, `\` is _not_ escaped, because it is
* not interpreted as a magic character, but instead as a path separator.
*
* If the {@link MinimatchOptions.magicalBraces} option is used,
* then braces (`{` and `}`) will be escaped.
*/
export declare const escape: (s: string, { windowsPathsNoEscape, magicalBraces, }?: Pick<MinimatchOptions, "windowsPathsNoEscape" | "magicalBraces">) => string;
//# sourceMappingURL=escape.d.ts.map

1
node_modules/nodemon/node_modules/minimatch/dist/esm/escape.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"escape.d.ts","sourceRoot":"","sources":["../../src/escape.ts"],"names":[],"mappings":"AAAA,OAAO,EAAE,gBAAgB,EAAE,MAAM,YAAY,CAAA;AAE7C;;;;;;;;;;;GAWG;AACH,eAAO,MAAM,MAAM,GACjB,GAAG,MAAM,EACT,2CAGG,IAAI,CAAC,gBAAgB,EAAE,sBAAsB,GAAG,eAAe,CAAM,WAazE,CAAA"}

26
node_modules/nodemon/node_modules/minimatch/dist/esm/escape.js generated vendored Normal file
View file

@ -0,0 +1,26 @@
/**
* Escape all magic characters in a glob pattern.
*
* If the {@link MinimatchOptions.windowsPathsNoEscape}
* option is used, then characters are escaped by wrapping in `[]`, because
* a magic character wrapped in a character class can only be satisfied by
* that exact character. In this mode, `\` is _not_ escaped, because it is
* not interpreted as a magic character, but instead as a path separator.
*
* If the {@link MinimatchOptions.magicalBraces} option is used,
* then braces (`{` and `}`) will be escaped.
*/
export const escape = (s, { windowsPathsNoEscape = false, magicalBraces = false, } = {}) => {
// don't need to escape +@! because we escape the parens
// that make those magic, and escaping ! as [!] isn't valid,
// because [!]] is a valid glob class meaning not ']'.
if (magicalBraces) {
return windowsPathsNoEscape ?
s.replace(/[?*()[\]{}]/g, '[$&]')
: s.replace(/[?*()[\]\\{}]/g, '\\$&');
}
return windowsPathsNoEscape ?
s.replace(/[?*()[\]]/g, '[$&]')
: s.replace(/[?*()[\]\\]/g, '\\$&');
};
//# sourceMappingURL=escape.js.map

1
node_modules/nodemon/node_modules/minimatch/dist/esm/escape.js.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"escape.js","sourceRoot":"","sources":["../../src/escape.ts"],"names":[],"mappings":"AAEA;;;;;;;;;;;GAWG;AACH,MAAM,CAAC,MAAM,MAAM,GAAG,CACpB,CAAS,EACT,EACE,oBAAoB,GAAG,KAAK,EAC5B,aAAa,GAAG,KAAK,MAC+C,EAAE,EACxE,EAAE;IACF,wDAAwD;IACxD,4DAA4D;IAC5D,sDAAsD;IACtD,IAAI,aAAa,EAAE,CAAC;QAClB,OAAO,oBAAoB,CAAC,CAAC;YACzB,CAAC,CAAC,OAAO,CAAC,cAAc,EAAE,MAAM,CAAC;YACnC,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,gBAAgB,EAAE,MAAM,CAAC,CAAA;IACzC,CAAC;IACD,OAAO,oBAAoB,CAAC,CAAC;QACzB,CAAC,CAAC,OAAO,CAAC,YAAY,EAAE,MAAM,CAAC;QACjC,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,cAAc,EAAE,MAAM,CAAC,CAAA;AACvC,CAAC,CAAA","sourcesContent":["import { MinimatchOptions } from './index.js'\n\n/**\n * Escape all magic characters in a glob pattern.\n *\n * If the {@link MinimatchOptions.windowsPathsNoEscape}\n * option is used, then characters are escaped by wrapping in `[]`, because\n * a magic character wrapped in a character class can only be satisfied by\n * that exact character. In this mode, `\\` is _not_ escaped, because it is\n * not interpreted as a magic character, but instead as a path separator.\n *\n * If the {@link MinimatchOptions.magicalBraces} option is used,\n * then braces (`{` and `}`) will be escaped.\n */\nexport const escape = (\n s: string,\n {\n windowsPathsNoEscape = false,\n magicalBraces = false,\n }: Pick<MinimatchOptions, 'windowsPathsNoEscape' | 'magicalBraces'> = {},\n) => {\n // don't need to escape +@! because we escape the parens\n // that make those magic, and escaping ! as [!] isn't valid,\n // because [!]] is a valid glob class meaning not ']'.\n if (magicalBraces) {\n return windowsPathsNoEscape ?\n s.replace(/[?*()[\\]{}]/g, '[$&]')\n : s.replace(/[?*()[\\]\\\\{}]/g, '\\\\$&')\n }\n return windowsPathsNoEscape ?\n s.replace(/[?*()[\\]]/g, '[$&]')\n : s.replace(/[?*()[\\]\\\\]/g, '\\\\$&')\n}\n"]}

174
node_modules/nodemon/node_modules/minimatch/dist/esm/index.d.ts generated vendored Normal file
View file

@ -0,0 +1,174 @@
import { AST } from './ast.js';
export type Platform = 'aix' | 'android' | 'darwin' | 'freebsd' | 'haiku' | 'linux' | 'openbsd' | 'sunos' | 'win32' | 'cygwin' | 'netbsd';
export interface MinimatchOptions {
/** do not expand `{x,y}` style braces */
nobrace?: boolean;
/** do not treat patterns starting with `#` as a comment */
nocomment?: boolean;
/** do not treat patterns starting with `!` as a negation */
nonegate?: boolean;
/** print LOTS of debugging output */
debug?: boolean;
/** treat `**` the same as `*` */
noglobstar?: boolean;
/** do not expand extglobs like `+(a|b)` */
noext?: boolean;
/** return the pattern if nothing matches */
nonull?: boolean;
/** treat `\\` as a path separator, not an escape character */
windowsPathsNoEscape?: boolean;
/**
* inverse of {@link MinimatchOptions.windowsPathsNoEscape}
* @deprecated
*/
allowWindowsEscape?: boolean;
/**
* Compare a partial path to a pattern. As long as the parts
* of the path that are present are not contradicted by the
* pattern, it will be treated as a match. This is useful in
* applications where you're walking through a folder structure,
* and don't yet have the full path, but want to ensure that you
* do not walk down paths that can never be a match.
*/
partial?: boolean;
/** allow matches that start with `.` even if the pattern does not */
dot?: boolean;
/** ignore case */
nocase?: boolean;
/** ignore case only in wildcard patterns */
nocaseMagicOnly?: boolean;
/** consider braces to be "magic" for the purpose of `hasMagic` */
magicalBraces?: boolean;
/**
* If set, then patterns without slashes will be matched
* against the basename of the path if it contains slashes.
* For example, `a?b` would match the path `/xyz/123/acb`, but
* not `/xyz/acb/123`.
*/
matchBase?: boolean;
/** invert the results of negated matches */
flipNegate?: boolean;
/** do not collapse multiple `/` into a single `/` */
preserveMultipleSlashes?: boolean;
/**
* A number indicating the level of optimization that should be done
* to the pattern prior to parsing and using it for matches.
*/
optimizationLevel?: number;
/** operating system platform */
platform?: Platform;
/**
* When a pattern starts with a UNC path or drive letter, and in
* `nocase:true` mode, do not convert the root portions of the
* pattern into a case-insensitive regular expression, and instead
* leave them as strings.
*
* This is the default when the platform is `win32` and
* `nocase:true` is set.
*/
windowsNoMagicRoot?: boolean;
/**
* max number of `{...}` patterns to expand. Default 100_000.
*/
braceExpandMax?: number;
/**
* Max number of non-adjacent `**` patterns to recursively walk down.
*
* The default of 200 is almost certainly high enough for most purposes,
* and can handle absurdly excessive patterns.
*/
maxGlobstarRecursion?: number;
/**
* Max depth to traverse for nested extglobs like `*(a|b|c)`
*
* Default is 2, which is quite low, but any higher value
* swiftly results in punishing performance impacts. Note
* that this is *not* relevant when the globstar types can
* be safely coalesced into a single set.
*
* For example, `*(a|@(b|c)|d)` would be flattened into
* `*(a|b|c|d)`. Thus, many common extglobs will retain good
* performance and never hit this limit, even if they are
* excessively deep and complicated.
*
* If the limit is hit, then the extglob characters are simply
* not parsed, and the pattern effectively switches into
* `noextglob: true` mode for the contents of that nested
* sub-pattern. This will typically _not_ result in a match,
* but is considered a valid trade-off for security and
* performance.
*/
maxExtglobRecursion?: number;
}
export declare const minimatch: {
(p: string, pattern: string, options?: MinimatchOptions): boolean;
sep: Sep;
GLOBSTAR: typeof GLOBSTAR;
filter: (pattern: string, options?: MinimatchOptions) => (p: string) => boolean;
defaults: (def: MinimatchOptions) => typeof minimatch;
braceExpand: (pattern: string, options?: MinimatchOptions) => string[];
makeRe: (pattern: string, options?: MinimatchOptions) => false | MMRegExp;
match: (list: string[], pattern: string, options?: MinimatchOptions) => string[];
AST: typeof AST;
Minimatch: typeof Minimatch;
escape: (s: string, { windowsPathsNoEscape, magicalBraces, }?: Pick<MinimatchOptions, "windowsPathsNoEscape" | "magicalBraces">) => string;
unescape: (s: string, { windowsPathsNoEscape, magicalBraces, }?: Pick<MinimatchOptions, "windowsPathsNoEscape" | "magicalBraces">) => string;
};
export type Sep = '\\' | '/';
export declare const sep: Sep;
export declare const GLOBSTAR: unique symbol;
export declare const filter: (pattern: string, options?: MinimatchOptions) => (p: string) => boolean;
export declare const defaults: (def: MinimatchOptions) => typeof minimatch;
export declare const braceExpand: (pattern: string, options?: MinimatchOptions) => string[];
export declare const makeRe: (pattern: string, options?: MinimatchOptions) => false | MMRegExp;
export declare const match: (list: string[], pattern: string, options?: MinimatchOptions) => string[];
export type MMRegExp = RegExp & {
_src?: string;
_glob?: string;
};
export type ParseReturnFiltered = string | MMRegExp | typeof GLOBSTAR;
export type ParseReturn = ParseReturnFiltered | false;
export declare class Minimatch {
#private;
options: MinimatchOptions;
set: ParseReturnFiltered[][];
pattern: string;
windowsPathsNoEscape: boolean;
nonegate: boolean;
negate: boolean;
comment: boolean;
empty: boolean;
preserveMultipleSlashes: boolean;
partial: boolean;
globSet: string[];
globParts: string[][];
nocase: boolean;
isWindows: boolean;
platform: Platform;
windowsNoMagicRoot: boolean;
maxGlobstarRecursion: number;
regexp: false | null | MMRegExp;
constructor(pattern: string, options?: MinimatchOptions);
hasMagic(): boolean;
debug(..._: any[]): void;
make(): void;
preprocess(globParts: string[][]): string[][];
adjascentGlobstarOptimize(globParts: string[][]): string[][];
levelOneOptimize(globParts: string[][]): string[][];
levelTwoFileOptimize(parts: string | string[]): string[];
firstPhasePreProcess(globParts: string[][]): string[][];
secondPhasePreProcess(globParts: string[][]): string[][];
partsMatch(a: string[], b: string[], emptyGSMatch?: boolean): false | string[];
parseNegate(): void;
matchOne(file: string[], pattern: ParseReturn[], partial?: boolean): boolean;
braceExpand(): string[];
parse(pattern: string): ParseReturn;
makeRe(): false | MMRegExp;
slashSplit(p: string): string[];
match(f: string, partial?: boolean): boolean;
static defaults(def: MinimatchOptions): typeof Minimatch;
}
export { AST } from './ast.js';
export { escape } from './escape.js';
export { unescape } from './unescape.js';
//# sourceMappingURL=index.d.ts.map

1
node_modules/nodemon/node_modules/minimatch/dist/esm/index.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"index.d.ts","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":"AAEA,OAAO,EAAE,GAAG,EAAe,MAAM,UAAU,CAAA;AAI3C,MAAM,MAAM,QAAQ,GAChB,KAAK,GACL,SAAS,GACT,QAAQ,GACR,SAAS,GACT,OAAO,GACP,OAAO,GACP,SAAS,GACT,OAAO,GACP,OAAO,GACP,QAAQ,GACR,QAAQ,CAAA;AAEZ,MAAM,WAAW,gBAAgB;IAC/B,yCAAyC;IACzC,OAAO,CAAC,EAAE,OAAO,CAAA;IACjB,2DAA2D;IAC3D,SAAS,CAAC,EAAE,OAAO,CAAA;IACnB,4DAA4D;IAC5D,QAAQ,CAAC,EAAE,OAAO,CAAA;IAClB,qCAAqC;IACrC,KAAK,CAAC,EAAE,OAAO,CAAA;IACf,iCAAiC;IACjC,UAAU,CAAC,EAAE,OAAO,CAAA;IACpB,2CAA2C;IAC3C,KAAK,CAAC,EAAE,OAAO,CAAA;IACf,4CAA4C;IAC5C,MAAM,CAAC,EAAE,OAAO,CAAA;IAChB,8DAA8D;IAC9D,oBAAoB,CAAC,EAAE,OAAO,CAAA;IAC9B;;;OAGG;IACH,kBAAkB,CAAC,EAAE,OAAO,CAAA;IAC5B;;;;;;;OAOG;IACH,OAAO,CAAC,EAAE,OAAO,CAAA;IACjB,qEAAqE;IACrE,GAAG,CAAC,EAAE,OAAO,CAAA;IACb,kBAAkB;IAClB,MAAM,CAAC,EAAE,OAAO,CAAA;IAChB,4CAA4C;IAC5C,eAAe,CAAC,EAAE,OAAO,CAAA;IACzB,kEAAkE;IAClE,aAAa,CAAC,EAAE,OAAO,CAAA;IACvB;;;;;OAKG;IACH,SAAS,CAAC,EAAE,OAAO,CAAA;IACnB,4CAA4C;IAC5C,UAAU,CAAC,EAAE,OAAO,CAAA;IACpB,qDAAqD;IACrD,uBAAuB,CAAC,EAAE,OAAO,CAAA;IACjC;;;OAGG;IACH,iBAAiB,CAAC,EAAE,MAAM,CAAA;IAC1B,gCAAgC;IAChC,QAAQ,CAAC,EAAE,QAAQ,CAAA;IACnB;;;;;;;;OAQG;IACH,kBAAkB,CAAC,EAAE,OAAO,CAAA;IAC5B;;OAEG;IACH,cAAc,CAAC,EAAE,MAAM,CAAA;IACvB;;;;;OAKG;IACH,oBAAoB,CAAC,EAAE,MAAM,CAAA;IAE7B;;;;;;;;;;;;;;;;;;;OAmBG;IACH,mBAAmB,CAAC,EAAE,MAAM,CAAA;CAC7B;AAED,eAAO,MAAM,SAAS;QACjB,MAAM,WACA,MAAM,YACN,gBAAgB;;;sBA4Gf,MAAM,YAAW,gBAAgB,MAC1C,GAAG,MAAM;oBAOkB,gBAAgB,KAAG,OAAO,SAAS;2BAuFtD,MAAM,YACN,gBAAgB;sBA2BK,MAAM,YAAW,gBAAgB;kBAKzD,MAAM,EAAE,WACL,MAAM,YACN,gBAAgB;;;;;CApO1B,CAAA;AAkED,MAAM,MAAM,GAAG,GAAG,IAAI,GAAG,GAAG,CAAA;AAQ5B,eAAO,MAAM,GAAG,KAC+C,CAAA;AAG/D,eAAO,MAAM,QAAQ,eAAwB,CAAA;AAmB7C,eAAO,MAAM,MAAM,GAChB,SAAS,MAAM,EAAE,UAAS,gBAAqB,MAC/C,GAAG,MAAM,YACsB,CAAA;AAMlC,eAAO,MAAM,QAAQ,GAAI,KAAK,gBAAgB,KAAG,OAAO,SAyEvD,CAAA;AAaD,eAAO,MAAM,WAAW,GACtB,SAAS,MAAM,EACf,UAAS,gBAAqB,aAY/B,CAAA;AAeD,eAAO,MAAM,MAAM,GAAI,SAAS,MAAM,EAAE,UAAS,gBAAqB,qBAC5B,CAAA;AAG1C,eAAO,MAAM,KAAK,GAChB,MAAM,MAAM,EAAE,EACd,SAAS,MAAM,EACf,UAAS,gBAAqB,aAQ/B,CAAA;AAQD,MAAM,MAAM,QAAQ,GAAG,MAAM,GAAG;IAC9B,IAAI,CAAC,EAAE,MAAM,CAAA;IACb,KAAK,CAAC,EAAE,MAAM,CAAA;CACf,CAAA;AAED,MAAM,MAAM,mBAAmB,GAAG,MAAM,GAAG,QAAQ,GAAG,OAAO,QAAQ,CAAA;AACrE,MAAM,MAAM,WAAW,GAAG,mBAAmB,GAAG,KAAK,CAAA;AAErD,qBAAa,SAAS;;IACpB,OAAO,EAAE,gBAAgB,CAAA;IACzB,GAAG,EAAE,mBAAmB,EAAE,EAAE,CAAA;IAC5B,OAAO,EAAE,MAAM,CAAA;IAEf,oBAAoB,EAAE,OAAO,CAAA;IAC7B,QAAQ,EAAE,OAAO,CAAA;IACjB,MAAM,EAAE,OAAO,CAAA;IACf,OAAO,EAAE,OAAO,CAAA;IAChB,KAAK,EAAE,OAAO,CAAA;IACd,uBAAuB,EAAE,OAAO,CAAA;IAChC,OAAO,EAAE,OAAO,CAAA;IAChB,OAAO,EAAE,MAAM,EAAE,CAAA;IACjB,SAAS,EAAE,MAAM,EAAE,EAAE,CAAA;IACrB,MAAM,EAAE,OAAO,CAAA;IAEf,SAAS,EAAE,OAAO,CAAA;IAClB,QAAQ,EAAE,QAAQ,CAAA;IAClB,kBAAkB,EAAE,OAAO,CAAA;IAC3B,oBAAoB,EAAE,MAAM,CAAA;IAE5B,MAAM,EAAE,KAAK,GAAG,IAAI,GAAG,QAAQ,CAAA;gBACnB,OAAO,EAAE,MAAM,EAAE,OAAO,GAAE,gBAAqB;IAqC3D,QAAQ,IAAI,OAAO;IAYnB,KAAK,CAAC,GAAG,CAAC,EAAE,GAAG,EAAE;IAEjB,IAAI;IA6FJ,UAAU,CAAC,SAAS,EAAE,MAAM,EAAE,EAAE;IA8BhC,yBAAyB,CAAC,SAAS,EAAE,MAAM,EAAE,EAAE;IAiB/C,gBAAgB,CAAC,SAAS,EAAE,MAAM,EAAE,EAAE;IAoBtC,oBAAoB,CAAC,KAAK,EAAE,MAAM,GAAG,MAAM,EAAE;IA6D7C,oBAAoB,CAAC,SAAS,EAAE,MAAM,EAAE,EAAE;IA0F1C,qBAAqB,CAAC,SAAS,EAAE,MAAM,EAAE,EAAE,GAAG,MAAM,EAAE,EAAE;IAkBxD,UAAU,CACR,CAAC,EAAE,MAAM,EAAE,EACX,CAAC,EAAE,MAAM,EAAE,EACX,YAAY,GAAE,OAAe,GAC5B,KAAK,GAAG,MAAM,EAAE;IA+CnB,WAAW;IAqBX,QAAQ,CACN,IAAI,EAAE,MAAM,EAAE,EACd,OAAO,EAAE,WAAW,EAAE,EACtB,OAAO,GAAE,OAAe;IA8W1B,WAAW;IAIX,KAAK,CAAC,OAAO,EAAE,MAAM,GAAG,WAAW;IA6CnC,MAAM;IAuGN,UAAU,CAAC,CAAC,EAAE,MAAM;IAepB,KAAK,CAAC,CAAC,EAAE,MAAM,EAAE,OAAO,UAAe;IAiEvC,MAAM,CAAC,QAAQ,CAAC,GAAG,EAAE,gBAAgB;CAGtC;AAED,OAAO,EAAE,GAAG,EAAE,MAAM,UAAU,CAAA;AAC9B,OAAO,EAAE,MAAM,EAAE,MAAM,aAAa,CAAA;AACpC,OAAO,EAAE,QAAQ,EAAE,MAAM,eAAe,CAAA"}

1108
node_modules/nodemon/node_modules/minimatch/dist/esm/index.js generated vendored Normal file
View file

File diff suppressed because it is too large Load diff

1
node_modules/nodemon/node_modules/minimatch/dist/esm/index.js.map generated vendored Normal file
View file

File diff suppressed because one or more lines are too long

3
node_modules/nodemon/node_modules/minimatch/dist/esm/package.json generated vendored Normal file
View file

@ -0,0 +1,3 @@
{
"type": "module"
}

22
node_modules/nodemon/node_modules/minimatch/dist/esm/unescape.d.ts generated vendored Normal file
View file

@ -0,0 +1,22 @@
import { MinimatchOptions } from './index.js';
/**
* Un-escape a string that has been escaped with {@link escape}.
*
* If the {@link MinimatchOptions.windowsPathsNoEscape} option is used, then
* square-bracket escapes are removed, but not backslash escapes.
*
* For example, it will turn the string `'[*]'` into `*`, but it will not
* turn `'\\*'` into `'*'`, because `\` is a path separator in
* `windowsPathsNoEscape` mode.
*
* When `windowsPathsNoEscape` is not set, then both square-bracket escapes and
* backslash escapes are removed.
*
* Slashes (and backslashes in `windowsPathsNoEscape` mode) cannot be escaped
* or unescaped.
*
* When `magicalBraces` is not set, escapes of braces (`{` and `}`) will not be
* unescaped.
*/
export declare const unescape: (s: string, { windowsPathsNoEscape, magicalBraces, }?: Pick<MinimatchOptions, "windowsPathsNoEscape" | "magicalBraces">) => string;
//# sourceMappingURL=unescape.d.ts.map

1
node_modules/nodemon/node_modules/minimatch/dist/esm/unescape.d.ts.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"unescape.d.ts","sourceRoot":"","sources":["../../src/unescape.ts"],"names":[],"mappings":"AAAA,OAAO,EAAE,gBAAgB,EAAE,MAAM,YAAY,CAAA;AAE7C;;;;;;;;;;;;;;;;;;GAkBG;AAEH,eAAO,MAAM,QAAQ,GACnB,GAAG,MAAM,EACT,2CAGG,IAAI,CAAC,gBAAgB,EAAE,sBAAsB,GAAG,eAAe,CAAM,WAczE,CAAA"}

34
node_modules/nodemon/node_modules/minimatch/dist/esm/unescape.js generated vendored Normal file
View file

@ -0,0 +1,34 @@
/**
* Un-escape a string that has been escaped with {@link escape}.
*
* If the {@link MinimatchOptions.windowsPathsNoEscape} option is used, then
* square-bracket escapes are removed, but not backslash escapes.
*
* For example, it will turn the string `'[*]'` into `*`, but it will not
* turn `'\\*'` into `'*'`, because `\` is a path separator in
* `windowsPathsNoEscape` mode.
*
* When `windowsPathsNoEscape` is not set, then both square-bracket escapes and
* backslash escapes are removed.
*
* Slashes (and backslashes in `windowsPathsNoEscape` mode) cannot be escaped
* or unescaped.
*
* When `magicalBraces` is not set, escapes of braces (`{` and `}`) will not be
* unescaped.
*/
export const unescape = (s, { windowsPathsNoEscape = false, magicalBraces = true, } = {}) => {
if (magicalBraces) {
return windowsPathsNoEscape ?
s.replace(/\[([^\/\\])\]/g, '$1')
: s
.replace(/((?!\\).|^)\[([^\/\\])\]/g, '$1$2')
.replace(/\\([^\/])/g, '$1');
}
return windowsPathsNoEscape ?
s.replace(/\[([^\/\\{}])\]/g, '$1')
: s
.replace(/((?!\\).|^)\[([^\/\\{}])\]/g, '$1$2')
.replace(/\\([^\/{}])/g, '$1');
};
//# sourceMappingURL=unescape.js.map

1
node_modules/nodemon/node_modules/minimatch/dist/esm/unescape.js.map generated vendored Normal file
View file

@ -0,0 +1 @@
{"version":3,"file":"unescape.js","sourceRoot":"","sources":["../../src/unescape.ts"],"names":[],"mappings":"AAEA;;;;;;;;;;;;;;;;;;GAkBG;AAEH,MAAM,CAAC,MAAM,QAAQ,GAAG,CACtB,CAAS,EACT,EACE,oBAAoB,GAAG,KAAK,EAC5B,aAAa,GAAG,IAAI,MACgD,EAAE,EACxE,EAAE;IACF,IAAI,aAAa,EAAE,CAAC;QAClB,OAAO,oBAAoB,CAAC,CAAC;YACzB,CAAC,CAAC,OAAO,CAAC,gBAAgB,EAAE,IAAI,CAAC;YACnC,CAAC,CAAC,CAAC;iBACE,OAAO,CAAC,2BAA2B,EAAE,MAAM,CAAC;iBAC5C,OAAO,CAAC,YAAY,EAAE,IAAI,CAAC,CAAA;IACpC,CAAC;IACD,OAAO,oBAAoB,CAAC,CAAC;QACzB,CAAC,CAAC,OAAO,CAAC,kBAAkB,EAAE,IAAI,CAAC;QACrC,CAAC,CAAC,CAAC;aACE,OAAO,CAAC,6BAA6B,EAAE,MAAM,CAAC;aAC9C,OAAO,CAAC,cAAc,EAAE,IAAI,CAAC,CAAA;AACtC,CAAC,CAAA","sourcesContent":["import { MinimatchOptions } from './index.js'\n\n/**\n * Un-escape a string that has been escaped with {@link escape}.\n *\n * If the {@link MinimatchOptions.windowsPathsNoEscape} option is used, then\n * square-bracket escapes are removed, but not backslash escapes.\n *\n * For example, it will turn the string `'[*]'` into `*`, but it will not\n * turn `'\\\\*'` into `'*'`, because `\\` is a path separator in\n * `windowsPathsNoEscape` mode.\n *\n * When `windowsPathsNoEscape` is not set, then both square-bracket escapes and\n * backslash escapes are removed.\n *\n * Slashes (and backslashes in `windowsPathsNoEscape` mode) cannot be escaped\n * or unescaped.\n *\n * When `magicalBraces` is not set, escapes of braces (`{` and `}`) will not be\n * unescaped.\n */\n\nexport const unescape = (\n s: string,\n {\n windowsPathsNoEscape = false,\n magicalBraces = true,\n }: Pick<MinimatchOptions, 'windowsPathsNoEscape' | 'magicalBraces'> = {},\n) => {\n if (magicalBraces) {\n return windowsPathsNoEscape ?\n s.replace(/\\[([^\\/\\\\])\\]/g, '$1')\n : s\n .replace(/((?!\\\\).|^)\\[([^\\/\\\\])\\]/g, '$1$2')\n .replace(/\\\\([^\\/])/g, '$1')\n }\n return windowsPathsNoEscape ?\n s.replace(/\\[([^\\/\\\\{}])\\]/g, '$1')\n : s\n .replace(/((?!\\\\).|^)\\[([^\\/\\\\{}])\\]/g, '$1$2')\n .replace(/\\\\([^\\/{}])/g, '$1')\n}\n"]}

67
node_modules/nodemon/node_modules/minimatch/package.json generated vendored Normal file
View file

@ -0,0 +1,67 @@
{
"author": "Isaac Z. Schlueter <i@izs.me> (http://blog.izs.me)",
"name": "minimatch",
"description": "a glob matcher in javascript",
"version": "10.2.4",
"repository": {
"type": "git",
"url": "git@github.com:isaacs/minimatch"
},
"main": "./dist/commonjs/index.js",
"types": "./dist/commonjs/index.d.ts",
"exports": {
"./package.json": "./package.json",
".": {
"import": {
"types": "./dist/esm/index.d.ts",
"default": "./dist/esm/index.js"
},
"require": {
"types": "./dist/commonjs/index.d.ts",
"default": "./dist/commonjs/index.js"
}
}
},
"files": [
"dist"
],
"scripts": {
"preversion": "npm test",
"postversion": "npm publish",
"prepublishOnly": "git push origin --follow-tags",
"prepare": "tshy",
"pretest": "npm run prepare",
"presnap": "npm run prepare",
"test": "tap",
"snap": "tap",
"format": "prettier --write .",
"benchmark": "node benchmark/index.js",
"typedoc": "typedoc --tsconfig .tshy/esm.json ./src/*.ts"
},
"engines": {
"node": "18 || 20 || >=22"
},
"devDependencies": {
"@types/node": "^25.3.0",
"mkdirp": "^3.0.1",
"prettier": "^3.6.2",
"tap": "^21.6.2",
"tshy": "^3.0.2",
"typedoc": "^0.28.5"
},
"funding": {
"url": "https://github.com/sponsors/isaacs"
},
"license": "BlueOak-1.0.0",
"tshy": {
"exports": {
"./package.json": "./package.json",
".": "./src/index.ts"
}
},
"type": "module",
"module": "./dist/esm/index.js",
"dependencies": {
"brace-expansion": "^5.0.2"
}
}

162
node_modules/nodemon/node_modules/ms/index.js generated vendored Normal file
View file

@ -0,0 +1,162 @@
/**
* Helpers.
*/
var s = 1000;
var m = s * 60;
var h = m * 60;
var d = h * 24;
var w = d * 7;
var y = d * 365.25;
/**
* Parse or format the given `val`.
*
* Options:
*
* - `long` verbose formatting [false]
*
* @param {String|Number} val
* @param {Object} [options]
* @throws {Error} throw an error if val is not a non-empty string or a number
* @return {String|Number}
* @api public
*/
module.exports = function (val, options) {
options = options || {};
var type = typeof val;
if (type === 'string' && val.length > 0) {
return parse(val);
} else if (type === 'number' && isFinite(val)) {
return options.long ? fmtLong(val) : fmtShort(val);
}
throw new Error(
'val is not a non-empty string or a valid number. val=' +
JSON.stringify(val)
);
};
/**
* Parse the given `str` and return milliseconds.
*
* @param {String} str
* @return {Number}
* @api private
*/
function parse(str) {
str = String(str);
if (str.length > 100) {
return;
}
var match = /^(-?(?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(
str
);
if (!match) {
return;
}
var n = parseFloat(match[1]);
var type = (match[2] || 'ms').toLowerCase();
switch (type) {
case 'years':
case 'year':
case 'yrs':
case 'yr':
case 'y':
return n * y;
case 'weeks':
case 'week':
case 'w':
return n * w;
case 'days':
case 'day':
case 'd':
return n * d;
case 'hours':
case 'hour':
case 'hrs':
case 'hr':
case 'h':
return n * h;
case 'minutes':
case 'minute':
case 'mins':
case 'min':
case 'm':
return n * m;
case 'seconds':
case 'second':
case 'secs':
case 'sec':
case 's':
return n * s;
case 'milliseconds':
case 'millisecond':
case 'msecs':
case 'msec':
case 'ms':
return n;
default:
return undefined;
}
}
/**
* Short format for `ms`.
*
* @param {Number} ms
* @return {String}
* @api private
*/
function fmtShort(ms) {
var msAbs = Math.abs(ms);
if (msAbs >= d) {
return Math.round(ms / d) + 'd';
}
if (msAbs >= h) {
return Math.round(ms / h) + 'h';
}
if (msAbs >= m) {
return Math.round(ms / m) + 'm';
}
if (msAbs >= s) {
return Math.round(ms / s) + 's';
}
return ms + 'ms';
}
/**
* Long format for `ms`.
*
* @param {Number} ms
* @return {String}
* @api private
*/
function fmtLong(ms) {
var msAbs = Math.abs(ms);
if (msAbs >= d) {
return plural(ms, msAbs, d, 'day');
}
if (msAbs >= h) {
return plural(ms, msAbs, h, 'hour');
}
if (msAbs >= m) {
return plural(ms, msAbs, m, 'minute');
}
if (msAbs >= s) {
return plural(ms, msAbs, s, 'second');
}
return ms + ' ms';
}
/**
* Pluralization helper.
*/
function plural(ms, msAbs, n, name) {
var isPlural = msAbs >= n * 1.5;
return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : '');
}

21
node_modules/nodemon/node_modules/ms/license.md generated vendored Normal file
View file

@ -0,0 +1,21 @@
The MIT License (MIT)
Copyright (c) 2020 Vercel, Inc.
Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in all
copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
SOFTWARE.

38
node_modules/nodemon/node_modules/ms/package.json generated vendored Normal file
View file

@ -0,0 +1,38 @@
{
"name": "ms",
"version": "2.1.3",
"description": "Tiny millisecond conversion utility",
"repository": "vercel/ms",
"main": "./index",
"files": [
"index.js"
],
"scripts": {
"precommit": "lint-staged",
"lint": "eslint lib/* bin/*",
"test": "mocha tests.js"
},
"eslintConfig": {
"extends": "eslint:recommended",
"env": {
"node": true,
"es6": true
}
},
"lint-staged": {
"*.js": [
"npm run lint",
"prettier --single-quote --write",
"git add"
]
},
"license": "MIT",
"devDependencies": {
"eslint": "4.18.2",
"expect.js": "0.3.1",
"husky": "0.14.3",
"lint-staged": "5.0.0",
"mocha": "4.0.1",
"prettier": "2.0.5"
}
}

59
node_modules/nodemon/node_modules/ms/readme.md generated vendored Normal file
View file

@ -0,0 +1,59 @@
# ms
![CI](https://github.com/vercel/ms/workflows/CI/badge.svg)
Use this package to easily convert various time formats to milliseconds.
## Examples
```js
ms('2 days') // 172800000
ms('1d') // 86400000
ms('10h') // 36000000
ms('2.5 hrs') // 9000000
ms('2h') // 7200000
ms('1m') // 60000
ms('5s') // 5000
ms('1y') // 31557600000
ms('100') // 100
ms('-3 days') // -259200000
ms('-1h') // -3600000
ms('-200') // -200
```
### Convert from Milliseconds
```js
ms(60000) // "1m"
ms(2 * 60000) // "2m"
ms(-3 * 60000) // "-3m"
ms(ms('10 hours')) // "10h"
```
### Time Format Written-Out
```js
ms(60000, { long: true }) // "1 minute"
ms(2 * 60000, { long: true }) // "2 minutes"
ms(-3 * 60000, { long: true }) // "-3 minutes"
ms(ms('10 hours'), { long: true }) // "10 hours"
```
## Features
- Works both in [Node.js](https://nodejs.org) and in the browser
- If a number is supplied to `ms`, a string with a unit is returned
- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`)
- If you pass a string with a number and a valid unit, the number of equivalent milliseconds is returned
## Related Packages
- [ms.macro](https://github.com/knpwrs/ms.macro) - Run `ms` as a macro at build-time.
## Caught a Bug?
1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device
2. Link the package to the global module directory: `npm link`
3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, Node.js will now use your clone of ms!
As always, you can run the tests using: `npm test`

15
node_modules/nodemon/node_modules/semver/LICENSE generated vendored Normal file
View file

@ -0,0 +1,15 @@
The ISC License
Copyright (c) Isaac Z. Schlueter and Contributors
Permission to use, copy, modify, and/or distribute this software for any
purpose with or without fee is hereby granted, provided that the above
copyright notice and this permission notice appear in all copies.
THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR
IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.

665
node_modules/nodemon/node_modules/semver/README.md generated vendored Normal file
View file

@ -0,0 +1,665 @@
semver(1) -- The semantic versioner for npm
===========================================
## Install
```bash
npm install semver
````
## Usage
As a node module:
```js
const semver = require('semver')
semver.valid('1.2.3') // '1.2.3'
semver.valid('a.b.c') // null
semver.clean(' =v1.2.3 ') // '1.2.3'
semver.satisfies('1.2.3', '1.x || >=2.5.0 || 5.0.0 - 7.2.3') // true
semver.gt('1.2.3', '9.8.7') // false
semver.lt('1.2.3', '9.8.7') // true
semver.minVersion('>=1.0.0') // '1.0.0'
semver.valid(semver.coerce('v2')) // '2.0.0'
semver.valid(semver.coerce('42.6.7.9.3-alpha')) // '42.6.7'
```
You can also just load the module for the function that you care about if
you'd like to minimize your footprint.
```js
// load the whole API at once in a single object
const semver = require('semver')
// or just load the bits you need
// all of them listed here, just pick and choose what you want
// classes
const SemVer = require('semver/classes/semver')
const Comparator = require('semver/classes/comparator')
const Range = require('semver/classes/range')
// functions for working with versions
const semverParse = require('semver/functions/parse')
const semverValid = require('semver/functions/valid')
const semverClean = require('semver/functions/clean')
const semverInc = require('semver/functions/inc')
const semverDiff = require('semver/functions/diff')
const semverMajor = require('semver/functions/major')
const semverMinor = require('semver/functions/minor')
const semverPatch = require('semver/functions/patch')
const semverPrerelease = require('semver/functions/prerelease')
const semverCompare = require('semver/functions/compare')
const semverRcompare = require('semver/functions/rcompare')
const semverCompareLoose = require('semver/functions/compare-loose')
const semverCompareBuild = require('semver/functions/compare-build')
const semverSort = require('semver/functions/sort')
const semverRsort = require('semver/functions/rsort')
// low-level comparators between versions
const semverGt = require('semver/functions/gt')
const semverLt = require('semver/functions/lt')
const semverEq = require('semver/functions/eq')
const semverNeq = require('semver/functions/neq')
const semverGte = require('semver/functions/gte')
const semverLte = require('semver/functions/lte')
const semverCmp = require('semver/functions/cmp')
const semverCoerce = require('semver/functions/coerce')
// working with ranges
const semverSatisfies = require('semver/functions/satisfies')
const semverMaxSatisfying = require('semver/ranges/max-satisfying')
const semverMinSatisfying = require('semver/ranges/min-satisfying')
const semverToComparators = require('semver/ranges/to-comparators')
const semverMinVersion = require('semver/ranges/min-version')
const semverValidRange = require('semver/ranges/valid')
const semverOutside = require('semver/ranges/outside')
const semverGtr = require('semver/ranges/gtr')
const semverLtr = require('semver/ranges/ltr')
const semverIntersects = require('semver/ranges/intersects')
const semverSimplifyRange = require('semver/ranges/simplify')
const semverRangeSubset = require('semver/ranges/subset')
```
As a command-line utility:
```
$ semver -h
A JavaScript implementation of the https://semver.org/ specification
Copyright Isaac Z. Schlueter
Usage: semver [options] <version> [<version> [...]]
Prints valid versions sorted by SemVer precedence
Options:
-r --range <range>
Print versions that match the specified range.
-i --increment [<level>]
Increment a version by the specified level. Level can
be one of: major, minor, patch, premajor, preminor,
prepatch, prerelease, or release. Default level is 'patch'.
Only one version may be specified.
--preid <identifier>
Identifier to be used to prefix premajor, preminor,
prepatch or prerelease version increments.
-l --loose
Interpret versions and ranges loosely
-n <0|1|false>
Base number for prerelease identifier (default: 0).
Use false to omit the number altogether.
-p --include-prerelease
Always include prerelease versions in range matching
-c --coerce
Coerce a string into SemVer if possible
(does not imply --loose)
--rtl
Coerce version strings right to left
--ltr
Coerce version strings left to right (default)
Program exits successfully if any valid version satisfies
all supplied ranges, and prints all satisfying versions.
If no satisfying versions are found, then exits failure.
Versions are printed in ascending order, so supplying
multiple versions to the utility will just sort them.
```
## Versions
A "version" is described by the `v2.0.0` specification found at
<https://semver.org/>.
A leading `"="` or `"v"` character is stripped off and ignored.
Support for stripping a leading "v" is kept for compatibility with `v1.0.0` of the SemVer
specification but should not be used anymore.
## Ranges
A `version range` is a set of `comparators` that specify versions
that satisfy the range.
A `comparator` is composed of an `operator` and a `version`. The set
of primitive `operators` is:
* `<` Less than
* `<=` Less than or equal to
* `>` Greater than
* `>=` Greater than or equal to
* `=` Equal. If no operator is specified, then equality is assumed,
so this operator is optional but MAY be included.
For example, the comparator `>=1.2.7` would match the versions
`1.2.7`, `1.2.8`, `2.5.3`, and `1.3.9`, but not the versions `1.2.6`
or `1.1.0`. The comparator `>1` is equivalent to `>=2.0.0` and
would match the versions `2.0.0` and `3.1.0`, but not the versions
`1.0.1` or `1.1.0`.
Comparators can be joined by whitespace to form a `comparator set`,
which is satisfied by the **intersection** of all of the comparators
it includes.
A range is composed of one or more comparator sets, joined by `||`. A
version matches a range if and only if every comparator in at least
one of the `||`-separated comparator sets is satisfied by the version.
For example, the range `>=1.2.7 <1.3.0` would match the versions
`1.2.7`, `1.2.8`, and `1.2.99`, but not the versions `1.2.6`, `1.3.0`,
or `1.1.0`.
The range `1.2.7 || >=1.2.9 <2.0.0` would match the versions `1.2.7`,
`1.2.9`, and `1.4.6`, but not the versions `1.2.8` or `2.0.0`.
### Prerelease Tags
If a version has a prerelease tag (for example, `1.2.3-alpha.3`) then
it will only be allowed to satisfy comparator sets if at least one
comparator with the same `[major, minor, patch]` tuple also has a
prerelease tag.
For example, the range `>1.2.3-alpha.3` would be allowed to match the
version `1.2.3-alpha.7`, but it would *not* be satisfied by
`3.4.5-alpha.9`, even though `3.4.5-alpha.9` is technically "greater
than" `1.2.3-alpha.3` according to the SemVer sort rules. The version
range only accepts prerelease tags on the `1.2.3` version.
Version `3.4.5` *would* satisfy the range because it does not have a
prerelease flag, and `3.4.5` is greater than `1.2.3-alpha.7`.
The purpose of this behavior is twofold. First, prerelease versions
frequently are updated very quickly, and contain many breaking changes
that are (by the author's design) not yet fit for public consumption.
Therefore, by default, they are excluded from range-matching
semantics.
Second, a user who has opted into using a prerelease version has
indicated the intent to use *that specific* set of
alpha/beta/rc versions. By including a prerelease tag in the range,
the user is indicating that they are aware of the risk. However, it
is still not appropriate to assume that they have opted into taking a
similar risk on the *next* set of prerelease versions.
Note that this behavior can be suppressed (treating all prerelease
versions as if they were normal versions, for range-matching)
by setting the `includePrerelease` flag on the options
object to any
[functions](https://github.com/npm/node-semver#functions) that do
range matching.
#### Prerelease Identifiers
The method `.inc` takes an additional `identifier` string argument that
will append the value of the string as a prerelease identifier:
```javascript
semver.inc('1.2.3', 'prerelease', 'beta')
// '1.2.4-beta.0'
```
command-line example:
```bash
$ semver 1.2.3 -i prerelease --preid beta
1.2.4-beta.0
```
Which then can be used to increment further:
```bash
$ semver 1.2.4-beta.0 -i prerelease
1.2.4-beta.1
```
To get out of the prerelease phase, use the `release` option:
```bash
$ semver 1.2.4-beta.1 -i release
1.2.4
```
#### Prerelease Identifier Base
The method `.inc` takes an optional parameter 'identifierBase' string
that will let you let your prerelease number as zero-based or one-based.
Set to `false` to omit the prerelease number altogether.
If you do not specify this parameter, it will default to zero-based.
```javascript
semver.inc('1.2.3', 'prerelease', 'beta', '1')
// '1.2.4-beta.1'
```
```javascript
semver.inc('1.2.3', 'prerelease', 'beta', false)
// '1.2.4-beta'
```
command-line example:
```bash
$ semver 1.2.3 -i prerelease --preid beta -n 1
1.2.4-beta.1
```
```bash
$ semver 1.2.3 -i prerelease --preid beta -n false
1.2.4-beta
```
### Advanced Range Syntax
Advanced range syntax desugars to primitive comparators in
deterministic ways.
Advanced ranges may be combined in the same way as primitive
comparators using white space or `||`.
#### Hyphen Ranges `X.Y.Z - A.B.C`
Specifies an inclusive set.
* `1.2.3 - 2.3.4` := `>=1.2.3 <=2.3.4`
If a partial version is provided as the first version in the inclusive
range, then the missing pieces are replaced with zeroes.
* `1.2 - 2.3.4` := `>=1.2.0 <=2.3.4`
If a partial version is provided as the second version in the
inclusive range, then all versions that start with the supplied parts
of the tuple are accepted, but nothing that would be greater than the
provided tuple parts.
* `1.2.3 - 2.3` := `>=1.2.3 <2.4.0-0`
* `1.2.3 - 2` := `>=1.2.3 <3.0.0-0`
#### X-Ranges `1.2.x` `1.X` `1.2.*` `*`
Any of `X`, `x`, or `*` may be used to "stand in" for one of the
numeric values in the `[major, minor, patch]` tuple.
* `*` := `>=0.0.0` (Any non-prerelease version satisfies, unless
`includePrerelease` is specified, in which case any version at all
satisfies)
* `1.x` := `>=1.0.0 <2.0.0-0` (Matching major version)
* `1.2.x` := `>=1.2.0 <1.3.0-0` (Matching major and minor versions)
A partial version range is treated as an X-Range, so the special
character is in fact optional.
* `""` (empty string) := `*` := `>=0.0.0`
* `1` := `1.x.x` := `>=1.0.0 <2.0.0-0`
* `1.2` := `1.2.x` := `>=1.2.0 <1.3.0-0`
#### Tilde Ranges `~1.2.3` `~1.2` `~1`
Allows patch-level changes if a minor version is specified on the
comparator. Allows minor-level changes if not.
* `~1.2.3` := `>=1.2.3 <1.(2+1).0` := `>=1.2.3 <1.3.0-0`
* `~1.2` := `>=1.2.0 <1.(2+1).0` := `>=1.2.0 <1.3.0-0` (Same as `1.2.x`)
* `~1` := `>=1.0.0 <(1+1).0.0` := `>=1.0.0 <2.0.0-0` (Same as `1.x`)
* `~0.2.3` := `>=0.2.3 <0.(2+1).0` := `>=0.2.3 <0.3.0-0`
* `~0.2` := `>=0.2.0 <0.(2+1).0` := `>=0.2.0 <0.3.0-0` (Same as `0.2.x`)
* `~0` := `>=0.0.0 <(0+1).0.0` := `>=0.0.0 <1.0.0-0` (Same as `0.x`)
* `~1.2.3-beta.2` := `>=1.2.3-beta.2 <1.3.0-0` Note that prereleases in
the `1.2.3` version will be allowed, if they are greater than or
equal to `beta.2`. So, `1.2.3-beta.4` would be allowed, but
`1.2.4-beta.2` would not, because it is a prerelease of a
different `[major, minor, patch]` tuple.
#### Caret Ranges `^1.2.3` `^0.2.5` `^0.0.4`
Allows changes that do not modify the left-most non-zero element in the
`[major, minor, patch]` tuple. In other words, this allows patch and
minor updates for versions `1.0.0` and above, patch updates for
versions `0.X >=0.1.0`, and *no* updates for versions `0.0.X`.
Many authors treat a `0.x` version as if the `x` were the major
"breaking-change" indicator.
Caret ranges are ideal when an author may make breaking changes
between `0.2.4` and `0.3.0` releases, which is a common practice.
However, it presumes that there will *not* be breaking changes between
`0.2.4` and `0.2.5`. It allows for changes that are presumed to be
additive (but non-breaking), according to commonly observed practices.
* `^1.2.3` := `>=1.2.3 <2.0.0-0`
* `^0.2.3` := `>=0.2.3 <0.3.0-0`
* `^0.0.3` := `>=0.0.3 <0.0.4-0`
* `^1.2.3-beta.2` := `>=1.2.3-beta.2 <2.0.0-0` Note that prereleases in
the `1.2.3` version will be allowed, if they are greater than or
equal to `beta.2`. So, `1.2.3-beta.4` would be allowed, but
`1.2.4-beta.2` would not, because it is a prerelease of a
different `[major, minor, patch]` tuple.
* `^0.0.3-beta` := `>=0.0.3-beta <0.0.4-0` Note that prereleases in the
`0.0.3` version *only* will be allowed, if they are greater than or
equal to `beta`. So, `0.0.3-pr.2` would be allowed.
When parsing caret ranges, a missing `patch` value desugars to the
number `0`, but will allow flexibility within that value, even if the
major and minor versions are both `0`.
* `^1.2.x` := `>=1.2.0 <2.0.0-0`
* `^0.0.x` := `>=0.0.0 <0.1.0-0`
* `^0.0` := `>=0.0.0 <0.1.0-0`
A missing `minor` and `patch` values will desugar to zero, but also
allow flexibility within those values, even if the major version is
zero.
* `^1.x` := `>=1.0.0 <2.0.0-0`
* `^0.x` := `>=0.0.0 <1.0.0-0`
### Range Grammar
Putting all this together, here is a Backus-Naur grammar for ranges,
for the benefit of parser authors:
```bnf
range-set ::= range ( logical-or range ) *
logical-or ::= ( ' ' ) * '||' ( ' ' ) *
range ::= hyphen | simple ( ' ' simple ) * | ''
hyphen ::= partial ' - ' partial
simple ::= primitive | partial | tilde | caret
primitive ::= ( '<' | '>' | '>=' | '<=' | '=' ) partial
partial ::= xr ( '.' xr ( '.' xr qualifier ? )? )?
xr ::= 'x' | 'X' | '*' | nr
nr ::= '0' | ['1'-'9'] ( ['0'-'9'] ) *
tilde ::= '~' partial
caret ::= '^' partial
qualifier ::= ( '-' pre )? ( '+' build )?
pre ::= parts
build ::= parts
parts ::= part ( '.' part ) *
part ::= nr | [-0-9A-Za-z]+
```
## Functions
All methods and classes take a final `options` object argument. All
options in this object are `false` by default. The options supported
are:
- `loose`: Be more forgiving about not-quite-valid semver strings.
(Any resulting output will always be 100% strict compliant, of
course.) For backwards compatibility reasons, if the `options`
argument is a boolean value instead of an object, it is interpreted
to be the `loose` param.
- `includePrerelease`: Set to suppress the [default
behavior](https://github.com/npm/node-semver#prerelease-tags) of
excluding prerelease tagged versions from ranges unless they are
explicitly opted into.
Strict-mode Comparators and Ranges will be strict about the SemVer
strings that they parse.
* `valid(v)`: Return the parsed version, or null if it's not valid.
* `inc(v, releaseType, options, identifier, identifierBase)`:
Return the version incremented by the release
type (`major`, `premajor`, `minor`, `preminor`, `patch`,
`prepatch`, `prerelease`, or `release`), or null if it's not valid
* `premajor` in one call will bump the version up to the next major
version and down to a prerelease of that major version.
`preminor`, and `prepatch` work the same way.
* If called from a non-prerelease version, `prerelease` will work the
same as `prepatch`. It increments the patch version and then makes a
prerelease. If the input version is already a prerelease it simply
increments it.
* `release` will remove any prerelease part of the version.
* `identifier` can be used to prefix `premajor`, `preminor`,
`prepatch`, or `prerelease` version increments. `identifierBase`
is the base to be used for the `prerelease` identifier.
* `prerelease(v)`: Returns an array of prerelease components, or null
if none exist. Example: `prerelease('1.2.3-alpha.1') -> ['alpha', 1]`
* `major(v)`: Return the major version number.
* `minor(v)`: Return the minor version number.
* `patch(v)`: Return the patch version number.
* `intersects(r1, r2, loose)`: Return true if the two supplied ranges
or comparators intersect.
* `parse(v)`: Attempt to parse a string as a semantic version, returning either
a `SemVer` object or `null`.
### Comparison
* `gt(v1, v2)`: `v1 > v2`
* `gte(v1, v2)`: `v1 >= v2`
* `lt(v1, v2)`: `v1 < v2`
* `lte(v1, v2)`: `v1 <= v2`
* `eq(v1, v2)`: `v1 == v2` This is true if they're logically equivalent,
even if they're not the same string. You already know how to
compare strings.
* `neq(v1, v2)`: `v1 != v2` The opposite of `eq`.
* `cmp(v1, comparator, v2)`: Pass in a comparison string, and it'll call
the corresponding function above. `"==="` and `"!=="` do simple
string comparison, but are included for completeness. Throws if an
invalid comparison string is provided.
* `compare(v1, v2)`: Return `0` if `v1 == v2`, or `1` if `v1` is greater, or `-1` if
`v2` is greater. Sorts in ascending order if passed to `Array.sort()`.
* `rcompare(v1, v2)`: The reverse of `compare`. Sorts an array of versions
in descending order when passed to `Array.sort()`.
* `compareBuild(v1, v2)`: The same as `compare` but considers `build` when two versions
are equal. Sorts in ascending order if passed to `Array.sort()`.
* `compareLoose(v1, v2)`: Short for `compare(v1, v2, { loose: true })`.
* `diff(v1, v2)`: Returns the difference between two versions by the release type
(`major`, `premajor`, `minor`, `preminor`, `patch`, `prepatch`, or `prerelease`),
or null if the versions are the same.
### Sorting
* `sort(versions)`: Returns a sorted array of versions based on the `compareBuild`
function.
* `rsort(versions)`: The reverse of `sort`. Returns an array of versions based on
the `compareBuild` function in descending order.
### Comparators
* `intersects(comparator)`: Return true if the comparators intersect
### Ranges
* `validRange(range)`: Return the valid range or null if it's not valid.
* `satisfies(version, range)`: Return true if the version satisfies the
range.
* `maxSatisfying(versions, range)`: Return the highest version in the list
that satisfies the range, or `null` if none of them do.
* `minSatisfying(versions, range)`: Return the lowest version in the list
that satisfies the range, or `null` if none of them do.
* `minVersion(range)`: Return the lowest version that can match
the given range.
* `gtr(version, range)`: Return `true` if the version is greater than all the
versions possible in the range.
* `ltr(version, range)`: Return `true` if the version is less than all the
versions possible in the range.
* `outside(version, range, hilo)`: Return true if the version is outside
the bounds of the range in either the high or low direction. The
`hilo` argument must be either the string `'>'` or `'<'`. (This is
the function called by `gtr` and `ltr`.)
* `intersects(range)`: Return true if any of the range comparators intersect.
* `simplifyRange(versions, range)`: Return a "simplified" range that
matches the same items in the `versions` list as the range specified. Note
that it does *not* guarantee that it would match the same versions in all
cases, only for the set of versions provided. This is useful when
generating ranges by joining together multiple versions with `||`
programmatically, to provide the user with something a bit more
ergonomic. If the provided range is shorter in string-length than the
generated range, then that is returned.
* `subset(subRange, superRange)`: Return `true` if the `subRange` range is
entirely contained by the `superRange` range.
Note that, since ranges may be non-contiguous, a version might not be
greater than a range, less than a range, *or* satisfy a range! For
example, the range `1.2 <1.2.9 || >2.0.0` would have a hole from `1.2.9`
until `2.0.0`, so version `1.2.10` would not be greater than the
range (because `2.0.1` satisfies, which is higher), nor less than the
range (since `1.2.8` satisfies, which is lower), and it also does not
satisfy the range.
If you want to know if a version satisfies or does not satisfy a
range, use the `satisfies(version, range)` function.
### Coercion
* `coerce(version, options)`: Coerces a string to semver if possible
This aims to provide a very forgiving translation of a non-semver string to
semver. It looks for the first digit in a string and consumes all
remaining characters which satisfy at least a partial semver (e.g., `1`,
`1.2`, `1.2.3`) up to the max permitted length (256 characters). Longer
versions are simply truncated (`4.6.3.9.2-alpha2` becomes `4.6.3`). All
surrounding text is simply ignored (`v3.4 replaces v3.3.1` becomes
`3.4.0`). Only text which lacks digits will fail coercion (`version one`
is not valid). The maximum length for any semver component considered for
coercion is 16 characters; longer components will be ignored
(`10000000000000000.4.7.4` becomes `4.7.4`). The maximum value for any
semver component is `Number.MAX_SAFE_INTEGER || (2**53 - 1)`; higher value
components are invalid (`9999999999999999.4.7.4` is likely invalid).
If the `options.rtl` flag is set, then `coerce` will return the right-most
coercible tuple that does not share an ending index with a longer coercible
tuple. For example, `1.2.3.4` will return `2.3.4` in rtl mode, not
`4.0.0`. `1.2.3/4` will return `4.0.0`, because the `4` is not a part of
any other overlapping SemVer tuple.
If the `options.includePrerelease` flag is set, then the `coerce` result will contain
prerelease and build parts of a version. For example, `1.2.3.4-rc.1+rev.2`
will preserve prerelease `rc.1` and build `rev.2` in the result.
### Clean
* `clean(version)`: Clean a string to be a valid semver if possible
This will return a cleaned and trimmed semver version. If the provided
version is not valid a null will be returned. This does not work for
ranges.
ex.
* `s.clean(' = v 2.1.5foo')`: `null`
* `s.clean(' = v 2.1.5foo', { loose: true })`: `'2.1.5-foo'`
* `s.clean(' = v 2.1.5-foo')`: `null`
* `s.clean(' = v 2.1.5-foo', { loose: true })`: `'2.1.5-foo'`
* `s.clean('=v2.1.5')`: `'2.1.5'`
* `s.clean(' =v2.1.5')`: `'2.1.5'`
* `s.clean(' 2.1.5 ')`: `'2.1.5'`
* `s.clean('~1.0.0')`: `null`
## Constants
As a convenience, helper constants are exported to provide information about what `node-semver` supports:
### `RELEASE_TYPES`
- major
- premajor
- minor
- preminor
- patch
- prepatch
- prerelease
```
const semver = require('semver');
if (semver.RELEASE_TYPES.includes(arbitraryUserInput)) {
console.log('This is a valid release type!');
} else {
console.warn('This is NOT a valid release type!');
}
```
### `SEMVER_SPEC_VERSION`
2.0.0
```
const semver = require('semver');
console.log('We are currently using the semver specification version:', semver.SEMVER_SPEC_VERSION);
```
## Exported Modules
<!--
TODO: Make sure that all of these items are documented (classes aren't,
eg), and then pull the module name into the documentation for that specific
thing.
-->
You may pull in just the part of this semver utility that you need if you
are sensitive to packing and tree-shaking concerns. The main
`require('semver')` export uses getter functions to lazily load the parts
of the API that are used.
The following modules are available:
* `require('semver')`
* `require('semver/classes')`
* `require('semver/classes/comparator')`
* `require('semver/classes/range')`
* `require('semver/classes/semver')`
* `require('semver/functions/clean')`
* `require('semver/functions/cmp')`
* `require('semver/functions/coerce')`
* `require('semver/functions/compare')`
* `require('semver/functions/compare-build')`
* `require('semver/functions/compare-loose')`
* `require('semver/functions/diff')`
* `require('semver/functions/eq')`
* `require('semver/functions/gt')`
* `require('semver/functions/gte')`
* `require('semver/functions/inc')`
* `require('semver/functions/lt')`
* `require('semver/functions/lte')`
* `require('semver/functions/major')`
* `require('semver/functions/minor')`
* `require('semver/functions/neq')`
* `require('semver/functions/parse')`
* `require('semver/functions/patch')`
* `require('semver/functions/prerelease')`
* `require('semver/functions/rcompare')`
* `require('semver/functions/rsort')`
* `require('semver/functions/satisfies')`
* `require('semver/functions/sort')`
* `require('semver/functions/valid')`
* `require('semver/ranges/gtr')`
* `require('semver/ranges/intersects')`
* `require('semver/ranges/ltr')`
* `require('semver/ranges/max-satisfying')`
* `require('semver/ranges/min-satisfying')`
* `require('semver/ranges/min-version')`
* `require('semver/ranges/outside')`
* `require('semver/ranges/simplify')`
* `require('semver/ranges/subset')`
* `require('semver/ranges/to-comparators')`
* `require('semver/ranges/valid')`

191
node_modules/nodemon/node_modules/semver/bin/semver.js generated vendored Executable file
View file

@ -0,0 +1,191 @@
#!/usr/bin/env node
// Standalone semver comparison program.
// Exits successfully and prints matching version(s) if
// any supplied version is valid and passes all tests.
'use strict'
const argv = process.argv.slice(2)
let versions = []
const range = []
let inc = null
const version = require('../package.json').version
let loose = false
let includePrerelease = false
let coerce = false
let rtl = false
let identifier
let identifierBase
const semver = require('../')
const parseOptions = require('../internal/parse-options')
let reverse = false
let options = {}
const main = () => {
if (!argv.length) {
return help()
}
while (argv.length) {
let a = argv.shift()
const indexOfEqualSign = a.indexOf('=')
if (indexOfEqualSign !== -1) {
const value = a.slice(indexOfEqualSign + 1)
a = a.slice(0, indexOfEqualSign)
argv.unshift(value)
}
switch (a) {
case '-rv': case '-rev': case '--rev': case '--reverse':
reverse = true
break
case '-l': case '--loose':
loose = true
break
case '-p': case '--include-prerelease':
includePrerelease = true
break
case '-v': case '--version':
versions.push(argv.shift())
break
case '-i': case '--inc': case '--increment':
switch (argv[0]) {
case 'major': case 'minor': case 'patch': case 'prerelease':
case 'premajor': case 'preminor': case 'prepatch':
case 'release':
inc = argv.shift()
break
default:
inc = 'patch'
break
}
break
case '--preid':
identifier = argv.shift()
break
case '-r': case '--range':
range.push(argv.shift())
break
case '-n':
identifierBase = argv.shift()
if (identifierBase === 'false') {
identifierBase = false
}
break
case '-c': case '--coerce':
coerce = true
break
case '--rtl':
rtl = true
break
case '--ltr':
rtl = false
break
case '-h': case '--help': case '-?':
return help()
default:
versions.push(a)
break
}
}
options = parseOptions({ loose, includePrerelease, rtl })
versions = versions.map((v) => {
return coerce ? (semver.coerce(v, options) || { version: v }).version : v
}).filter((v) => {
return semver.valid(v, options)
})
if (!versions.length) {
return fail()
}
if (inc && (versions.length !== 1 || range.length)) {
return failInc()
}
for (let i = 0, l = range.length; i < l; i++) {
versions = versions.filter((v) => {
return semver.satisfies(v, range[i], options)
})
if (!versions.length) {
return fail()
}
}
versions
.sort((a, b) => semver[reverse ? 'rcompare' : 'compare'](a, b, options))
.map(v => semver.clean(v, options))
.map(v => inc ? semver.inc(v, inc, options, identifier, identifierBase) : v)
.forEach(v => console.log(v))
}
const failInc = () => {
console.error('--inc can only be used on a single version with no range')
fail()
}
const fail = () => process.exit(1)
const help = () => console.log(
`SemVer ${version}
A JavaScript implementation of the https://semver.org/ specification
Copyright Isaac Z. Schlueter
Usage: semver [options] <version> [<version> [...]]
Prints valid versions sorted by SemVer precedence
Options:
-r --range <range>
Print versions that match the specified range.
-i --increment [<level>]
Increment a version by the specified level. Level can
be one of: major, minor, patch, premajor, preminor,
prepatch, prerelease, or release. Default level is 'patch'.
Only one version may be specified.
--preid <identifier>
Identifier to be used to prefix premajor, preminor,
prepatch or prerelease version increments.
-l --loose
Interpret versions and ranges loosely
-p --include-prerelease
Always include prerelease versions in range matching
-c --coerce
Coerce a string into SemVer if possible
(does not imply --loose)
--rtl
Coerce version strings right to left
--ltr
Coerce version strings left to right (default)
-n <base>
Base number to be used for the prerelease identifier.
Can be either 0 or 1, or false to omit the number altogether.
Defaults to 0.
Program exits successfully if any valid version satisfies
all supplied ranges, and prints all satisfying versions.
If no satisfying versions are found, then exits failure.
Versions are printed in ascending order, so supplying
multiple versions to the utility will just sort them.`)
main()

143
node_modules/nodemon/node_modules/semver/classes/comparator.js generated vendored Normal file
View file

@ -0,0 +1,143 @@
'use strict'
const ANY = Symbol('SemVer ANY')
// hoisted class for cyclic dependency
class Comparator {
static get ANY () {
return ANY
}
constructor (comp, options) {
options = parseOptions(options)
if (comp instanceof Comparator) {
if (comp.loose === !!options.loose) {
return comp
} else {
comp = comp.value
}
}
comp = comp.trim().split(/\s+/).join(' ')
debug('comparator', comp, options)
this.options = options
this.loose = !!options.loose
this.parse(comp)
if (this.semver === ANY) {
this.value = ''
} else {
this.value = this.operator + this.semver.version
}
debug('comp', this)
}
parse (comp) {
const r = this.options.loose ? re[t.COMPARATORLOOSE] : re[t.COMPARATOR]
const m = comp.match(r)
if (!m) {
throw new TypeError(`Invalid comparator: ${comp}`)
}
this.operator = m[1] !== undefined ? m[1] : ''
if (this.operator === '=') {
this.operator = ''
}
// if it literally is just '>' or '' then allow anything.
if (!m[2]) {
this.semver = ANY
} else {
this.semver = new SemVer(m[2], this.options.loose)
}
}
toString () {
return this.value
}
test (version) {
debug('Comparator.test', version, this.options.loose)
if (this.semver === ANY || version === ANY) {
return true
}
if (typeof version === 'string') {
try {
version = new SemVer(version, this.options)
} catch (er) {
return false
}
}
return cmp(version, this.operator, this.semver, this.options)
}
intersects (comp, options) {
if (!(comp instanceof Comparator)) {
throw new TypeError('a Comparator is required')
}
if (this.operator === '') {
if (this.value === '') {
return true
}
return new Range(comp.value, options).test(this.value)
} else if (comp.operator === '') {
if (comp.value === '') {
return true
}
return new Range(this.value, options).test(comp.semver)
}
options = parseOptions(options)
// Special cases where nothing can possibly be lower
if (options.includePrerelease &&
(this.value === '<0.0.0-0' || comp.value === '<0.0.0-0')) {
return false
}
if (!options.includePrerelease &&
(this.value.startsWith('<0.0.0') || comp.value.startsWith('<0.0.0'))) {
return false
}
// Same direction increasing (> or >=)
if (this.operator.startsWith('>') && comp.operator.startsWith('>')) {
return true
}
// Same direction decreasing (< or <=)
if (this.operator.startsWith('<') && comp.operator.startsWith('<')) {
return true
}
// same SemVer and both sides are inclusive (<= or >=)
if (
(this.semver.version === comp.semver.version) &&
this.operator.includes('=') && comp.operator.includes('=')) {
return true
}
// opposite directions less than
if (cmp(this.semver, '<', comp.semver, options) &&
this.operator.startsWith('>') && comp.operator.startsWith('<')) {
return true
}
// opposite directions greater than
if (cmp(this.semver, '>', comp.semver, options) &&
this.operator.startsWith('<') && comp.operator.startsWith('>')) {
return true
}
return false
}
}
module.exports = Comparator
const parseOptions = require('../internal/parse-options')
const { safeRe: re, t } = require('../internal/re')
const cmp = require('../functions/cmp')
const debug = require('../internal/debug')
const SemVer = require('./semver')
const Range = require('./range')

7
node_modules/nodemon/node_modules/semver/classes/index.js generated vendored Normal file
View file

@ -0,0 +1,7 @@
'use strict'
module.exports = {
SemVer: require('./semver.js'),
Range: require('./range.js'),
Comparator: require('./comparator.js'),
}

Some files were not shown because too many files have changed in this diff Show more